Example 1: Degree to Radian Conversion

Question: Convert 7575^\circ into radian measure.

Solution:

To convert from degrees to radians, we multiply by the conversion factor π180\frac{\pi}{180}.

75=75×π180=5×1512×15π=5π12 radians75^\circ = 75 \times \frac{\pi}{180} = \frac{5 \times 15}{12 \times 15}\pi = \mathbf{\frac{5\pi}{12}} \text{ radians}.

Example 2: Radian to Degree Conversion

Question: Convert 11π12\frac{11\pi}{12} radians into degree measure.

Solution:

To convert from radians to degrees, we multiply by the conversion factor 180π\frac{180}{\pi}.

11π12 rad=11π12×180π=11×18012=11×15=165\frac{11\pi}{12} \text{ rad} = \frac{11\pi}{12} \times \frac{180}{\pi} = 11 \times \frac{180}{12} = 11 \times 15 = \mathbf{165^\circ}.

Example 3: Arc Length

Question: A circular wire of radius 7 cm is cut and bent into an arc of a circle of radius 12 cm. Find the angle subtended by the arc at the center.

Solution:

Step 1: The length of the wire is the circumference of the first circle, l=2πr1=2π(7)=14πl = 2\pi r_1 = 2\pi(7) = 14\pi cm.

Step 2: This length becomes the arc length for the second circle. Using the formula l=r2θl=r_2\theta, where r2=12r_2=12 cm:

14π=12θ    θ=14π12=7π614\pi = 12\theta \implies \theta = \frac{14\pi}{12} = \mathbf{\frac{7\pi}{6}} radians.

Example 4: Clock Angle Problem

Question: Find the angle in degrees between the minute hand and the hour hand of a clock at 3:40 PM.

Solution:

Step 1: At 3:40, the minute hand is at the 8, which is 812×360=240\frac{8}{12} \times 360^\circ = \mathbf{240^\circ} from the 12.

Step 2: The hour hand has moved 3 full hours plus 40/60 = 2/3 of the way through the next hour. Its position is (3+23)×30=113×30=110(3 + \frac{2}{3}) \times 30^\circ = \frac{11}{3} \times 30^\circ = \mathbf{110^\circ} from the 12.

Step 3: The difference is 240110=130|240^\circ - 110^\circ| = \mathbf{130^\circ}.

Example 5: Finding Trig Values from a Point

Question: If the terminal side of an angle θ\theta passes through the point (5, -12), find cosθ\cos\theta and cscθ\csc\theta.

Solution:

Given x=5,y=12x=5, y=-12. The distance from the origin is r=x2+y2=52+(12)2=25+144=169=13r = \sqrt{x^2+y^2} = \sqrt{5^2+(-12)^2} = \sqrt{25+144}=\sqrt{169}=\mathbf{13}.

  • cosθ=x/r=5/13\cos\theta = x/r = \mathbf{5/13}.

  • cscθ=r/y=13/12\csc\theta = r/y = \mathbf{-13/12}.

Example 6: Finding Trig Values from One Ratio and Quadrant

Question: If tanx=4/3\tan x = -4/3 and x lies in the second quadrant, find sinx+cosx\sin x + \cos x.

Solution:

In Q2, sinx>0\sin x > 0 and cosx<0\cos x < 0. From tanx=4/3\tan x = -4/3, we can form a reference triangle with opposite=4, adjacent=3, hypotenuse=5.

  • sinx=opposite/hypotenuse=4/5\sin x = \text{opposite/hypotenuse} = \mathbf{4/5} (positive in Q2).

  • cosx=adjacent/hypotenuse=3/5\cos x = \text{adjacent/hypotenuse} = \mathbf{-3/5} (negative in Q2).

  • The sum is 4/5+(3/5)=1/54/5 + (-3/5) = \mathbf{1/5}.

Example 7: Evaluating at Large Angles

Question: Find the value of cos(1125)\cos(-1125^\circ).

Solution:

First, use the identity cos(θ)=cosθ\cos(-\theta)=\cos\theta. So we need cos(1125)\cos(1125^\circ).

