1. (CBSE 2018) Relations: Principal Solutions

Question: Find the principal solutions of the equation tanx=3\tan x = \sqrt{3}.

Explanation: Principal solutions are those in the interval [0,2π)[0, 2\pi).

  1. Identify Quadrants: tanx\tan x is positive in Quadrant I and Quadrant III.

  2. Find Q1 Solution: The base angle α\alpha where tanα=3\tan \alpha = \sqrt{3} is α=π/3\alpha = \pi/3.

  3. Find Q3 Solution: The rule for Q3 is π+α\pi + \alpha. So, x=π+π/3=4π/3x = \pi + \pi/3 = 4\pi/3.

Answer: The principal solutions are π/3\pi/3 and 4π/34\pi/3.

2. (CBSE 2019) Relations: Principal Solutions

Question: Find the principal solutions of secx=2\sec x = 2.

Explanation:

  1. Convert to Cosine: The equation secx=2\sec x = 2 is equivalent to cosx=1/2\cos x = 1/2.

  2. Identify Quadrants: cosx\cos x is positive in Q1 and Q4.

  3. Find Q1 Solution: The angle is x=π/3x = \pi/3.

  4. Find Q4 Solution: The rule is 2πα2\pi - \alpha. So, x=2ππ/3=5π/3x = 2\pi - \pi/3 = 5\pi/3.

Answer: The principal solutions are π/3\pi/3 and 5π/35\pi/3.

3. (CBSE 2020) Relations: General Solution

Question: Find the general solution of the equation cos(4x)=cos(2x)\cos(4x) = \cos(2x).

Explanation: We use the general solution for cosA=cosB\cos A = \cos B, which is A=2nπ±BA = 2n\pi \pm B.

Here, A=4x,B=2xA=4x, B=2x. So, 4x=2nπ±2x4x = 2n\pi \pm 2x.

  • Case 1 (+):

    4x=2nπ+2x4x = 2n\pi + 2x

        2x=2nπ    x=nπ\implies 2x = 2n\pi \implies x=n\pi.

  • Case 2 (-):

    4x=2nπ2x4x = 2n\pi - 2x

        6x=2nπ    x=nπ/3\implies 6x = 2n\pi \implies x=n\pi/3.

The set of solutions {nπ}\{n\pi\} is a subset of {nπ/3}\{n\pi/3\}. The complete general solution is the larger set.

Answer: The general solution is x=nπ/3,nZx=n\pi/3, n \in \mathbb{Z}.

4. (CBSE 2017) Relations: General Solution

Question: Find the general solution of the equation sinx=32\sin x = -\frac{\sqrt{3}}{2}.

Explanation:

  1. Find a Principal Value: We need an angle α\alpha such that sinα=3/2\sin\alpha = -\sqrt{3}/2. We can choose the angle in Q4, α=π/3\alpha = -\pi/3.

  2. Apply General Formula: The solution for sinx=sinα\sin x = \sin\alpha is x=nπ+(1)nαx = n\pi + (-1)^n \alpha

  3. Substitute: x=nπ+(1)n(π/3)x = n\pi + (-1)^n(-\pi/3) =nπ(1)n(π/3)= n\pi - (-1)^n(\pi/3)

Answer: x=nπ(1)n(π/3),nZx = n\pi - (-1)^n (\pi/3), n \in \mathbb{Z}.

5. (CBSE 2022) Relations: General Solution

Question: Find the general solution of the equation tan(3x)=1\tan(3x) = -1.

Explanation:

  1. Find Principal Value: We know tan(π/4)=1\tan(\pi/4)=1. Since tangent is an odd function, tan(π/4)=1\tan(-\pi/4)=-1. So, we can write tan(3x)=tan(π/4)\tan(3x) = \tan(-\pi/4).

  2. Apply General Formula: For tanA=tanB\tan A = \tan B, the solution is A=nπ+BA = n\pi + B.

    3x=nππ/43x = n\pi - \pi/4.

  3. Solve for x: Divide by 3.

Answer: x=nπ3π12,nZx = \frac{n\pi}{3} - \frac{\pi}{12}, n \in \mathbb{Z}

6. (CBSE Sample Paper) Relations: Squared Functions

Question: Find the general solution of sin2(2x)=1/4\sin^2(2x) = 1/4.

Explanation:

  1. Find Principal Value: sin2(2x)=(1/2)2\sin^2(2x) = (1/2)^2. We know sin(π/6)=1/2\sin(\pi/6) = 1/2. So, the equation is sin2(2x)=sin2(π/6)\sin^2(2x) = \sin^2(\pi/6)

  2. Apply General Formula: The solution for sin2A=sin2α\sin^2A = \sin^2\alpha is A=nπ±αA = n\pi \pm \alpha

    Here, A=2x,α=π/6A=2x, \alpha=\pi/6. So, 2x=nπ±π/62x = n\pi \pm \pi/6.

