Reading Dissociation off a Density Measurement

A gas that dissociates in a closed vessel keeps its mass and gains molecules. Two moles of NO2\mathrm{NO_2} weigh exactly what the one mole of N2O4\mathrm{N_2O_4} they came from weighed, but they occupy twice the volume at the same temperature and pressure. Anything that measures mass per mole therefore falls as dissociation proceeds, and measuring how far it has fallen measures the degree of dissociation.

Key Point (Definition): The degree of dissociation α\alpha is the fraction of the reactant originally taken that has dissociated when equilibrium is reached. It runs from 00 to 11; multiplied by 100 it is the percentage dissociation.

The quantity actually measured in the laboratory is the vapour density.

Key Point (Definition): The vapour density of a gas is the mass of a given volume of that gas divided by the mass of the same volume of hydrogen, both measured at the same temperature and pressure. For an ideal gas this equals M/2M/2, where MM is the molar mass in gmol1\mathrm{g\,mol^{-1}}.

Two symbols are used throughout, and mixing them up is the commonest error in the topic. DD is the theoretical vapour density, calculated from the formula of the undissociated substance. dd is the observed vapour density, measured on the equilibrium mixture. Dissociation makes dd smaller than DD.

The derivation

Write the dissociation so that one mole of reactant appears on the left, and let it produce nn moles of gaseous product in total:

A(g)nB(g)\mathrm{A(g)} \rightleftharpoons n\,\mathrm{B(g)}

Step 1. Start with 1 mol of A\mathrm{A} and let a fraction α\alpha of it dissociate. At equilibrium there is (1α)(1-\alpha) mol of A\mathrm{A} left and nαn\alpha mol of product formed.

Step 2. Add the moles present at equilibrium:

ntotal=(1α)+nα=1+(n1)αn_{\text{total}} = (1-\alpha) + n\alpha = 1 + (n-1)\alpha

Step 3. Mass is conserved. The mass of the sample equals moles multiplied by molar mass, both before and after:

1×Mtheoretical=[1+(n1)α]×Mobserved1 \times M_{\text{theoretical}} = \left[1 + (n-1)\alpha\right] \times M_{\text{observed}}

Step 4. Divide, and replace each molar mass by twice its vapour density, since the factor 2 cancels:

Dd=MtheoreticalMobserved=1+(n1)α\frac{D}{d} = \frac{M_{\text{theoretical}}}{M_{\text{observed}}} = 1 + (n-1)\alpha

Step 5. Make α\alpha the subject:

α=Dd(n1)dequivalentlyα=MtheoreticalMobserved(n1)Mobserved\alpha = \frac{D - d}{(n-1)\,d} \qquad\text{equivalently}\qquad \alpha = \frac{M_{\text{theoretical}} - M_{\text{observed}}}{(n-1)\,M_{\text{observed}}}

The ratio D/dD/d is the gas-phase counterpart of the van't Hoff factor: it is the number of particles now present for every particle originally taken, i=1+(n1)αi = 1 + (n-1)\alpha.

Diagram showing how dissociation raises the mole number and lowers the observed vapour density

What nn actually counts

nn is the number of moles of gaseous product formed from one mole of the reactant. The equation must be rewritten with a coefficient of 1 on the reactant before nn is read off, even if fractions appear on the right.

Dissociation, written per mole of reactant nn α\alpha in terms of DD and dd
PCl5(g)PCl3(g)+Cl2(g)\mathrm{PCl_5(g)} \rightleftharpoons \mathrm{PCl_3(g)} + \mathrm{Cl_2(g)} 2 (Dd)/d(D-d)/d
N2O4(g)2NO2(g)\mathrm{N_2O_4(g)} \rightleftharpoons 2\mathrm{NO_2(g)} 2 (Dd)/d(D-d)/d
NH4Cl(g)NH3(g)+HCl(g)\mathrm{NH_4Cl(g)} \rightleftharpoons \mathrm{NH_3(g)} + \mathrm{HCl(g)} 2 (Dd)/d(D-d)/d
NH3(g)12N2(g)+32H2(g)\mathrm{NH_3(g)} \rightleftharpoons \frac{1}{2}\mathrm{N_2(g)} + \frac{3}{2}\mathrm{H_2(g)} 2 (Dd)/d(D-d)/d
SO3(g)SO2(g)+12O2(g)\mathrm{SO_3(g)} \rightleftharpoons \mathrm{SO_2(g)} + \frac{1}{2}\mathrm{O_2(g)} 1.51.5 2(Dd)/d2(D-d)/d
N2O5(g)2NO2(g)+12O2(g)\mathrm{N_2O_5(g)} \rightleftharpoons 2\mathrm{NO_2(g)} + \frac{1}{2}\mathrm{O_2(g)} 2.52.5 (Dd)/1.5d(D-d)/1.5d

For the first four the formula collapses to the memorable α=(Dd)/d\alpha = (D-d)/d, which is why so many students apply it everywhere. It is only correct when n=2n = 2.