Next, find the coterminal angle by subtracting multiples of 360360^\circ. 1125=3×360+45=1080+451125^\circ = 3 \times 360^\circ + 45^\circ = 1080^\circ + 45^\circ.

So, cos(1125)=cos(45)=1/2\cos(1125^\circ) = \cos(45^\circ) = \mathbf{1/\sqrt{2}}.

Example 8: Simplifying with Allied Angles

Question: Find the value of tan(19π/3)\tan(19\pi/3).

Solution:

We simplify the angle. 19π/3=(18π+π)/3=6π+π/319\pi/3 = (18\pi + \pi)/3 = 6\pi + \pi/3. Since the period of tangent is π\pi, we can ignore multiples of π\pi.

So, tan(19π/3)=tan(6π+π/3)=tan(π/3)=3\tan(19\pi/3) = \tan(6\pi+\pi/3) = \tan(\pi/3) = \mathbf{\sqrt{3}}.

Example 9: Proving a Basic Identity

Question: Prove that sinx1+cosx+1+cosxsinx=2cscx\frac{\sin x}{1+\cos x} + \frac{1+\cos x}{\sin x} = 2\csc x.

Solution:

Starting with the Left Hand Side (LHS), we find a common denominator:

LHS = sin2x+(1+cosx)2sinx(1+cosx)=sin2x+1+2cosx+cos2xsinx(1+cosx)\frac{\sin^2 x + (1+\cos x)^2}{\sin x(1+\cos x)} = \frac{\sin^2 x + 1+2\cos x+\cos^2x}{\sin x(1+\cos x)}.

Using sin2x+cos2x=1\sin^2 x+\cos^2x=1, the numerator becomes 1+1+2cosx=2+2cosx=2(1+cosx)1+1+2\cos x = 2+2\cos x = 2(1+\cos x).

LHS = 2(1+cosx)sinx(1+cosx)=2sinx=2cscx\frac{2(1+\cos x)}{\sin x(1+\cos x)} = \frac{2}{\sin x} = \mathbf{2\csc x} = RHS.

Example 10: Using Allied Angle Identities

Question: Simplify cos(180A)sin(270+A)sin(90A)cos(360A)\frac{\cos(180^\circ-A)\sin(270^\circ+A)}{\sin(90^\circ-A)\cos(360^\circ-A)}.

Solution:

We simplify each term:

  • Numerator: cos(180A)=cosA\cos(180^\circ-A) = -\cos A (Q2). sin(270+A)=cosA\sin(270^\circ+A) = -\cos A (Q4).

  • Denominator: sin(90A)=cosA\sin(90^\circ-A) = \cos A (Q1). cos(360A)=cosA\cos(360^\circ-A) = \cos A (Q4).

The expression becomes (cosA)(cosA)(cosA)(cosA)=cos2Acos2A=1\frac{(-\cos A)(-\cos A)}{(\cos A)(\cos A)} = \frac{\cos^2A}{\cos^2A} = \mathbf{1}.

Example 11: Graphing Transformations (Amplitude)

Question: What is the range of the function f(x)=3cosxf(x) = -3\cos x?

Solution:

Step 1: The range of the basic function y=cosxy=\cos x is [1,1][-1,1].

Step 2: Multiplying by -3 scales the range by a factor of 3 and reflects it across the x-axis. The new range is [3,3][-3, 3]. The maximum value is 3 and the minimum value is -3.

Example 12: Graphing Transformations (Period)

Question: What is the period of the function f(x)=tan(x/2)f(x) = \tan(x/2)?

Solution:

The period of tan(x)\tan(x) is π\pi. The period of tan(Bx)\tan(Bx) is given by the formula πB\frac{\pi}{|B|}.

Here, B=1/2B=1/2. The period is π1/2=2π\frac{\pi}{1/2} = \mathbf{2\pi}.

Example 13: Graphing Transformations (Phase Shift)

Question: The graph of y=sin(x+π/3)y=\sin(x+\pi/3) is a shift of the standard sine graph by:

Solution:

For a function y=Asin(Bx+C)y=A\sin(Bx+C), the phase shift is given by C/B-C/B. Here, C=π/3C=\pi/3 and B=1B=1. The phase shift is (π/3)/1=π/3-(\pi/3)/1 = -\pi/3. A negative phase shift corresponds to a shift to the left by π/3\mathbf{\pi/3} units.