  3. Solve for x: Divide by 2.

Answer: x=nπ2±π12,nZx = \frac{n\pi}{2} \pm \frac{\pi}{12}, n \in \mathbb{Z}

7. (CBSE 2018) Equations Reducible to Simpler Forms

Question: Solve the equation 2cos2x+3sinx=02\cos^2x + 3\sin x = 0.

Explanation:

  1. Convert to a single function: Use cos2x=1sin2x\cos^2x = 1-\sin^2x. The equation becomes 2(1sin2x)+3sinx=02(1-\sin^2x) + 3\sin x = 0

  2. Form a quadratic: 22sin2x+3sinx=02-2\sin^2x+3\sin x=0     2sin2x3sinx2=0\implies 2\sin^2x - 3\sin x - 2 = 0

  3. Solve the quadratic: Let y=sinxy=\sin x. We have 2y23y2=02y^2-3y-2=0, which factors as (2y+1)(y2)=0(2y+1)(y-2)=0. The solutions are y=1/2y=-1/2 and y=2y=2.

  4. Find valid solutions: This means sinx=1/2\sin x = -1/2 or sinx=2\sin x = 2. Since the range of sine is [1,1][-1, 1], sinx=2\sin x = 2 is impossible.

  5. Find the general solution: For sinx=1/2=sin(π/6)\sin x = -1/2 = \sin(-\pi/6), the general solution is x=nπ+(1)n+1(π/6)x = n\pi + (-1)^{n+1} (\pi/6)

Answer: x=nπ+(1)n+1(π/6),nZx = n\pi + (-1)^{n+1} (\pi/6), n \in \mathbb{Z}.

8. (CBSE 2021) Equations Reducible to Simpler Forms

Question: Find the number of solutions of the equation 2sin2x+5sinx3=02\sin^2x + 5\sin x - 3 = 0 in the interval [0,3π][0, 3\pi].

Explanation:

  1. Solve the Quadratic: Let y=sinxy=\sin x. The equation is 2y2+5y3=02y^2+5y-3=0, which factors to (2y1)(y+3)=0(2y-1)(y+3)=0. This gives sinx=1/2\sin x = 1/2 or sinx=3\sin x = -3. The second case is impossible.

  2. Find Solutions for sinx=1/2\sin x = 1/2: We need to find all angles in [0,3π][0, 3\pi] where the sine is 1/2.

    • In [0,2π][0, 2\pi]: Solutions are in Q1 and Q2, which are π/6\pi/6 and 5π/65\pi/6.

    • In [2π,4π][2\pi, 4\pi]: The next solutions are 2π+π/6=13π/62\pi+\pi/6 = 13\pi/6 and 2π+5π/6=17π/62\pi+5\pi/6 = 17\pi/6.

  3. Check Interval: The interval is [0,3π][0, 3\pi]. Since 3π=18π/63\pi = 18\pi/6, all four solutions found (π/6,5π/6,13π/6,17π/6\pi/6, 5\pi/6, 13\pi/6, 17\pi/6) are within this interval.

Answer: There are 4 solutions.

9. (CBSE 2019) Equations Reducible to Simpler Forms

Question: Solve sinx+sin(3x)+sin(5x)=0\sin x + \sin(3x) + \sin(5x) = 0.

Explanation:

  1. Group and apply sum-to-product: Group (sin(5x)+sinx)(\sin(5x)+\sin x). Use sinA+sinB=2sin((A+B)/2)cos((AB)/2)\sin A + \sin B = 2\sin((A+B)/2)\cos((A-B)/2) 2sin(3x)cos(2x)+sin(3x)=02\sin(3x)\cos(2x) + \sin(3x) = 0     sin(3x)(2cos(2x)+1)=0\implies \sin(3x)(2\cos(2x)+1)=0
  2. Solve the two cases:
    • Case 1: sin(3x)=0    3x=nπ    x=nπ/3\sin(3x)=0 \implies 3x=n\pi \implies x=n\pi/3
    • Case 2: 2cos(2x)+1=0    cos(2x)=1/22\cos(2x)+1=0 \implies \cos(2x)=-1/2 The general solution is 2x=2nπ±2π/3    x=nπ±π/32x=2n\pi \pm 2\pi/3 \implies x=n\pi \pm \pi/3

Answer: The solutions are x=nπ/3x=n\pi/3 and x=nπ±π/3x=n\pi \pm \pi/3.