The pressure version of the same result

Nothing in the derivation depends on density as such — only on the mole number changing at constant mass. If the pure reactant would exert a pressure p0p_0 in the vessel at that temperature, and the equilibrium mixture exerts PP, then at constant volume and temperature pressure is proportional to moles:

Pp0=1+(n1)α\frac{P}{p_0} = 1 + (n-1)\alpha

An observed total pressure and a calculated undissociated pressure give α\alpha exactly as a pair of densities do.

The conditions attached to the formula

Every step above used an assumption, and each one is a place where a question can be set.

  1. Ideal gas behaviour. D=M/2D = M/2 and PnP \propto n both come from pV=nRTpV = nRT. Near condensation, or at high pressure, the relation drifts.
  2. One dissociation only. If the product dissociates further, or two reactions run at once, the single nn in the formula no longer describes the mixture.
  3. The sample must be entirely in the gas phase. A solid or liquid residue holds back mass that the calculation assumes is in the vapour.
  4. DD must come from the formula mass of the undissociated species, and dd must be measured at the same temperature and pressure.
  5. The vapour must not associate. If dd comes out greater than DD, molecules are combining rather than splitting — acetic acid vapour dimerising through hydrogen bonds is the standard case — and a different relation applies. The sign of DdD - d tells which process is happening before any arithmetic is done.

Reading α\alpha back out of a measurement

Four different measurements all lead to the same α\alpha, and a question may supply any one of them.

Measurement given Relation used
Theoretical and observed vapour density α=Dd(n1)d\alpha = \dfrac{D-d}{(n-1)d}
Theoretical and observed molar mass α=MthMobs(n1)Mobs\alpha = \dfrac{M_{\text{th}} - M_{\text{obs}}}{(n-1)M_{\text{obs}}}
Undissociated and observed pressure, constant VV and TT α=Pp0(n1)p0\alpha = \dfrac{P - p_0}{(n-1)p_0}
Initial and final total moles, constant VV and TT α=nfinalninitial(n1)ninitial\alpha = \dfrac{n_{\text{final}} - n_{\text{initial}}}{(n-1)n_{\text{initial}}}

All four are the single statement 1+(n1)α1 + (n-1)\alpha = (particles now)/(particles taken), read through whichever property was measured. They differ in two places, not one. First the numerator: density and molar mass fall on dissociation while pressure and mole number rise, so the subtraction is written the other way round in the lower two rows. Second the denominator: it is always whichever quantity sits below the line in that ratio, which is the observed density or molar mass in the upper two rows but the initial pressure or mole number in the lower two.

[JEE Main] A question that gives a vapour density and asks for KpK_p is really two questions joined: get α\alpha from the densities, then feed α\alpha into the KpK_p expression of the next block.

KpK_p in Terms of α\alpha and Total Pressure

Once α\alpha is known, the equilibrium constant follows without ever converting to concentrations. The route is always the same: moles at equilibrium, then mole fractions, then partial pressures as mole fraction multiplied by total pressure PP, then substitution.

Case 1: A(g)2B(g)\mathrm{A(g)} \rightleftharpoons 2\mathrm{B(g)}

This covers N2O42NO2\mathrm{N_2O_4} \rightleftharpoons 2\mathrm{NO_2}, Cl22Cl\mathrm{Cl_2} \rightleftharpoons 2\mathrm{Cl} and I22I\mathrm{I_2} \rightleftharpoons 2\mathrm{I} — every case in which one mole of reactant splits into two moles of the same product. PCl5\mathrm{PCl_5} does not belong here: its two products are different species, and it follows Case 2 below.

Step 1. Start with 1 mol of A\mathrm{A}; at equilibrium, A=1α\mathrm{A} = 1-\alpha, B=2α\mathrm{B} = 2\alpha, total =1+α= 1+\alpha.

Step 2. Mole fractions are each species divided by the total:

xA=1α1+αxB=2α1+αx_{\mathrm{A}} = \frac{1-\alpha}{1+\alpha} \qquad x_{\mathrm{B}} = \frac{2\alpha}{1+\alpha}

Step 3. Partial pressure is mole fraction multiplied by the total pressure PP:

pA=(1α)P1+αpB=2αP1+αp_{\mathrm{A}} = \frac{(1-\alpha)P}{1+\alpha} \qquad p_{\mathrm{B}} = \frac{2\alpha P}{1+\alpha}

Step 4. Substitute into Kp=pB2/pAK_p = p_{\mathrm{B}}^{2}/p_{\mathrm{A}}:

