How to Work This Section

Thirty fully worked problems: classic ordering and card-hand problems, a full mixed practice set, and sixteen drills that rehearse the exam-standard patterns — dice pairs, card hands via (nr)\binom{n}{r}, arrangement probabilities via n!n! and nPr^nP_r, and 'atleast one' through the complement.

Counting techniques feeding the equally likely probability formula

The single test that decides every setup: are my outcomes equally likely? Choose the sample space so they are (ordered pairs for dice, unordered hands for cards, arrangements for orderings), count favourable and total with Chapter 6 tools, then divide.

Classic Worked Examples

Example 1. Veena visits four cities A, B, C, D in a random order. Find the probability that she visits (i) A before B (ii) A before B and B before C (iii) A first and B last (iv) A either first or second (v) A just before B.

Solution.

Step 1 — sample space. A visiting plan is an ordering of the four cities: 4!=244! = 24 equally likely orders.

(i) Step 2 — use symmetry. Pair every order with the one obtained by swapping A and B. In each pair exactly one order has A before B, so exactly half the orders do: P=1224=12P = \frac{12}{24} = \frac{1}{2} — no listing needed.

(ii) Step 3 — fix a relative order of three cities. Among the 3!=63! = 6 possible relative orders of A, B, C, all are equally likely, and only one is A→B→C. So the favourable orders number 246=4\frac{24}{6} = 4 (they differ only in where D sits): P=424=16P = \frac{4}{24} = \frac{1}{6}.

(iii) Step 4 — pin the ends. A in position 1 and B in position 4 leaves C, D for the middle two places: 2!=22! = 2 orders → P=224=112P = \frac{2}{24} = \frac{1}{12}.

(iv) Step 5 — disjoint cases. 'A first' gives 3!=63! = 6 orders; 'A second' gives another 6; the two cases cannot overlap → P=6+624=12P = \frac{6 + 6}{24} = \frac{1}{2}.

(v) Step 6 — glue the block. 'A just before B' means AB appear as an adjacent block in that order. Treat AB as one unit: the units {AB},C,D\{AB\}, C, D arrange in 3!=63! = 6 ways → P=624=14P = \frac{6}{24} = \frac{1}{4}. Note how (v) differs from (i): adjacency is a stronger demand than mere precedence.


Example 2. A hand of 7 cards is drawn from a deck of 52. Find the probability that it contains (i) all 4 Kings (ii) exactly 3 Kings (iii) atleast 3 Kings.

Solution.

Step 1 — sample space. A hand is an unordered set of 7 cards: (527)\binom{52}{7} equally likely hands.

(i) Step 2 — build the favourable hands. Take all 4 Kings ((44)=1\binom{4}{4} = 1 way), then complete the hand with 74=37 - 4 = 3 cards from the remaining 48 ((483)=17296\binom{48}{3} = 17296 ways).

Step 3 — divide. P(4 Kings)=(44)(483)(527)=17296133784560=17735P(4 \text{ Kings}) = \dfrac{\binom{4}{4}\binom{48}{3}}{\binom{52}{7}} = \dfrac{17296}{133784560} = \dfrac{1}{7735}.

(ii) Step 4 — same recipe, 3 Kings. Choose 3 of the 4 Kings ((43)=4\binom{4}{3} = 4) and 4 non-Kings ((484)=194580\binom{48}{4} = 194580): P(3 Kings)=4×194580133784560=91547P(3 \text{ Kings}) = \dfrac{4 \times 194580}{133784560} = \dfrac{9}{1547}.

(iii) Step 5 — add disjoint cases. 'Atleast 3' means exactly 3 or exactly 4 — a hand cannot be both: P=91547+17735=457735+17735=467735P = \dfrac{9}{1547} + \dfrac{1}{7735} = \dfrac{45}{7735} + \dfrac{1}{7735} = \dfrac{46}{7735}.


Example 3. For any three events AA, BB, CC, prove that P(ABC)=P(A)+P(B)+P(C)P(AB)P(AC)P(BC)+P(ABC)P(A \cup B \cup C) = P(A) + P(B) + P(C) - P(A \cap B) - P(A \cap C) - P(B \cap C) + P(A \cap B \cap C).

Solution.

Step 1 — reduce three events to two. Set E=BCE = B \cup C, so ABC=AEA \cup B \cup C = A \cup E and the two-event rule applies: P(AE)=P(A)+P(E)P(AE)P(A \cup E) = P(A) + P(E) - P(A \cap E).