Example 14: Solving an Equation Graphically

Question: Find the number of solutions to the equation cosx=x2\cos x = x^2.

Solution:

We sketch the graphs of y=cosxy=\cos x and y=x2y=x^2. The graph of y=x2y=x^2 is an upward-opening parabola with its vertex at the origin. The graph of y=cosxy=\cos x is a wave that passes through (0,1). The parabola is symmetric about the y-axis, as is the cosine function. For x>0x>0, they intersect once. By symmetry, they will also intersect once for x<0x<0. Total number of solutions is 2.

Example 15: Maximum and Minimum Values

Question: Find the maximum and minimum values of the expression 5sinx+12cosx5\sin x + 12\cos x.

Solution:

For an expression of the form asinx+bcosxa\sin x + b\cos x, the range is [a2+b2,a2+b2][-\sqrt{a^2+b^2}, \sqrt{a^2+b^2}].

Here, a=5,b=12a=5, b=12. So, a2+b2=52+122=25+144=169=13\sqrt{a^2+b^2} = \sqrt{5^2+12^2} = \sqrt{25+144}=\sqrt{169}=13. The range is [-13, 13].

Example 16: Compound Angle Formula

Question: Find the value of sin(75)\sin(75^\circ).

Solution:

We write 7575^\circ as a sum of standard angles: 75=45+3075^\circ=45^\circ+30^\circ. Using the identity sin(A+B)=sinAcosB+cosAsinB\sin(A+B) = \sin A \cos B + \cos A \sin B:

sin(75)=sin(45)cos(30)+cos(45)sin(30)=(12)(32)+(12)(12)=3+122\sin(75^\circ) = \sin(45^\circ)\cos(30^\circ)+\cos(45^\circ)\sin(30^\circ) = (\frac{1}{\sqrt{2}})(\frac{\sqrt{3}}{2}) + (\frac{1}{\sqrt{2}})(\frac{1}{2}) = \mathbf{\frac{\sqrt{3}+1}{2\sqrt{2}}}.

Example 17: Double Angle Formula

Question: If sinθ=3/5\sin\theta = 3/5 and θ\theta is in the second quadrant, find the value of sin(2θ)\sin(2\theta).

Solution:

In Q2, cosθ\cos\theta is negative. Using cos2θ=1sin2θ\cos^2\theta=1-\sin^2\theta, we get cosθ=1(3/5)2=16/25=4/5\cos\theta = -\sqrt{1-(3/5)^2} = -\sqrt{16/25} = -4/5. Now, using the double angle formula:

sin(2θ)=2sinθcosθ=2(3/5)(4/5)=24/25\sin(2\theta) = 2\sin\theta\cos\theta = 2(3/5)(-4/5) = \mathbf{-24/25}.

Example 18: Triple Angle Formula

Question: Find the value of 4cos3(20)3cos(20)4\cos^3(20^\circ) - 3\cos(20^\circ).

Solution:

This expression matches the identity for cos(3θ)=4cos3θ3cosθ\cos(3\theta) = 4\cos^3\theta - 3\cos\theta. Here, θ=20\theta=20^\circ. The value of the expression is cos(3×20)=cos(60)=1/2\cos(3 \times 20^\circ) = \cos(60^\circ) = \mathbf{1/2}.

Example 19: Product-to-Sum Formula

Question: Express 2sin(5x)cos(3x)2\sin(5x)\cos(3x) as a sum.

Solution:

Using the identity 2sinAcosB=sin(A+B)+sin(AB)2\sin A \cos B = \sin(A+B)+\sin(A-B), with A=5x,B=3xA=5x, B=3x, we get:

sin(5x+3x)+sin(5x3x)=sin(8x)+sin(2x)\sin(5x+3x)+\sin(5x-3x) = \mathbf{\sin(8x)+\sin(2x)}.

Example 20: Sum-to-Product Formula

Question: Simplify sin(7x)sin(5x)cos(7x)+cos(5x)\frac{\sin(7x)-\sin(5x)}{\cos(7x)+\cos(5x)}.