Kp=(2αP1+α)2(1α)P1+α=4α2P2(1+α)2×1+α(1α)PK_p = \frac{\left(\dfrac{2\alpha P}{1+\alpha}\right)^{2}}{\dfrac{(1-\alpha)P}{1+\alpha}} = \frac{4\alpha^{2}P^{2}}{(1+\alpha)^{2}} \times \frac{1+\alpha}{(1-\alpha)P}

Step 5. Cancel one factor of (1+α)(1+\alpha) and one of PP, and use (1+α)(1α)=1α2(1+\alpha)(1-\alpha) = 1-\alpha^{2}:

Kp=4α2P1α2\boxed{K_p = \frac{4\alpha^{2}P}{1-\alpha^{2}}}

Step 6. Inverting for α\alpha: cross-multiplying gives KpKpα2=4α2PK_p - K_p\alpha^{2} = 4\alpha^{2}P, so

α=KpKp+4P\alpha = \sqrt{\frac{K_p}{K_p + 4P}}

Case 2: A(g)B(g)+C(g)\mathrm{A(g)} \rightleftharpoons \mathrm{B(g)} + \mathrm{C(g)}

This is the PCl5PCl3+Cl2\mathrm{PCl_5} \rightleftharpoons \mathrm{PCl_3} + \mathrm{Cl_2} pattern, and also NH4Cl\mathrm{NH_4Cl} vapour and COCl2\mathrm{COCl_2}. The total is again 1+α1+\alpha, but the two products each carry a coefficient of 1:

pB=pC=αP1+αpA=(1α)P1+αp_{\mathrm{B}} = p_{\mathrm{C}} = \frac{\alpha P}{1+\alpha} \qquad p_{\mathrm{A}} = \frac{(1-\alpha)P}{1+\alpha}

Kp=pBpCpA=α2P2(1+α)2×1+α(1α)P=α2P1α2α=KpKp+PK_p = \frac{p_{\mathrm{B}}\,p_{\mathrm{C}}}{p_{\mathrm{A}}} = \frac{\alpha^{2}P^{2}}{(1+\alpha)^{2}} \times \frac{1+\alpha}{(1-\alpha)P} = \frac{\alpha^{2}P}{1-\alpha^{2}} \qquad \alpha = \sqrt{\frac{K_p}{K_p + P}}

The only difference from Case 1 is the factor 4, and it comes from squaring the coefficient 2 in 2B2\mathrm{B}. Dropping it is the single most common slip in this calculation.

The standard cases collected

Equilibrium Total moles KpK_p α\alpha KcK_c (volume VV, 1 mol taken)
A2B\mathrm{A} \rightleftharpoons 2\mathrm{B} 1+α1+\alpha 4α2P1α2\dfrac{4\alpha^{2}P}{1-\alpha^{2}} KpKp+4P\sqrt{\dfrac{K_p}{K_p+4P}} 4α2(1α)V\dfrac{4\alpha^{2}}{(1-\alpha)V}
AB+C\mathrm{A} \rightleftharpoons \mathrm{B}+\mathrm{C} 1+α1+\alpha α2P1α2\dfrac{\alpha^{2}P}{1-\alpha^{2}} KpKp+P\sqrt{\dfrac{K_p}{K_p+P}} α2(1α)V\dfrac{\alpha^{2}}{(1-\alpha)V}
A3B\mathrm{A} \rightleftharpoons 3\mathrm{B} 1+2α1+2\alpha 27α3P2(1α)(1+2α)2\dfrac{27\alpha^{3}P^{2}}{(1-\alpha)(1+2\alpha)^{2}} solved numerically 27α3(1α)V2\dfrac{27\alpha^{3}}{(1-\alpha)V^{2}}
2AB+C2\mathrm{A} \rightleftharpoons \mathrm{B}+\mathrm{C} 11 (unchanged) α24(1α)2\dfrac{\alpha^{2}}{4(1-\alpha)^{2}} independent of PP same as KpK_p

The last row is worth a moment. When the number of gaseous moles does not change, PP cancels out of the expression entirely, and α\alpha is fixed by temperature alone. H2+I22HI\mathrm{H_2 + I_2 \rightleftharpoons 2HI} and the dissociation of HI\mathrm{HI} behave this way, which is why a vapour-density measurement on them shows nothing at all — dd equals DD however far the reaction has gone.

How α\alpha responds to pressure

Take Kp=4α2P/(1α2)K_p = 4\alpha^{2}P/(1-\alpha^{2}) and hold the temperature fixed, so KpK_p is a constant. Raising PP must be paid for by lowering α2/(1α2)\alpha^{2}/(1-\alpha^{2}), which means lowering α\alpha. Compression suppresses dissociation whenever the dissociation increases the gaseous mole number, which is exactly what Le Chatelier's principle predicts, now with a number attached.