Step 2 — expand P(E)P(E). By the two-event rule again: P(E)=P(BC)=P(B)+P(C)P(BC)P(E) = P(B \cup C) = P(B) + P(C) - P(B \cap C).

Step 3 — expand P(AE)P(A \cap E). Distribute the intersection over the union: AE=A(BC)=(AB)(AC)A \cap E = A \cap (B \cup C) = (A \cap B) \cup (A \cap C). Apply the two-event rule to THIS union: P(AE)=P(AB)+P(AC)P((AB)(AC))P(A \cap E) = P(A \cap B) + P(A \cap C) - P\big((A \cap B) \cap (A \cap C)\big), and the last set simplifies to ABCA \cap B \cap C.

Step 4 — substitute back. P(ABC)=P(A)+[P(B)+P(C)P(BC)][P(AB)+P(AC)P(ABC)]P(A \cup B \cup C) = P(A) + \big[P(B) + P(C) - P(B \cap C)\big] - \big[P(A \cap B) + P(A \cap C) - P(A \cap B \cap C)\big], which rearranges to the claimed formula. \blacksquare Memory hook: add the singles, subtract the pairs, add the triple back.


Example 4. In a relay race with five teams A, B, C, D, E: (a) P(A, B, C finish first, second, third respectively) (b) P(A, B, C are the first three in any order).

Solution.

Step 1 — sample space. Record only the first three places, in order: 5P3=5×4×3=60^5P_3 = 5 \times 4 \times 3 = 60 equally likely outcomes.

(a) Step 2. Exactly one outcome reads A-B-C in that order: P=160P = \frac{1}{60}.

(b) Step 3. Now any shuffling of A, B, C across the three places counts: 3!=63! = 6 favourable outcomes → P=660=110P = \frac{6}{60} = \frac{1}{10}.

Step 4 — cross-check (b) by combinations. Ignore order entirely: the set of first-three teams is one of (53)=10\binom{5}{3} = 10 equally likely triples, and exactly one triple is {A,B,C}\{A, B, C\}110\frac{1}{10} ✓.

Mixed Practice Problems

Example 5. A box contains 10 red, 20 blue, 30 green marbles; 5 are drawn. Find the probability that (i) all are blue (ii) atleast one is green.

Solution.

Step 1 — sample space. Five marbles from 10+20+30=6010 + 20 + 30 = 60: (605)=5461512\binom{60}{5} = 5461512 equally likely draws.

(i) Step 2. All five from the 20 blue: (205)=15504\binom{20}{5} = 15504 ways → P=155045461512=3411977P = \frac{15504}{5461512} = \frac{34}{11977}.

(ii) Step 3 — complement. 'Atleast one green' has five messy cases; 'NO green' has one: all five marbles from the 6030=3060 - 30 = 30 non-green ones, (305)=142506\binom{30}{5} = 142506 ways.

Step 4 — subtract. P(no green)=1425065461512=1174484P(\text{no green}) = \frac{142506}{5461512} = \frac{117}{4484}, so P(atleast one green)=11174484=436744840.97P(\text{atleast one green}) = 1 - \frac{117}{4484} = \frac{4367}{4484} \approx 0.97 — with half the box green, missing green entirely is rare.


Example 6. 4 cards are drawn from a deck of 52. What is the probability of obtaining 3 diamonds and one spade?

Solution.

Step 1 — sample space. (524)=270725\binom{52}{4} = 270725 unordered 4-card draws.

Step 2 — build a favourable draw. Choose the 3 diamonds from 13 ((133)=286\binom{13}{3} = 286 ways) AND the 1 spade from 13 ((131)=13\binom{13}{1} = 13 ways): 286×13=3718286 \times 13 = 3718 draws.

Step 3 — divide and simplify. P=3718270725=28620825P = \frac{3718}{270725} = \frac{286}{20825} (dividing numerator and denominator by 13).


Example 7. A die has two faces with '1', three faces with '2', one face with '3'. It is rolled once. Determine (i) P(2)P(2) (ii) P(1 or 3)P(1 \text{ or } 3) (iii) P(not 3)P(\text{not } 3).

Solution.

Step 1 — choose the right sample space. The three NUMBERS are not equally likely, but the six FACES are. Work with faces: 2 faces show 1, 3 faces show 2, 1 face shows 3.

(i) Step 2. P(2)=36=12P(2) = \frac{3}{6} = \frac{1}{2}.