Solution:

Using the sum-to-product formulas:

  • Numerator: sinAsinB=2cos(A+B2)sin(AB2)=2cos(6x)sin(x)\sin A - \sin B = 2\cos(\frac{A+B}{2})\sin(\frac{A-B}{2}) = 2\cos(6x)\sin(x).

  • Denominator: cosA+cosB=2cos(A+B2)cos(AB2)=2cos(6x)cos(x)\cos A + \cos B = 2\cos(\frac{A+B}{2})\cos(\frac{A-B}{2}) = 2\cos(6x)\cos(x).

The expression simplifies to 2cos(6x)sin(x)2cos(6x)cos(x)=sinxcosx=tanx\frac{2\cos(6x)\sin(x)}{2\cos(6x)\cos(x)} = \frac{\sin x}{\cos x} = \mathbf{\tan x}.

Example 21: Area of a Sector

Question: The area of a sector of a circle is 15 sq cm and the angle of the sector is 1.5 radians. Find the radius of the circle.

Solution:

Using the formula A=12r2θA = \frac{1}{2}r^2\theta:

15=12r2(1.5)    30=1.5r2    r2=301.5=2015 = \frac{1}{2}r^2(1.5) \implies 30 = 1.5r^2 \implies r^2 = \frac{30}{1.5} = 20. The radius is r=20=25r = \sqrt{20} = \mathbf{2\sqrt{5}} cm.

Example 22: Simplifying a Complex Identity

Question: Prove that 1sinθ1+sinθ=secθtanθ\sqrt{\frac{1-\sin\theta}{1+\sin\theta}} = \sec\theta - \tan\theta for θ\theta in the first quadrant.

Solution:

To simplify the expression under the square root, we multiply the numerator and denominator by the conjugate of the denominator, which is (1sinθ)(1-\sin\theta):

LHS = (1sinθ)(1sinθ)(1+sinθ)(1sinθ)=(1sinθ)21sin2θ=(1sinθ)2cos2θ\sqrt{\frac{(1-\sin\theta)(1-\sin\theta)}{(1+\sin\theta)(1-\sin\theta)}} = \sqrt{\frac{(1-\sin\theta)^2}{1-\sin^2\theta}} = \sqrt{\frac{(1-\sin\theta)^2}{\cos^2\theta}}.

Since θ\theta is in the first quadrant, both 1sinθ1-\sin\theta and cosθ\cos\theta are positive, so we can take the square root directly:

LHS = 1sinθcosθ=1cosθsinθcosθ=secθtanθ\frac{1-\sin\theta}{\cos\theta} = \frac{1}{\cos\theta} - \frac{\sin\theta}{\cos\theta} = \mathbf{\sec\theta - \tan\theta} = RHS.

Example 23: Finding Period of a Complex Function

Question: Find the period of the function f(x)=sinx+cosxf(x) = |\sin x| + |\cos x|.

Solution:

The period of sinx|\sin x| is π\pi and the period of cosx|\cos x| is π\pi. The period of their sum will be less than or equal to π\pi. Let's test a smaller value, T=π/2T=\pi/2.

f(x+π/2)=sin(x+π/2)+cos(x+π/2)=cosx+sinx=cosx+sinx=f(x)f(x+\pi/2) = |\sin(x+\pi/2)| + |\cos(x+\pi/2)| = |\cos x| + |-\sin x| = |\cos x| + |\sin x| = f(x).

Since the function repeats every π/2\pi/2, the fundamental period is π/2\pi/2.

Example 24: Finding Domain

Question: Find the domain of the function f(x)=112cosxf(x) = \frac{1}{1-2\cos x}.

Solution:

The function is defined everywhere except where the denominator is zero.

12cosx=0    cosx=1/21-2\cos x = 0 \implies \cos x = 1/2.

The principal values for this are x=π/3x=\pi/3 and x=π/3x=-\pi/3. The general solution, accounting for the periodicity of cosine, is x=2nπ±π/3x = 2n\pi \pm \pi/3, where n is any integer. The domain is \mathbf{\mathbb{R} - \{2n\pi \pm \pi/3, n \in \mathbb{Z}\}.