When α\alpha is small, 1α211-\alpha^{2} \approx 1 and

αKp4P(Case 1)αKpP(Case 2)\alpha \approx \sqrt{\frac{K_p}{4P}} \quad\text{(Case 1)} \qquad \alpha \approx \sqrt{\frac{K_p}{P}} \quad\text{(Case 2)}

so α\alpha falls off as P1/2P^{-1/2}. Quadrupling the pressure roughly halves the degree of dissociation. That approximation needs α\alpha small — below about 0.10.1 it is good to a few per cent, and at α=0.5\alpha = 0.5 it is useless.

Adding an inert gas at constant volume changes neither the partial pressures nor α\alpha: the extra gas raises the total pressure but every pip_i stays where it was. Adding an inert gas at constant total pressure forces the volume up, dilutes every reacting species, and pushes dissociation forward exactly as a genuine pressure reduction would.

[JEE Main] Recognise the pattern by counting the moles on the right of the equation written for one mole of reactant. Two moles gives the 1+α1+\alpha denominator; the factor 4 appears only when both moles are the same species.

Simultaneous and Coupled Equilibria

Two equilibria that share a species cannot be solved separately. The shared species has one concentration in the vessel, and both equilibrium expressions must be satisfied by that single value at the same time.

The combination rule

If a third equation is obtained by adding two others, its equilibrium constant is the product of theirs at the same temperature:

Reaction 3=Reaction 1+Reaction 2K3=K1×K2\text{Reaction 3} = \text{Reaction 1} + \text{Reaction 2} \quad\Longrightarrow\quad K_3 = K_1 \times K_2

The reason is mechanical: writing the two expressions and multiplying them cancels the concentration of every species that appears as a product in one and a reactant in the other. Two consequences are used constantly.

Stepwise ionisation. For hydrogen sulphide,

H2SH++HS, Ka1=9.1×108HSH++S2, Ka2=1.2×1013\mathrm{H_2S} \rightleftharpoons \mathrm{H^+} + \mathrm{HS^-},\ K_{a_1} = 9.1 \times 10^{-8} \qquad \mathrm{HS^-} \rightleftharpoons \mathrm{H^+} + \mathrm{S^{2-}},\ K_{a_2} = 1.2 \times 10^{-13}

H2S2H++S2Knet=Ka1Ka2=1.1×1020\mathrm{H_2S} \rightleftharpoons 2\mathrm{H^+} + \mathrm{S^{2-}} \qquad K_{\text{net}} = K_{a_1}K_{a_2} = 1.1 \times 10^{-20}

Rearranged, this is the master equation of qualitative analysis:

[S2]=Ka1Ka2[H2S][H+]2[\mathrm{S^{2-}}] = \frac{K_{a_1}K_{a_2}[\mathrm{H_2S}]}{[\mathrm{H^+}]^{2}}

The sulphide concentration is controlled by the square of the hydrogen ion concentration. Saturating a solution with H2S\mathrm{H_2S} holds [H2S][\mathrm{H_2S}] near 0.1 M0.1\ \mathrm{M}; the acidity then sets [S2][\mathrm{S^{2-}}] anywhere over about six orders of magnitude. In 0.1 M0.1\ \mathrm{M} HCl the sulphide ion concentration is only about 1.0×1019 M1.0 \times 10^{-19}\ \mathrm{M}, while in 0.1 M0.1\ \mathrm{M} H2S\mathrm{H_2S} alone it is near 1.2×1013 M1.2 \times 10^{-13}\ \mathrm{M}.

Dissolution helped by complex formation. Silver chloride dissolves in ammonia because two equilibria are added:

AgCl(s)Ag++Cl, Ksp=1.8×1010\mathrm{AgCl(s)} \rightleftharpoons \mathrm{Ag^+} + \mathrm{Cl^-},\ K_{sp} = 1.8 \times 10^{-10} Ag++2NH3[Ag(NH3)2]+, Kf=1.6×107\mathrm{Ag^+} + 2\mathrm{NH_3} \rightleftharpoons [\mathrm{Ag(NH_3)_2}]^{+},\ K_f = 1.6 \times 10^{7} AgCl(s)+2NH3[Ag(NH3)2]++Cl, K=KspKf=2.9×103\mathrm{AgCl(s)} + 2\mathrm{NH_3} \rightleftharpoons [\mathrm{Ag(NH_3)_2}]^{+} + \mathrm{Cl^-},\ K = K_{sp}K_f = 2.9 \times 10^{-3}

A net constant of 10310^{-3} is small but workable, so ammonia dissolves silver chloride. For silver iodide, Ksp=8.3×1017K_{sp} = 8.3 \times 10^{-17} gives a net constant near 1.3×1091.3 \times 10^{-9}, and ammonia leaves it untouched. The complexing agent removes Ag+\mathrm{Ag^+}, the shared species, and the solid dissolves to replace it.