(ii) Step 3. '1 or 3' covers 2+1=32 + 1 = 3 faces → P=36=12P = \frac{3}{6} = \frac{1}{2}. (Equivalently the complement of rolling a 2.)

(iii) Step 4. P(not 3)=1P(3)=116=56P(\text{not } 3) = 1 - P(3) = 1 - \frac{1}{6} = \frac{5}{6}.


Example 8. A lottery sells 10,000 tickets with ten equal prizes. Find the probability of NOT getting a prize when buying (a) one ticket (b) two tickets (c) 10 tickets.

Solution.

Step 1 — count the blanks. 1000010=999010000 - 10 = 9990 tickets win nothing.

(a) Step 2. One ticket is one draw from 10,000: P(no prize)=999010000=9991000P(\text{no prize}) = \frac{9990}{10000} = \frac{999}{1000}.

(b) Step 3. Your two tickets form an unordered pair; missing every prize means BOTH tickets come from the 9990 blanks: P=(99902)(100002)P = \dfrac{\binom{9990}{2}}{\binom{10000}{2}}.

(c) Step 4. Same structure with ten tickets: P=(999010)(1000010)P = \dfrac{\binom{9990}{10}}{\binom{10000}{10}}. Each answer is a ratio of 'all-blank selections' to 'all selections' — only the selection size changes.


Example 9. Out of 100 students, two sections of 40 and 60 are formed. If you and your friend are among the 100, find the probability that (a) you both enter the same section (b) you both enter different sections.

Solution.

Step 1 — focus on the pair of seats. Only the positions of you and your friend matter: the pair of seats you occupy is a random 2-subset of 100, so n(S)=(1002)=4950n(S) = \binom{100}{2} = 4950.

(a) Step 2 — two disjoint ways to be together. Both in the 40-section: (402)=780\binom{40}{2} = 780; both in the 60-section: (602)=1770\binom{60}{2} = 1770.

Step 3 — add and divide. P=780+17704950=25504950=1733P = \frac{780 + 1770}{4950} = \frac{2550}{4950} = \frac{17}{33}.

(b) Step 4 — complement. P(different)=11733=1633P(\text{different}) = 1 - \frac{17}{33} = \frac{16}{33}. Direct check: one seat in each section can be chosen in 40×60=240040 \times 60 = 2400 ways, and 24004950=1633\frac{2400}{4950} = \frac{16}{33} ✓.


Example 10. Three letters are put at random into three addressed envelopes, one per envelope. Find the probability that atleast one letter is in its proper envelope.

All six letter placements for three envelopes with the two derangements highlighted

Solution.

Step 1 — sample space. The letters fill the envelopes in 3!=63! = 6 equally likely ways.

Step 2 — go through the complement. 'Atleast one correct' has overlapping cases, but its complement — 'NO letter in its own envelope' — is a single clean condition.

Step 3 — count the derangements. Writing each placement as the order the letters land in envelopes 1, 2, 3: of the six orders 123,132,213,231,312,321123, 132, 213, 231, 312, 321, check each against the correct positions — only 231231 and 312312 put every letter in a wrong envelope. So D3=2D_3 = 2.

Step 4 — finish. P(none correct)=26=13P(\text{none correct}) = \frac{2}{6} = \frac{1}{3}, hence P(atleast one correct)=113=23P(\text{atleast one correct}) = 1 - \frac{1}{3} = \frac{2}{3}.


Example 11. P(A)=0.54P(A) = 0.54, P(B)=0.69P(B) = 0.69, P(AB)=0.35P(A \cap B) = 0.35. Find (i) P(AB)P(A \cup B) (ii) P(AB)P(A' \cap B') (iii) P(AB)P(A \cap B') (iv) P(BA)P(B \cap A').

Solution.

(i) Step 1 — addition rule. P(AB)=0.54+0.690.35=1.230.35=0.88P(A \cup B) = 0.54 + 0.69 - 0.35 = 1.23 - 0.35 = \mathbf{0.88}.

(ii) Step 2 — De Morgan. AB=(AB)A' \cap B' = (A \cup B)', so P=10.88=0.12P = 1 - 0.88 = \mathbf{0.12}.

(iii) Step 3 — 'AA only'. Strip the overlap from AA: P(AB)=P(A)P(AB)=0.540.35=0.19P(A \cap B') = P(A) - P(A \cap B) = 0.54 - 0.35 = \mathbf{0.19}.