Example 25: Proving an Identity with 1818^\circ

Question: Prove that sin(18)=514\sin(18^\circ) = \frac{\sqrt{5}-1}{4}.

Solution:

Let θ=18\theta=18^\circ. Then 5θ=90    2θ=903θ5\theta=90^\circ \implies 2\theta = 90^\circ-3\theta. Take sine of both sides:

sin(2θ)=sin(903θ)=cos(3θ)\sin(2\theta)=\sin(90^\circ-3\theta)=\cos(3\theta).

2sinθcosθ=4cos3θ3cosθ2\sin\theta\cos\theta = 4\cos^3\theta-3\cos\theta. Since cos(18)\ne0\cos(18^\circ) \n e 0, we can divide by cosθ\cos\theta:

2sinθ=4cos2θ3=4(1sin2θ)32\sin\theta = 4\cos^2\theta-3 = 4(1-\sin^2\theta)-3. Let y=sinθy=\sin\theta.

2y=44y23    4y2+2y1=02y=4-4y^2-3 \implies 4y^2+2y-1=0. Solving with the quadratic formula gives y=2±44(4)(1)8=2±208=1±54y = \frac{-2\pm\sqrt{4-4(4)(-1)}}{8} = \frac{-2\pm\sqrt{20}}{8} = \frac{-1\pm\sqrt{5}}{4}. Since 1818^\circ is in the first quadrant, its sine is positive. So, sin(18)=514\sin(18^\circ) = \mathbf{\frac{\sqrt{5}-1}{4}}.

Example 26: Evaluating a Product

Question: Find the value of cos(20)cos(40)cos(80)\cos(20^\circ)\cos(40^\circ)\cos(80^\circ).

Solution:

Let P=cos(20)cos(40)cos(80)P = \cos(20^\circ)\cos(40^\circ)\cos(80^\circ). Multiply and divide by 2sin(20)2\sin(20^\circ):

P=(2sin20cos20)cos40cos802sin20=sin40cos40cos802sin20P = \frac{(2\sin 20^\circ \cos 20^\circ)\cos 40^\circ \cos 80^\circ}{2\sin 20^\circ} = \frac{\sin 40^\circ \cos 40^\circ \cos 80^\circ}{2\sin 20^\circ}.

Repeat the process: P=(1/2)(2sin40cos40)cos802sin20=(1/2)sin80cos802sin20P = \frac{(1/2)(2\sin 40^\circ \cos 40^\circ) \cos 80^\circ}{2\sin 20^\circ} = \frac{(1/2)\sin 80^\circ \cos 80^\circ}{2\sin 20^\circ}.

Repeat again: P=(1/4)(2sin80cos80)2sin20=(1/4)sin1602sin20P = \frac{(1/4)(2\sin 80^\circ \cos 80^\circ)}{2\sin 20^\circ} = \frac{(1/4)\sin 160^\circ}{2\sin 20^\circ}.

Since sin(160)=sin(18020)=sin(20)\sin(160^\circ) = \sin(180^\circ-20^\circ)=\sin(20^\circ), this becomes:

P=sin(20)8sin(20)=1/8P = \frac{\sin(20^\circ)}{8\sin(20^\circ)} = \mathbf{1/8}.

Example 27: Range of a Transformed Function

Question: Find the range of f(x)=13cosxf(x) = \frac{1}{3-\cos x}.

Solution:

Step 1: Start with the range of the basic function: 1cosx1-1 \le \cos x \le 1.

Step 2: Multiply by -1, which reverses the inequalities: 1cosx11 \ge -\cos x \ge -1.

Step 3: Add 3 to all parts: 3+13cosx313+1 \ge 3-\cos x \ge 3-1, which is 43cosx24 \ge 3-\cos x \ge 2.

Step 4: Take the reciprocal, which reverses the inequalities again: 1413cosx12\frac{1}{4} \le \frac{1}{3-\cos x} \le \frac{1}{2}.

The range is [1/4, 1/2].

Example 28: Eliminating a Parameter

Question: If x=acos3θx = a\cos^3\theta and y=asin3θy=a\sin^3\theta, find the relation between x and y.