Two solids sharing a gas

The classic gas-phase case has two solids decomposing in the same vessel, each giving a different gas plus a common one:

A(s)B(g)+C(g), Kp1D(s)E(g)+C(g), Kp2\mathrm{A(s)} \rightleftharpoons \mathrm{B(g)} + \mathrm{C(g)},\ K_{p_1} \qquad \mathrm{D(s)} \rightleftharpoons \mathrm{E(g)} + \mathrm{C(g)},\ K_{p_2}

Let pB=xp_{\mathrm{B}} = x and pE=yp_{\mathrm{E}} = y. Every molecule of C\mathrm{C} came from one solid or the other, so pC=x+yp_{\mathrm{C}} = x + y. The two constants read

Kp1=x(x+y)Kp2=y(x+y)K_{p_1} = x(x+y) \qquad K_{p_2} = y(x+y)

Adding them gives Kp1+Kp2=(x+y)2K_{p_1} + K_{p_2} = (x+y)^{2}, so

pC=Kp1+Kp2x=Kp1pCy=Kp2pCp_{\mathrm{C}} = \sqrt{K_{p_1} + K_{p_2}} \qquad x = \frac{K_{p_1}}{p_{\mathrm{C}}} \qquad y = \frac{K_{p_2}}{p_{\mathrm{C}}}

Ptotal=x+y+pC=2Kp1+Kp2P_{\text{total}} = x + y + p_{\mathrm{C}} = 2\sqrt{K_{p_1} + K_{p_2}}

The result holds only for this shape — both solids giving two gaseous moles, one of them common, and both solids still present at equilibrium. If either solid runs out, its equilibrium no longer exists and the expression fails.

What sharing does to the shared species

The shared species ends up at a higher concentration than either equilibrium alone would give, and every species that is not shared ends up lower. Solid A\mathrm{A} alone would give pC=Kp1p_{\mathrm{C}} = \sqrt{K_{p_1}}; with D\mathrm{D} present as well, pC=Kp1+Kp2p_{\mathrm{C}} = \sqrt{K_{p_1}+K_{p_2}}, which is larger. Since Kp1=xpCK_{p_1} = x\,p_{\mathrm{C}} is fixed, a larger pCp_{\mathrm{C}} forces a smaller xx.

Key Point: Any second source of a shared species pushes the first equilibrium backwards. The common ion effect in solution, the suppression of PCl5\mathrm{PCl_5} dissociation by added chlorine, and the suppression of H2S\mathrm{H_2S} release by added ammonia are one principle wearing three costumes.

The gas-phase version is worth writing out. Heating PCl5\mathrm{PCl_5} with extra Cl2\mathrm{Cl_2} already present changes the mole table: starting from 1 mol PCl5\mathrm{PCl_5} and bb mol Cl2\mathrm{Cl_2}, at equilibrium there are (1α)(1-\alpha), α\alpha and (b+α)(b+\alpha) moles with a total of (1+b+α)(1+b+\alpha), and

Kp=α(b+α)(1α)(1+b+α)PK_p = \frac{\alpha(b+\alpha)}{(1-\alpha)(1+b+\alpha)}\,P

Setting b=0b = 0 recovers α2P/(1α2)\alpha^{2}P/(1-\alpha^{2}). For any b>0b > 0 the same KpK_p and PP give a smaller α\alpha.

Water as the universal shared species

In every aqueous problem, H3O+\mathrm{H_3O^+} and OH\mathrm{OH^-} are shared between the solute's equilibrium and water's own autoionisation. The two are linked by Kw=[H3O+][OH]K_w = [\mathrm{H_3O^+}][\mathrm{OH^-}], which is 1.0×10141.0 \times 10^{-14} at 298 K and changes with temperature. Most of the time the solute swamps water and the coupling is ignored. When the solution is very dilute, or the acid very weak, it cannot be — which is the subject of the next block.

The Exact Treatment of a Weak Acid

The working formula [H3O+]=Kac[\mathrm{H_3O^+}] = \sqrt{K_a c} is an approximation, and knowing when it fails is worth more marks than knowing the formula.