10. (CBSE 2016) Equations Reducible to Simpler Forms

Question: Solve the equation tanx+cotx=2\tan x + \cot x = 2.

Explanation:

  1. Convert to Sine and Cosine: sinxcosx+cosxsinx=2\frac{\sin x}{\cos x} + \frac{\cos x}{\sin x} = 2

  2. Simplify: sin2x+cos2xsinxcosx=2    1sinxcosx=2\frac{\sin^2x + \cos^2x}{\sin x \cos x} = 2 \implies \frac{1}{\sin x \cos x} = 2

  3. Use Double Angle Identity: Rearrange to 1=2sinxcosx1=2\sin x \cos x, which is sin(2x)=1\sin(2x) = 1.

  4. Find General Solution: The general solution for sinθ=1\sin\theta=1 is θ=2nπ+π/2\theta = 2n\pi + \pi/2 2x=2nπ+π/22x = 2n\pi + \pi/2 Dividing by 2 gives the final answer.

Answer: x=nπ+π/4x = n\pi + \pi/4

11. (CBSE 2017) Equations Reducible to Simpler Forms

Question: Solve the equation cos(2x)+3cosx=1\cos(2x) + 3\cos x = 1.

Explanation:

  1. Use Double Angle Identity: Substitute cos(2x)=2cos2x1\cos(2x) = 2\cos^2x-1

    2cos2x1+3cosx=12\cos^2x-1+3\cos x=1     2cos2x+3cosx2=0\implies 2\cos^2x+3\cos x-2=0

  2. Solve the Quadratic: Let y=cosxy=\cos x. The equation 2y2+3y2=02y^2+3y-2=0 factors as (2y1)(y+2)=0(2y-1)(y+2)=0 The solutions are y=1/2y=1/2 and y=2y=-2.

  3. Find Valid Solutions: This means cosx=1/2\cos x=1/2 or cosx=2\cos x=-2. The second case is impossible.

  4. Find General Solution: For cosx=1/2\cos x=1/2, the principal value is π/3\pi/3. The general solution is x=2nπ±π/3x=2n\pi \pm \pi/3

Answer: x=2nπ±π/3x=2n\pi \pm \pi/3

12. (CBSE 2020) Equations Reducible to Simpler Forms

Question: Find the general solution of the equation sin(2x)+sin(4x)=2sin(3x)\sin(2x) + \sin(4x) = 2\sin(3x).

Explanation:

  1. Apply Sum-to-Product to LHS: Use sinA+sinB=2sin((A+B)/2)cos((AB)/2)\sin A + \sin B = 2\sin((A+B)/2)\cos((A-B)/2) 2sin(3x)cos(x)=2sin(3x)2\sin(3x)\cos(-x) = 2\sin(3x) Since cos(x)=cosx\cos(-x)=\cos x, this is 2sin(3x)cos(x)=2sin(3x)2\sin(3x)\cos(x) = 2\sin(3x)     2sin(3x)cos(x)2sin(3x)=0\implies 2\sin(3x)\cos(x) - 2\sin(3x) = 0     2sin(3x)(cosx1)=0\implies 2\sin(3x)(\cos x - 1) = 0

  2. Solve the two cases:

    • Case 1: sin(3x)=0    3x=nπ    x=nπ/3\sin(3x)=0 \implies 3x=n\pi \implies x=n\pi/3.

    • Case 2: cosx1=0    cosx=1    x=2nπ\cos x - 1 = 0 \implies \cos x = 1 \implies x=2n\pi.

  3. Combine Solutions: The second set of solutions, x=2nπx=2n\pi, is a subset of the first, x=nπ/3x=n\pi/3 (when nn is a multiple of 6). The complete solution is the larger set.

Answer: x=nπ/3x=n\pi/3.

13. (CBSE 2015) Equations Reducible to Simpler Forms

Question: Solve cos(4x)=sin(2x)\cos(4x) = \sin(2x).

Explanation:

  1. Convert to a single function: Use the cofunction identity sin(2x)=cos(π/22x)\sin(2x) = \cos(\pi/2 - 2x). The equation becomes cos(4x)=cos(π/22x)\cos(4x) = \cos(\pi/2 - 2x)
  2. Apply General Solution for Cosine: For cosA=cosB\cos A = \cos B, the solution is A=2nπ±BA=2n\pi \pm B. 4x=2nπ±(π/22x)4x = 2n\pi \pm (\pi/2-2x)
  3. Solve the two cases:
    • Case 1 (+): 4x=2nπ+π/22x4x = 2n\pi + \pi/2 - 2x     6x=(4n+1)π/2\implies 6x = (4n+1)\pi/2     x=(4n+1)π/12\implies x = (4n+1)\pi/12
    • Case 2 (-): 4x=2nπ(π/22x)4x = 2n\pi - (\pi/2 - 2x)     2x=(4n1)π/2\implies 2x = (4n-1)\pi/2     x=(4n1)π/4\implies x = (4n-1)\pi/4

Answer: The solutions are x=(4n+1)π/12x=(4n+1)\pi/12 and x=(4n1)π/4x=(4n-1)\pi/4

14. (CBSE 2019) Equations of the Form asinx+bcosx=ca\sin x + b\cos x = c

Question: Find the general solution for sinx+cosx=1\sin x + \cos x = 1.