Solution:

Step 1: Isolate the trigonometric terms.

From the given equations, we have cos3θ=x/a\cos^3\theta = x/a and sin3θ=y/a\sin^3\theta = y/a.

Step 2: Raise both to the power of 2/3.

(cos3θ)2/3=(x/a)2/3    cos2θ=(x/a)2/3(\cos^3\theta)^{2/3} = (x/a)^{2/3} \implies \cos^2\theta = (x/a)^{2/3}.

(sin3θ)2/3=(y/a)2/3    sin2θ=(y/a)2/3(\sin^3\theta)^{2/3} = (y/a)^{2/3} \implies \sin^2\theta = (y/a)^{2/3}.

Step 3: Use the Pythagorean identity cos2θ+sin2θ=1\cos^2\theta+\sin^2\theta=1.

(x/a)2/3+(y/a)2/3=1(x/a)^{2/3}+(y/a)^{2/3} = 1, which simplifies to x2/3+y2/3=a2/3\mathbf{x^{2/3}+y^{2/3}=a^{2/3}}. (This is the equation of an astroid).

Example 29: Simplifying a Sum

Question: Find the value of cos2(π/8)+cos2(3π/8)+cos2(5π/8)+cos2(7π/8)\cos^2(\pi/8) + \cos^2(3\pi/8) + \cos^2(5\pi/8) + \cos^2(7\pi/8).

Solution:

Use allied angles to relate the larger angles to the smaller ones.

  • cos(7π/8)=cos(ππ/8)=cos(π/8)\cos(7\pi/8)=\cos(\pi-\pi/8)=-\cos(\pi/8), so cos2(7π/8)=cos2(π/8)\cos^2(7\pi/8) = \cos^2(\pi/8).

  • cos(5π/8)=cos(π3π/8)=cos(3π/8)\cos(5\pi/8)=\cos(\pi-3\pi/8)=-\cos(3\pi/8), so cos2(5π/8)=cos2(3π/8)\cos^2(5\pi/8) = \cos^2(3\pi/8).

The expression becomes 2(cos2(π/8)+cos2(3π/8))2(\cos^2(\pi/8)+\cos^2(3\pi/8)).

Now use the co-function identity: cos(3π/8)=cos(π/2π/8)=sin(π/8)\cos(3\pi/8)=\cos(\pi/2-\pi/8)=\sin(\pi/8).

The expression is 2(cos2(π/8)+sin2(π/8))=2(1)=22(\cos^2(\pi/8)+\sin^2(\pi/8))=2(1)=\mathbf{2}.

Example 30: Solving for an Expression

Question: If sinxa=cosxb\frac{\sin x}{a} = \frac{\cos x}{b}, then asin(2x)+bcos(2x)a\sin(2x)+b\cos(2x) is equal to:

Solution:

From the given ratio, let sinxa=cosxb=k\frac{\sin x}{a} = \frac{\cos x}{b} = k. Then sinx=ak\sin x = ak and cosx=bk\cos x=bk.

Since sin2x+cos2x=1\sin^2x+\cos^2x=1, we have (ak)2+(bk)2=1    k2(a2+b2)=1(ak)^2+(bk)^2=1 \implies k^2(a^2+b^2)=1.

Now, expand the target expression using double angle formulas:

asin(2x)+bcos(2x)=a(2sinxcosx)+b(cos2xsin2x)a\sin(2x)+b\cos(2x) = a(2\sin x \cos x) + b(\cos^2x-\sin^2x).

Substitute sinx=ak\sin x = ak and cosx=bk\cos x=bk:

=a(2(ak)(bk))+b((bk)2(ak)2)=2a2bk2+b(b2k2a2k2)=2a2bk2+b3k2a2bk2= a(2(ak)(bk)) + b((bk)^2-(ak)^2) = 2a^2bk^2 + b(b^2k^2-a^2k^2) = 2a^2bk^2+b^3k^2-a^2bk^2.

=a2bk2+b3k2=bk2(a2+b2)= a^2bk^2+b^3k^2 = b k^2(a^2+b^2).

Since k2(a2+b2)=1k^2(a^2+b^2)=1, the expression simplifies to b\mathbf{b}.