Where the approximation enters

For a monoprotic weak acid HA\mathrm{HA} at initial concentration cc, with xx the amount ionised per litre:

HA+H2OH3O++AKa=x2cx\mathrm{HA} + \mathrm{H_2O} \rightleftharpoons \mathrm{H_3O^+} + \mathrm{A^-} \qquad K_a = \frac{x^{2}}{c - x}

Replacing cxc - x by cc gives x=Kacx = \sqrt{K_a c}. The exact statement is a quadratic:

x2+KaxKac=0x=Ka+Ka2+4Kac2x^{2} + K_a x - K_a c = 0 \qquad x = \frac{-K_a + \sqrt{K_a^{2} + 4K_a c}}{2}

The negative root is discarded because a concentration cannot be negative. In terms of the degree of ionisation α=x/c\alpha = x/c, the same equation is Ostwald's dilution law without any approximation:

Ka=cα21αα=Ka+Ka2+4Kac2cK_a = \frac{c\alpha^{2}}{1-\alpha} \qquad \alpha = \frac{-K_a + \sqrt{K_a^{2} + 4K_ac}}{2c}

and the familiar α=Ka/c\alpha = \sqrt{K_a/c} is what is left when 1α1-\alpha is set to 1.

The c/Ka400c/K_a \ge 400 test

The usual working rule is that the approximation is acceptable while α0.05\alpha \le 0.05, a 5% ionisation. Turning that into a test on the data:

Step 1. Accept the approximate αKa/c\alpha \approx \sqrt{K_a/c} for the purpose of the test itself.

Step 2. Impose α0.05\alpha \le 0.05, so Ka/c0.0025K_a/c \le 0.0025.

Step 3. Invert: c/Ka400c/K_a \ge 400.

Key Point: Compute c/Kac/K_a before anything else. If it is at least 400400, use [H3O+]=Kac[\mathrm{H_3O^+}] = \sqrt{K_a c}. If it is smaller, solve the quadratic — the approximation will overstate [H3O+][\mathrm{H_3O^+}].

The approximation always errs the same way. The exact xx satisfies x=Ka(cx)x = \sqrt{K_a(c-x)}, which is smaller than Kac\sqrt{K_ac}, so the approximate answer is always too high and the approximate pH always too low. The size of the error:

c/Kac/K_a Exact α\alpha Approximate α\alpha Error in [H3O+][\mathrm{H_3O^+}] Error in pH
1000010000 0.009950.00995 0.010000.01000 +0.5%+0.5\% 0.0020.002
400400 0.04880.0488 0.05000.0500 +2.5%+2.5\% 0.0110.011
100100 0.09510.0951 0.10000.1000 +5.1%+5.1\% 0.0220.022
1010 0.2700.270 0.3160.316 +17%+17\% 0.0690.069
11 0.6180.618 1.0001.000 +62%+62\% 0.210.21

At c/Ka=400c/K_a = 400 the pH is wrong in the second decimal place, by 0.0110.011, which no examination cares about. At c/Ka=1c/K_a = 1 the approximation predicts complete ionisation of a weak acid, which is nonsense. The rule is a boundary between harmless and harmful, not between right and wrong.

Bringing water into the calculation

Two exact conditions govern the solution. Charge balance says the positive and negative charges must sum to zero:

[H3O+]=[A]+[OH][\mathrm{H_3O^+}] = [\mathrm{A^-}] + [\mathrm{OH^-}]

Mass balance says all the acid taken is somewhere:

c=[HA]+[A]c = [\mathrm{HA}] + [\mathrm{A^-}]

The [OH][\mathrm{OH^-}] term is what the ordinary treatment throws away. Keeping it, and writing [A]=Ka[HA]/[H3O+][\mathrm{A^-}] = K_a[\mathrm{HA}]/[\mathrm{H_3O^+}] and [OH]=Kw/[H3O+][\mathrm{OH^-}] = K_w/[\mathrm{H_3O^+}]:

[H3O+]=Ka[HA][H3O+]+Kw[H3O+][\mathrm{H_3O^+}] = \frac{K_a[\mathrm{HA}]}{[\mathrm{H_3O^+}]} + \frac{K_w}{[\mathrm{H_3O^+}]}

Multiplying through by [H3O+][\mathrm{H_3O^+}] and, where ionisation is slight, putting [HA]c[\mathrm{HA}] \approx c:

[H3O+]=Kac+Kw[\mathrm{H_3O^+}] = \sqrt{K_a c + K_w}

That one extra term is all that is usually needed. Solving the two balances without any approximation gives a cubic,

[H3O+]3+Ka[H3O+]2(Kac+Kw)[H3O+]KaKw=0[\mathrm{H_3O^+}]^{3} + K_a[\mathrm{H_3O^+}]^{2} - (K_ac + K_w)[\mathrm{H_3O^+}] - K_aK_w = 0

which is beyond what is ever required, but its existence is the reason the simpler forms are called approximations.

When water matters. Compare KacK_ac with KwK_w. Water contributes about 1% when Kac104KwK_ac \approx 10^{4}K_w, and dominates when Kac<KwK_ac < K_w. Two situations trigger it: an extremely weak acid such as HCN or phenol, and an extremely dilute solution of any acid. A 105 M10^{-5}\ \mathrm{M} solution of HCN has Kac=4.9×1015K_ac = 4.9 \times 10^{-15}, smaller than KwK_w; ignoring water gives pH=7.15\mathrm{pH} = 7.15 for an acid, which cannot be right.