Explanation:

  1. Normalize: Divide the equation by a2+b2=12+12=2\sqrt{a^2+b^2} = \sqrt{1^2+1^2} = \sqrt{2}. 12sinx+12cosx=12\frac{1}{\sqrt{2}}\sin x + \frac{1}{\sqrt{2}}\cos x = \frac{1}{\sqrt{2}}
  2. Convert to a Single Function: Recognize that 1/2=cos(π/4)=sin(π/4)1/\sqrt{2} = \cos(\pi/4) = \sin(\pi/4). We can use either the sin or cos sum formula. Let's use cos(AB)=cosAcosB+sinAsinB\cos(A-B) = \cos A \cos B + \sin A \sin B cosxcos(π/4)+sinxsin(π/4)=cos(xπ/4)=1/2\cos x\cos(\pi/4) + \sin x\sin(\pi/4) = \cos(x-\pi/4) = 1/\sqrt{2}
  3. Solve: The equation is cos(xπ/4)=cos(π/4)\cos(x-\pi/4) = \cos(\pi/4) The general solution is xπ/4=2nπ±π/4x-\pi/4 = 2n\pi \pm \pi/4
    • Case 1 (+): xπ/4=2nπ+π/4x-\pi/4 = 2n\pi + \pi/4     x=2nπ+π/2\implies x=2n\pi+\pi/2
    • Case 2 (-): xπ/4=2nππ/4x-\pi/4 = 2n\pi - \pi/4     x=2nπ\implies x=2n\pi

Answer: x=2nπ+π/2x=2n\pi+\pi/2 and x=2nπx=2n\pi.

15. (CBSE 2018) Equations of the Form asinx+bcosx=ca\sin x + b\cos x = c

Question: Solve the equation sinxcosx=1\sin x - \cos x = -1.

Explanation:

  1. Normalize: Divide by 12+(1)2=2\sqrt{1^2+(-1)^2} = \sqrt{2}. 12sinx12cosx=12\frac{1}{\sqrt{2}}\sin x - \frac{1}{\sqrt{2}}\cos x = -\frac{1}{\sqrt{2}}
  2. Convert: This can be written as sinxcos(π/4)cosxsin(π/4)=sin(xπ/4)\sin x\cos(\pi/4) - \cos x\sin(\pi/4) = \sin(x-\pi/4) So, sin(xπ/4)=1/2=sin(π/4)\sin(x-\pi/4) = -1/\sqrt{2} = \sin(-\pi/4)
  3. Solve: The general solution for sinA=sinB\sin A = \sin B is A=nπ+(1)nBA = n\pi + (-1)^n B. xπ/4=nπ+(1)n(π/4)x-\pi/4 = n\pi + (-1)^n(-\pi/4)

Answer: x=nπ+π/4(1)n(π/4)x = n\pi + \pi/4 - (-1)^n (\pi/4)

16. (CBSE 2021) Equations of the Form asinx+bcosx=ca\sin x + b\cos x = c

Question: Find the number of solutions of cosx+3sinx=2\cos x + \sqrt{3}\sin x = 2 in the interval [0,2π][0, 2\pi].

Explanation:

  1. Normalize: Divide by 12+(3)2=2\sqrt{1^2+(\sqrt{3})^2} = 2. This gives 12cosx+32sinx=1\frac{1}{2}\cos x + \frac{\sqrt{3}}{2}\sin x = 1
  2. Convert: This can be written as sin(π/6)cosx+cos(π/6)sinx=sin(x+π/6)\sin(\pi/6)\cos x + \cos(\pi/6)\sin x = \sin(x+\pi/6) So, sin(x+π/6)=1\sin(x+\pi/6)=1
  3. Solve: The only way sine can be 1 is if the angle is π/2\pi/2 plus any full rotation. So, x+π/6=2nπ+π/2x+\pi/6 = 2n\pi+\pi/2 x=2nπ+π/2π/6=2nπ+π/3x=2n\pi+\pi/2 - \pi/6 = 2n\pi+\pi/3
  4. Find Solution in Interval: For n=0n=0, we get x=π/3x=\pi/3. All other integer values of nn give solutions outside [0,2π][0, 2\pi].