(iv) Step 4 — 'BB only'. Symmetrically: P(BA)=0.690.35=0.34P(B \cap A') = 0.69 - 0.35 = \mathbf{0.34}.

Step 5 — consistency check. The four disjoint regions AA only, BB only, both, neither must total 1: 0.19+0.34+0.35+0.12=1.000.19 + 0.34 + 0.35 + 0.12 = 1.00 ✓.


Example 12. Five employees: Harish (M, 30), Rohan (M, 33), Sheetal (F, 46), Alis (F, 28), Salim (M, 41). One is chosen at random as spokesperson. Find the probability the spokesperson is male or over 35.

Solution.

Step 1 — read off the two events. Males: Harish, Rohan, Salim → P(M)=35P(M) = \frac{3}{5}. Over 35: Sheetal (46), Salim (41) → P(O)=25P(O) = \frac{2}{5}.

Step 2 — find the overlap. Male AND over 35: only Salim → P(MO)=15P(M \cap O) = \frac{1}{5}.

Step 3 — addition rule. P(MO)=35+2515=45P(M \cup O) = \frac{3}{5} + \frac{2}{5} - \frac{1}{5} = \frac{4}{5}. Direct check: the favourable people are Harish, Rohan, Salim, Sheetal — 4 of 5 ✓ (only Alis, a 28-year-old woman, fails both).


Example 13. 4-digit numbers greater than 5000 are formed from 0, 1, 3, 5, 7. Find the probability the number is divisible by 5 when (i) digits may repeat (ii) repetition is not allowed.

Solution.

(i) Step 1 — count numbers greater than 5000, repetition allowed. The first digit must be 5 or 7 (2 choices); the other three places are free (5 each): 2×53=2502 \times 5^3 = 250 strings. One of them is exactly 5000, which is NOT greater than 5000 — remove it: 2501=249250 - 1 = 249 numbers.

Step 2 — count the multiples of 5. Divisible by 5 needs last digit 0 or 5: first digit 2 choices, middle two 5×55 \times 5, last 2 choices → 2×25×2=1002 \times 25 \times 2 = 100, minus the excluded 5000 → 99.

Step 3 — divide. P=99249=3383P = \frac{99}{249} = \frac{33}{83}.

(ii) Step 4 — repeat without repetition. First digit 5 or 7 (2 ways), then the remaining three places take distinct leftover digits: 4×3×2=244 \times 3 \times 2 = 24 each → 2×24=482 \times 24 = 48 numbers, all automatically >5000> 5000 (5000 itself needs repeated zeros).

Step 5 — favourable count, split by first digit. First digit 5: the last digit can only be 0 (5 is used), middles from the remaining 3 digits: 3×2=63 \times 2 = 6 numbers. First digit 7: last digit 0 or 5 (2 ways), middles 3×2=63 \times 2 = 6 → 12 numbers. Total 6+12=186 + 12 = 18.

Step 6 — divide. P=1848=38P = \frac{18}{48} = \frac{3}{8}.


Example 14. A number lock has 4 wheels each with digits 0-9; the code is a sequence of four digits with no repeats. What is the probability of guessing it?

Solution.

Step 1 — recognise ordered-without-repetition. A lock code is a SEQUENCE (order matters) of DISTINCT digits, so count permutations: 10P4=10×9×8×7=5040^{10}P_4 = 10 \times 9 \times 8 \times 7 = 5040.

Step 2 — favourable. Exactly one sequence opens the lock.

Step 3 — divide. P=15040P = \frac{1}{5040}. Contrast: with repeats allowed the total would be 104=1000010^4 = 10000; unordered would be (104)=210\binom{10}{4} = 210 — both wrong models for a lock.

Drill Set A — Dice and Coins

Example 15. Two dice are thrown. Find the probability that the sum is 9.

Solution.

Step 1. Sample space: 36 ordered pairs, each with probability 136\frac{1}{36}.

Step 2. List the pairs summing to 9 systematically by first die: (3,6),(4,5),(5,4),(6,3)(3,6), (4,5), (5,4), (6,3) — first die 1 or 2 cannot reach 9. Four pairs.

Step 3. P=436=19P = \frac{4}{36} = \frac{1}{9}.


Example 16. Two dice are thrown. Find the probability of a doublet.

Solution.

Step 1. A doublet means both dice agree: (1,1),(2,2),(3,3),(4,4),(5,5),(6,6)(1,1), (2,2), (3,3), (4,4), (5,5), (6,6) — one per face value, six in all.