The strong-acid version of the same correction, for an acid of concentration CaC_a that ionises completely, is

[H3O+]=Ca+Ca2+4Kw2[\mathrm{H_3O^+}] = \frac{C_a + \sqrt{C_a^{2} + 4K_w}}{2}

For 108 M10^{-8}\ \mathrm{M} HCl this returns 1.05×107 M1.05 \times 10^{-7}\ \mathrm{M} and pH=6.98\mathrm{pH} = 6.98, slightly acidic, rather than the impossible pH=8\mathrm{pH} = 8 from the naive calculation. Adding acid to water can never take the pH above the neutral value.

The temperature caveat

KwK_w rises with temperature because the autoionisation of water is endothermic. At 298 K it is 1.0×10141.0 \times 10^{-14}, giving a neutral pH of exactly 7.00 and pH+pOH=14\mathrm{pH} + \mathrm{pOH} = 14. At 310 K, body temperature, KwK_w is 2.7×10142.7 \times 10^{-14}, so neutral water has pH=6.78\mathrm{pH} = 6.78 and pH+pOH=pKw=13.57\mathrm{pH} + \mathrm{pOH} = \mathrm{p}K_w = 13.57. The water is still exactly neutral — [H3O+]=[OH][\mathrm{H_3O^+}] = [\mathrm{OH^-}] — and its pH is not 7. Every statement in this chapter that attaches a number to neutrality carries "at 298 K" with it.

Buffer Capacity

A buffer resists pH change, but not without limit. Buffer capacity puts a number on the resistance.

Key Point (Definition): The buffer capacity β\beta is the number of moles of strong acid or strong base that must be added to one litre of the buffer to change its pH by one unit. Formally β=dnb/d(pH)\beta = \mathrm{d}n_b/\mathrm{d(pH)}, where nbn_b is moles of strong base added per litre. It is always positive, since adding base raises the pH and adding acid lowers it.

The expression and where its maximum lies

For a buffer made from a weak acid and its conjugate base with total concentration C=[HA]+[A]C = [\mathrm{HA}] + [\mathrm{A^-}], differentiating the mass and charge balances gives

β=2.303([H3O+]+[OH]+CKa[H3O+](Ka+[H3O+])2)\beta = 2.303\left(\,[\mathrm{H_3O^+}] + [\mathrm{OH^-}] + C\,\frac{K_a[\mathrm{H_3O^+}]}{\left(K_a + [\mathrm{H_3O^+}]\right)^{2}}\right)

The first two terms are water's own contribution; they are negligible between about pH 2 and pH 12 and take over outside that range, which is why a strong acid at pH 1 is itself an excellent buffer. The third term is the buffer's own.

Finding where it peaks takes one substitution. Put r=[H3O+]/Kar = [\mathrm{H_3O^+}]/K_a, so the buffer term becomes

Cr(1+r)2C\,\frac{r}{(1+r)^{2}}

Step 1. Differentiate with respect to rr:

ddr[r(1+r)2]=(1+r)22r(1+r)(1+r)4=1r(1+r)3\frac{\mathrm{d}}{\mathrm{d}r}\left[\frac{r}{(1+r)^{2}}\right] = \frac{(1+r)^{2} - 2r(1+r)}{(1+r)^{4}} = \frac{1-r}{(1+r)^{3}}

Step 2. Set the derivative to zero: r=1r = 1.

Step 3. r=1r = 1 means [H3O+]=Ka[\mathrm{H_3O^+}] = K_a, that is pH=pKa\mathrm{pH} = \mathrm{p}K_a.

Step 4. Substituting r=1r = 1 gives the peak value C/4C/4, so

βmax=2.303C4=0.576C\beta_{\max} = \frac{2.303\,C}{4} = 0.576\,C

Key Point: Buffer capacity is greatest when pH=pKa\mathrm{pH} = \mathrm{p}K_a, where the salt-to-acid ratio is 1:11{:}1, and it is directly proportional to the total buffer concentration.

Why the 1:11{:}1 mixture is the strongest

The Henderson-Hasselbalch equation, pH=pKa+log[salt][acid]\mathrm{pH} = \mathrm{p}K_a + \log\dfrac{[\text{salt}]}{[\text{acid}]}, says the pH tracks the logarithm of a ratio. Adding base converts acid into salt: it subtracts from the denominator and adds the same amount to the numerator. A ratio near 1 is the least sensitive place on that logarithmic curve, because both quantities are large and the fractional change in each is small.