Answer: There is 1 solution.

17. (CBSE 2017) Equations of the Form asinx+bcosx=ca\sin x + b\cos x = c

Question: For what values of k does the equation 3cosx+4sinx=k3\cos x + 4\sin x = k have a solution?

Explanation: An expression of the form acosx+bsinxa\cos x + b\sin x can be converted to Rcos(xα)R\cos(x-\alpha) where R=a2+b2R = \sqrt{a^2+b^2}.

Here, a=3,b=4a=3, b=4, so R=32+42=5R = \sqrt{3^2+4^2}=5. The expression is equivalent to 5cos(xα)5\cos(x-\alpha), for some angle α\alpha.

The range of the cosine function is [1,1][-1, 1]. Therefore, the range of 5cos(xα)5\cos(x-\alpha) is [5,5][-5, 5].

For the equation to have a solution, the value of kk must be within this range.

Answer: The solution exists for k[5,5]k \in [-5, 5].

18. (CBSE 2022) Equations of the Form asinx+bcosx=ca\sin x + b\cos x = c

Question: Solve tanx+secx=3\tan x + \sec x = \sqrt{3}.

Explanation:

  1. Convert and Simplify: sinx+1cosx=3\frac{\sin x+1}{\cos x} = \sqrt{3}     sinx+1=3cosx\implies \sin x+1 = \sqrt{3}\cos x This gives 3cosxsinx=1\sqrt{3}\cos x - \sin x = 1

  2. Normalize: Divide by (3)2+(1)2=2\sqrt{(\sqrt{3})^2+(-1)^2} = 2. We get 32cosx12sinx=1/2\frac{\sqrt{3}}{2}\cos x - \frac{1}{2}\sin x = 1/2

  3. Convert: This is in the form cosAcosBsinAsinB=cos(A+B)\cos A \cos B - \sin A \sin B = \cos(A+B) Let B=π/6B=\pi/6. The equation is cos(x+π/6)=1/2=cos(π/3)\cos(x+\pi/6)=1/2 = \cos(\pi/3)

  4. Solve: The general solution is x+π/6=2nπ±π/3x+\pi/6=2n\pi\pm\pi/3

    • Case 1 (+): x=2nπ+π/3π/6=2nπ+π/6x=2n\pi+\pi/3-\pi/6 = 2n\pi+\pi/6.

    • Case 2 (-): x=2nππ/3π/6=2nππ/2x=2n\pi-\pi/3-\pi/6 = 2n\pi-\pi/2.

We must check for extraneous solutions where cosx=0\cos x=0. The second case, x=2nππ/2x=2n\pi-\pi/2, gives odd multiples of π/2\pi/2, so it is rejected.

Answer: The general solution is x=2nπ+π/6x = 2n\pi+\pi/6

19. (CBSE 2023) Miscellaneous Examples

Question: Find the sum of solutions of cos(2x)=sinx\cos(2x)=\sin x in [0,2π][0,2\pi].

Explanation:

  1. Form a Quadratic: Use cos(2x)=12sin2x\cos(2x)=1-2\sin^2x. The equation becomes 12sin2x=sinx1-2\sin^2x=\sin x     2sin2x+sinx1=0\implies 2\sin^2x+\sin x-1=0.

  2. Solve for sinx\sin x: Factoring gives (2sinx1)(sinx+1)=0(2\sin x-1)(\sin x+1)=0 So, sinx=1/2\sin x=1/2 or sinx=1\sin x=-1.

  3. Find Solutions in [0,2π][0,2\pi]:

    • For sinx=1/2\sin x=1/2, the solutions are x=π/6x=\pi/6 and x=5π/6x=5\pi/6.

    • For sinx=1\sin x=-1, the solution is x=3π/2x=3\pi/2.

  4. Calculate the Sum: Sum=π/6+5π/6+3π/2Sum = \pi/6 + 5\pi/6 + 3\pi/2 =6π/6+3π/2= 6\pi/6 + 3\pi/2 =π+3π/2=5π/2= \pi+3\pi/2=5\pi/2

Answer: 5π/25\pi/2

20. (CBSE 2015) Miscellaneous Examples

Question: Solve sin4x+cos4x=1/2\sin^4x + \cos^4x = 1/2.