Step 2. P=636=16P = \frac{6}{36} = \frac{1}{6}. (Quick view: whatever the first die shows, the second matches it with probability 16\frac{1}{6}.)


Example 17. Two dice are thrown. Find the probability that atleast one die shows a 6.

Solution.

Step 1 — complement. 'Atleast one six' mixes one-six and two-six cases; 'NO six' is one case.

Step 2 — count no-six outcomes. Each die then has 5 allowed faces: 5×5=255 \times 5 = 25 pairs.

Step 3 — subtract. P=12536=1136P = 1 - \frac{25}{36} = \frac{11}{36}. Direct check: 6+61=116 + 6 - 1 = 11 pairs contain a six (row six plus column six, minus (6,6)(6,6) counted twice) ✓.


Example 18. Two dice are thrown. Find the probability that the sum is divisible by 3.

Solution.

Step 1. The achievable sums divisible by 3 are 3, 6, 9, 12.

Step 2 — count each. Sum 3: (1,2),(2,1)(1,2), (2,1) — 2. Sum 6: (1,5),(2,4),(3,3),(4,2),(5,1)(1,5), (2,4), (3,3), (4,2), (5,1) — 5. Sum 9: 4 (Example 15). Sum 12: (6,6)(6,6) — 1.

Step 3. Total 2+5+4+1=122 + 5 + 4 + 1 = 12 pairs → P=1236=13P = \frac{12}{36} = \frac{1}{3}. (Elegant check: sums mod 3 are uniform, so 13\frac{1}{3} exactly.)


Example 19. Two dice are thrown. Find the probability that the product of the numbers is even.

Solution.

Step 1 — flip to the complement. A product is ODD exactly when both factors are odd; every other case is even.

Step 2 — count both-odd. Each die shows 1, 3 or 5: 3×3=93 \times 3 = 9 pairs.

Step 3. P(even product)=1936=114=34P(\text{even product}) = 1 - \frac{9}{36} = 1 - \frac{1}{4} = \frac{3}{4}.


Example 20. A fair coin is tossed 4 times. Find the probability of (i) all heads (ii) atleast one tail.

Solution.

Step 1. Four tosses: 24=162^4 = 16 equally likely strings.

(i) Step 2. Only one string is HHHHHHHH: P=116P = \frac{1}{16}.

(ii) Step 3. 'Atleast one tail' is the complement of 'all heads': P=1116=1516P = 1 - \frac{1}{16} = \frac{15}{16}.


Example 21. Two dice are thrown. Find the probability that the sum is atleast 10.

Solution.

Step 1. 'Atleast 10' means sum 10, 11 or 12.

Step 2 — count each. Sum 10: (4,6),(5,5),(6,4)(4,6), (5,5), (6,4) — 3. Sum 11: (5,6),(6,5)(5,6), (6,5) — 2. Sum 12: (6,6)(6,6) — 1.

Step 3. Total 6 pairs → P=636=16P = \frac{6}{36} = \frac{1}{6}.


Example 22. In a leap year, find the probability of 53 Sundays.

Solution.

Step 1 — split the year into weeks. 366=52×7+2366 = 52 \times 7 + 2: every weekday occurs 52 times for sure, and TWO extra consecutive days remain.

Step 2 — list the possibilities for the extra pair. Depending on the year's starting day: (Sun, Mon), (Mon, Tue), (Tue, Wed), (Wed, Thu), (Thu, Fri), (Fri, Sat), (Sat, Sun) — 7 equally likely pairs.

Step 3 — favourable pairs. Sunday appears in (Sun, Mon) and (Sat, Sun): 2 of 7.

Step 4. P(53 Sundays)=27P(53 \text{ Sundays}) = \frac{2}{7}. (For an ordinary year the single extra day gives 17\frac{1}{7}.)

Drill Set B — Cards, Committees, Arrangements

Example 23. Two cards are drawn together from a deck of 52. Find the probability that both are aces.

Solution.

Step 1. 'Together' means an unordered pair: (522)=52×512=1326\binom{52}{2} = \frac{52 \times 51}{2} = 1326 pairs.

Step 2. Favourable pairs pick 2 of the 4 aces: (42)=6\binom{4}{2} = 6.

Step 3. P=61326=1221P = \frac{6}{1326} = \frac{1}{221}. Sequential cross-check: 452×351=113×117=1221\frac{4}{52} \times \frac{3}{51} = \frac{1}{13} \times \frac{1}{17} = \frac{1}{221} ✓.