Explanation:

  1. Use Algebraic Identity: sin4x+cos4x=(sin2x+cos2x)22sin2xcos2x\sin^4x + \cos^4x = (\sin^2x+\cos^2x)^2 - 2\sin^2x\cos^2x =12sin2xcos2x= 1 - 2\sin^2x\cos^2x

  2. Simplify: 12sin2xcos2x=1/21-2\sin^2x\cos^2x = 1/2     2sin2xcos2x=1/2\implies 2\sin^2x\cos^2x=1/2

  3. Use Double Angle Identity: Multiply by 2: 4sin2xcos2x=14\sin^2x\cos^2x=1     (2sinxcosx)2=1\implies (2\sin x\cos x)^2=1     sin2(2x)=1\implies \sin^2(2x)=1

  4. Solve: This means sin(2x)=±1\sin(2x)=\pm 1. This occurs when 2x2x is an odd multiple of π/2\pi/2.

    So, 2x=(2n+1)π/22x = (2n+1)\pi/2.

Answer: x=(2n+1)π/4x=(2n+1)\pi/4

21. (CBSE 2018) Miscellaneous Examples

Question: Find the number of solutions of cosx=2[x]|\cos x| = 2[x] where [.] is the GIF.

Explanation:

  1. Analyze Ranges: The range of the LHS, cosx|\cos x|, is [0,1][0,1]. The RHS, 2[x]2[x], produces only even integer values (…, -2, 0, 2, …).

  2. Find Common Value: The only value that is in both the range of the LHS and the set of possible values for the RHS is 0.

  3. Solve the System: We must have both sides equal to 0 simultaneously.

    • cosx=0    cosx=0    x=(2n+1)π/2|\cos x|=0 \implies \cos x = 0 \implies x = (2n+1)\pi/2.

    • 2[x]=0    [x]=02[x]=0 \implies [x]=0. This is true for all xx in the interval 0x<10 \le x < 1.

  4. Find Intersection: We need a solution for cosx=0\cos x=0 that lies in the interval [0,1)[0,1). The smallest positive solution for cosx=0\cos x=0 is x=π/21.57x=\pi/2 \approx 1.57, which is not in the interval. There is no intersection.

Answer: There are no solutions.

22. (CBSE 2019) Miscellaneous Examples

Question: Find the general solution of the equation 2sinxtanx+2sinxtanx1=02\sin x\tan x + 2\sin x - \tan x - 1 = 0.

Explanation:

  1. Factor by Grouping: (2sinxtanxtanx)+(2sinx1)=0(2\sin x\tan x - \tan x) + (2\sin x - 1) = 0     tanx(2sinx1)+1(2sinx1)=0\implies \tan x(2\sin x - 1) + 1(2\sin x - 1) = 0     (2sinx1)(tanx+1)=0\implies (2\sin x-1)(\tan x+1)=0
  2. Solve the two cases:
    • Case 1: 2sinx1=02\sin x-1=0     sinx=1/2\implies \sin x=1/2 The general solution is x=nπ+(1)nπ/6x=n\pi+(-1)^n\pi/6
    • Case 2: tanx+1=0\tan x+1=0     tanx=1\implies \tan x=-1 The general solution is x=nππ/4x=n\pi-\pi/4

Answer: x=nπ+(1)nπ/6x=n\pi+(-1)^n\pi/6 and x=nππ/4x=n\pi-\pi/4

23. (CBSE 2020) Miscellaneous Examples

Question: Find the sum of the principal solutions of the equation cot2x+3sinx+3=0\cot^2x + \frac{3}{\sin x} + 3 = 0

Explanation:

  1. Convert to a single function: Use cot2x=csc2x1\cot^2x = \csc^2x - 1. (csc2x1)+3cscx+3=0(\csc^2x-1) + 3\csc x + 3 = 0     csc2x+3cscx+2=0\implies \csc^2x+3\csc x+2=0

  2. Solve the Quadratic: Let y=cscxy=\csc x. y2+3y+2=0y^2+3y+2=0     (y+1)(y+2)=0\implies (y+1)(y+2)=0 So, y=1y=-1 or y=2y=-2.

  3. Find sinx\sin x values: This means cscx=1    sinx=1\csc x=-1 \implies \sin x=-1,

    or cscx=2    sinx=1/2\csc x=-2 \implies \sin x=-1/2.

  4. Find Principal Solutions in [0,2π)[0, 2\pi):

    • For sinx=1\sin x=-1, the solution is x=3π/2x=3\pi/2.
    • For sinx=1/2\sin x=-1/2, solutions are in Q3 and Q4. Reference angle is π/6\pi/6.

    Solutions are x=π+π/6=7π/6x=\pi+\pi/6 = 7\pi/6 and x=2ππ/6=11π/6x=2\pi-\pi/6 = 11\pi/6.