Example 24. From 5 boys and 3 girls, three are chosen at random. Find the probability that (i) all are boys (ii) atleast one is a girl.

Solution.

Step 1. Total selections: (83)=56\binom{8}{3} = 56.

(i) Step 2. All three from the 5 boys: (53)=10\binom{5}{3} = 10P=1056=528P = \frac{10}{56} = \frac{5}{28}.

(ii) Step 3 — complement. 'Atleast one girl' is the complement of 'all boys': P=1528=2328P = 1 - \frac{5}{28} = \frac{23}{28}.


Example 25. The letters of the word EXAM are arranged at random. Find the probability that the vowels are together.

Solution.

Step 1. EXAM has 4 distinct letters: 4!=244! = 24 arrangements.

Step 2 — glue the vowels. Treat E and A as one block: the units {EA},X,M\{EA\}, X, M arrange in 3!=63! = 6 ways, and inside the block the vowels order themselves in 2!=22! = 2 ways → 6×2=126 \times 2 = 12 favourable arrangements.

Step 3. P=1224=12P = \frac{12}{24} = \frac{1}{2}.


Example 26. A number is selected at random from 1 to 100. Find the probability that it is divisible by 4 or 6.

Solution.

Step 1 — count each family. Multiples of 4 up to 100: 100/4=25\lfloor 100/4 \rfloor = 25. Multiples of 6: 100/6=16\lfloor 100/6 \rfloor = 16.

Step 2 — find the double-counted ones. Divisible by both 4 and 6 means divisible by lcm(4,6)=12\mathrm{lcm}(4, 6) = 12 (not 24!): 100/12=8\lfloor 100/12 \rfloor = 8.

Step 3 — inclusion-exclusion. Favourable =25+168=33= 25 + 16 - 8 = 33P=33100P = \frac{33}{100}.


Example 27. A bag has 5 red and 4 blue balls; two are drawn together. Find the probability that both are the same colour.

Solution.

Step 1. Total pairs: (92)=36\binom{9}{2} = 36.

Step 2 — two disjoint colour cases. Both red: (52)=10\binom{5}{2} = 10; both blue: (42)=6\binom{4}{2} = 6.

Step 3. P=10+636=1636=49P = \frac{10 + 6}{36} = \frac{16}{36} = \frac{4}{9}. (Complement check: mixed pairs =5×4=20= 5 \times 4 = 20, and 2036+1636=1\frac{20}{36} + \frac{16}{36} = 1 ✓.)


Example 28. A committee of 3 is chosen from 4 men and 2 women. Find the probability that it contains atleast one woman.

Solution.

Step 1. Total committees: (63)=20\binom{6}{3} = 20.

Step 2 — complement. 'No woman' means all three from the 4 men: (43)=4\binom{4}{3} = 4P(no woman)=420=15P(\text{no woman}) = \frac{4}{20} = \frac{1}{5}.

Step 3. P(atleast one woman)=115=45P(\text{atleast one woman}) = 1 - \frac{1}{5} = \frac{4}{5}.


Example 29. A two-digit number (10 to 99) is chosen at random. Find the probability that it is divisible by 7.

Solution.

Step 1. Two-digit numbers run 10 to 99: 9910+1=9099 - 10 + 1 = 90 of them.

Step 2 — locate the multiples of 7. Smallest 10\geq 10: 14; largest 99\leq 99: 98. Count: 98147+1=12+1=13\frac{98 - 14}{7} + 1 = 12 + 1 = 13.

Step 3. P=1390P = \frac{13}{90}.


Example 30. A 3-digit number is formed from the digits 1, 2, 3, 4, 5 without repetition. Find the probability that it is even.

Solution.

Step 1. Total numbers: 5×4×3=605 \times 4 \times 3 = 60 (no leading-zero worry here).

Step 2 — condition on the last digit. Even needs the units digit 2 or 4: 2 choices. The hundreds and tens places then take 4×3=124 \times 3 = 12 ordered choices from the remaining digits.

Step 3. Favourable =2×12=24= 2 \times 12 = 24P=2460=25P = \frac{24}{60} = \frac{2}{5}.

Step 4 — symmetry shortcut. Every digit is equally likely to land in the units place, so P(even)=#{2,4}5=25P(\text{even}) = \frac{\#\{2, 4\}}{5} = \frac{2}{5} directly ✓.