  5. Calculate the Sum: Sum=3π/2+7π/6+11π/6Sum = 3\pi/2 + 7\pi/6 + 11\pi/6 =9π/6+7π/6+11π/6= 9\pi/6+7\pi/6+11\pi/6 =27π/6=9π/2= 27\pi/6 = 9\pi/2

Answer: 9π/29\pi/2.

24. (CBSE 2022) Miscellaneous Examples

Question: Solve tanθ+tan(2θ)+tanθtan(2θ)=1\tan\theta + \tan(2\theta) + \tan\theta\tan(2\theta) = 1.

Explanation:

  1. Rearrange the Equation: The structure resembles the tangent addition formula. tanθ+tan(2θ)=1tanθtan(2θ)\tan\theta+\tan(2\theta) = 1-\tan\theta\tan(2\theta)     tanθ+tan(2θ)1tanθtan(2θ)=1\implies \frac{\tan\theta+\tan(2\theta)}{1-\tan\theta\tan(2\theta)}=1

  2. Apply Identity: The LHS is the formula for tan(θ+2θ)=tan(3θ)\tan(\theta+2\theta) = \tan(3\theta) So, tan(3θ)=1\tan(3\theta)=1.

  3. Find General Solution: The general solution for tanA=1\tan A=1 is A=nπ+π/4A=n\pi+\pi/4

    So, 3θ=nπ+π/43\theta=n\pi+\pi/4.

Answer: θ=nπ/3+π/12\theta = n\pi/3+\pi/12

25. (CBSE 2021) Miscellaneous Examples

Question: Find the number of solutions of the equation cosx+cosy=2\cos x + \cos y = 2 in the interval [0,2π][0, 2\pi].

Explanation: The maximum value of the cosine function is 1. For the sum of two cosine terms to be 2, both must be at their maximum value simultaneously.

  • cosx=1    x=0,2π\cos x = 1 \implies x=0, 2\pi in the interval [0,2π][0, 2\pi].
  • cosy=1    y=0,2π\cos y = 1 \implies y=0, 2\pi in the interval [0,2π][0, 2\pi].

The solutions are ordered pairs (x,y). We can form pairs using these values:

(0,0), (0, 2π\pi), (2π\pi, 0), and (2π\pi, 2π\pi).

Answer: There are 4 solution pairs (x,y).

26. (CBSE Sample Paper) Miscellaneous Examples

Question: Solve 3tan2x1=03\tan^2x - 1 = 0.

Explanation:

  1. Solve for tan2x\tan^2x: tan2x=1/3\tan^2x=1/3.

  2. Find Principal Value: tan2x=(1/3)2=tan2(π/6)\tan^2x = (1/\sqrt{3})^2 = \tan^2(\pi/6) So, α=π/6\alpha=\pi/6.

  3. Apply General Formula: The general solution for tan2x=tan2α\tan^2x=\tan^2\alpha is x=nπ±αx = n\pi \pm \alpha

Answer: x=nπ±π/6,nZx = n\pi \pm \pi/6, n \in \mathbb{Z}

27. (CBSE 2017) Miscellaneous Examples

Question: If 3tan(2θ)+3tan(3θ)+tan(2θ)tan(3θ)=1\sqrt{3}\tan(2\theta) + \sqrt{3}\tan(3\theta) + \tan(2\theta)\tan(3\theta)=1, find the general value of θ\theta.

Explanation:

  1. Rearrange: 3(tan(2θ)+tan(3θ))=1tan(2θ)tan(3θ)\sqrt{3}(\tan(2\theta)+\tan(3\theta))=1-\tan(2\theta)\tan(3\theta)

  2. Form Tangent Sum: tan(2θ)+tan(3θ)1tan(2θ)tan(3θ)=1/3\frac{\tan(2\theta)+\tan(3\theta)}{1-\tan(2\theta)\tan(3\theta)}=1/\sqrt{3}

  3. Apply Identity: The LHS is tan(2θ+3θ)=tan(5θ)\tan(2\theta+3\theta) = \tan(5\theta) So, tan(5θ)=1/3\tan(5\theta)=1/\sqrt{3}.

  4. Solve: The principal value for tanA=1/3\tan A=1/\sqrt{3} is A=π/6A=\pi/6.

    The general solution is 5θ=nπ+π/65\theta=n\pi+\pi/6.

Answer: θ=nπ/5+π/30\theta=n\pi/5+\pi/30

28. (CBSE 2019) Miscellaneous Examples

Question: How many solutions does the equation 3sin2x7sinx+2=03\sin^2x-7\sin x+2=0 have in the interval [0,5π][0, 5\pi]?

Explanation:

  1. Solve the Quadratic: Let y=sinxy=\sin x. 3y27y+2=03y^2-7y+2=0     (3y1)(y2)=0\implies (3y-1)(y-2)=0 Since sinx=2\sin x=2 is not possible, we solve sinx=1/3\sin x=1/3.

  2. Count Solutions per Cycle: The value 1/31/3 is positive and less than 1. The equation sinx=1/3\sin x = 1/3 has two solutions in each interval of length 2π2\pi: one in Q1 and one in Q2.

  3. Count Solutions in [0,5π][0, 5\pi]: We break the interval down:

    • [0,2π][0, 2\pi]: Two solutions.

    • [2π,4π][2\pi, 4\pi]: Two solutions.

    • [4π,5π][4\pi, 5\pi]: This interval covers Q1 and Q2 of the next cycle. Since sinx\sin x is positive in both these quadrants, there are two more solutions (one near 4π4\pi and one near 5π5\pi).

    Total solutions = 2+2+2=62+2+2=6.

Answer: There are 6 solutions.

29. (CBSE 2021) Miscellaneous Examples

Question: Solve for x: cosx+sinx=cos(2x)+sin(2x)\cos x + \sin x = \cos(2x)+\sin(2x).

Explanation:

  1. Rearrange: Group the cosine and sine terms: cosxcos(2x)=sin(2x)sinx\cos x - \cos(2x) = \sin(2x)-\sin x.
  2. Apply Sum-to-Product Formulas: LHS=2sin(3x/2)sin(x/2)LHS = -2\sin(3x/2)\sin(-x/2) =2sin(3x/2)sin(x/2)= 2\sin(3x/2)\sin(x/2) RHS=2cos(3x/2)sin(x/2)RHS= 2\cos(3x/2)\sin(x/2)
  3. Solve the Equation: 2sin(3x/2)sin(x/2)=2cos(3x/2)sin(x/2)2\sin(3x/2)\sin(x/2) = 2\cos(3x/2)\sin(x/2) sin(x/2)[sin(3x/2)cos(3x/2)]=0\sin(x/2) [ \sin(3x/2)-\cos(3x/2) ] = 0
  4. Find Solutions:
    • Case 1: sin(x/2)=0    x/2=nπ    x=2nπ\sin(x/2)=0 \implies x/2=n\pi \implies x=2n\pi.
    • Case 2: sin(3x/2)=cos(3x/2)    tan(3x/2)=1\sin(3x/2)=\cos(3x/2) \implies \tan(3x/2)=1.

This gives 3x/2=nπ+π/4    x=2nπ/3+π/63x/2=n\pi+\pi/4 \implies x=2n\pi/3+\pi/6.

Answer: x=2nπx=2n\pi and x=2nπ/3+π/6x=2n\pi/3+\pi/6.

30. (CBSE 2023) Miscellaneous Examples

Question: Find the number of solutions of cosx=1+sinx\cos x = |1+\sin x| in [0,3π][0, 3\pi].

Explanation:

  1. Simplify the Absolute Value: In the interval [0,3π][0, 3\pi], the value of sinx\sin x is always in [1,1][-1, 1]. Therefore, the term 1+sinx1+\sin x is always non-negative ([0,2][0, 2]). So, 1+sinx=1+sinx|1+\sin x|=1+\sin x.

  2. Solve the Equation: The equation becomes cosx=1+sinx\cos x = 1+\sin x     cosxsinx=1\implies \cos x - \sin x = 1

  3. Normalize: Divide by 12+(1)2=2\sqrt{1^2+(-1)^2}=\sqrt{2}. 12cosx12sinx=12\frac{1}{\sqrt{2}}\cos x - \frac{1}{\sqrt{2}}\sin x = \frac{1}{\sqrt{2}}

  4. Convert and Find General Solution: This is cos(x+π/4)=1/2=cos(π/4)\cos(x+\pi/4) = 1/\sqrt{2} = \cos(\pi/4) The general solution is x+π/4=2nπ±π/4x+\pi/4 = 2n\pi \pm \pi/4

    • Case 1 (+): x=2nπx = 2n\pi.
    • Case 2 (-): x=2nππ/2x = 2n\pi - \pi/2.
  5. Find Solutions in [0,3π][0, 3\pi]:

    • For x=2nπx=2n\pi: n=0    x=0n=0 \implies x=0; n=1    x=2πn=1 \implies x=2\pi.
    • For x=2nππ/2x=2n\pi - \pi/2: n=1    x=3π/2n=1 \implies x=3\pi/2.

Answer: The solutions are 0,2π,3π/20, 2\pi, 3\pi/2. There are 3 solutions.