Numbers make it concrete. Take one litre of buffer with C=1.0 MC = 1.0\ \mathrm{M} and pKa=4.76\mathrm{p}K_a = 4.76, and add 0.050.05 mol of NaOH.

Starting mixture Starting pH Final ratio Final pH ΔpH\Delta \mathrm{pH} β\beta from this addition
0.500.50 acid, 0.500.50 salt 4.764.76 0.55/0.450.55/0.45 4.854.85 0.0870.087 0.570.57
0.700.70 acid, 0.300.30 salt 4.394.39 0.35/0.650.35/0.65 4.494.49 0.100.10 0.500.50
0.900.90 acid, 0.100.10 salt 3.813.81 0.15/0.850.15/0.85 4.014.01 0.200.20 0.250.25

The lopsided buffer shifts more than twice as far for the same addition. The last column is an average capacity over the interval rather than the instantaneous β\beta at the starting pH, and the two need not agree, because β\beta itself changes as the base goes in. For the two lopsided mixtures β\beta is climbing towards its peak as acid is converted, so the average comes out above the starting value — 0.500.50 against 0.480.48, and 0.250.25 against 0.210.21. The 1:11{:}1 mixture starts at the peak, so its β\beta can only fall, and its average 0.570.57 sits just below the starting 0.5760.576.

The useful range

At pH=pKa±1\mathrm{pH} = \mathrm{p}K_a \pm 1 the ratio is 10:110{:}1 or 1:101{:}10, and r/(1+r)2r/(1+r)^{2} has fallen from 0.250.25 to 10/121=0.08310/121 = 0.083 — almost exactly one third of the maximum. Beyond that the buffer is running out of one component and the capacity collapses. The working range of a buffer is pKa±1\mathrm{p}K_a \pm 1, and an acid is chosen for a target pH by finding one whose pKa\mathrm{p}K_a is within a unit of it.

Dilution: the trap

Diluting a buffer tenfold does not change [salt]/[acid][\text{salt}]/[\text{acid}], so the Henderson-Hasselbalch equation returns the same pH. The capacity, being proportional to CC, falls to one tenth. A diluted buffer holds the same pH and defends it ten times more weakly. The pH-unchanged result also has a limit of its own: once the components fall to around 106 M10^{-6}\ \mathrm{M}, the water terms and the neglected ±[H3O+]\pm[\mathrm{H_3O^+}] corrections in the mass balance matter, and the pH drifts towards 7.

Buffer capacity is also raised by having both components present in bulk rather than by any special ratio. A 0.01 M0.01\ \mathrm{M} acetate buffer at pH=4.76\mathrm{pH} = 4.76 is destroyed by 0.0060.006 mol of acid per litre; a 1.0 M1.0\ \mathrm{M} buffer at the same pH absorbs a hundred times as much for the same pH shift.

Choosing the acid for a target pH

Since the capacity peaks at pH=pKa\mathrm{pH} = \mathrm{p}K_a and stays usable within a unit of it, designing a buffer starts by picking a conjugate pair whose pKa\mathrm{p}K_a brackets the required pH, and only then adjusting the ratio.

Buffer pair pKa\mathrm{p}K_a at 298 K Best working range
HCOOH/HCOO\mathrm{HCOOH}/\mathrm{HCOO^-} 3.743.74 2.744.742.74 - 4.74
CH3COOH/CH3COO\mathrm{CH_3COOH}/\mathrm{CH_3COO^-} 4.764.76 3.765.763.76 - 5.76
H2CO3/HCO3\mathrm{H_2CO_3}/\mathrm{HCO_3^-} 6.356.35 5.357.355.35 - 7.35
H2PO4/HPO42\mathrm{H_2PO_4^-}/\mathrm{HPO_4^{2-}} 7.217.21 6.218.216.21 - 8.21
NH4+/NH3\mathrm{NH_4^+}/\mathrm{NH_3} 9.259.25 8.2510.258.25 - 10.25
HCO3/CO32\mathrm{HCO_3^-}/\mathrm{CO_3^{2-}} 10.3310.33 9.311.39.3 - 11.3

A basic buffer is handled with the same table by converting: an ammonia buffer has pKb=4.75\mathrm{p}K_b = 4.75 for the base, and the pKa\mathrm{p}K_a of its conjugate acid NH4+\mathrm{NH_4^+} is 144.75=9.2514 - 4.75 = 9.25 at 298 K. Blood is held near pH 7.4\mathrm{pH}\ 7.4 by the carbonic acid pair even though pKa\mathrm{p}K_a is 6.356.35, a full unit away, because the lungs and kidneys continuously restock both components — a working reminder that the ±1\pm 1 rule describes a closed beaker, not an open system.

[JEE Main] Questions phrase this as "which buffer resists change best". Rank first by how close the pH is to pKa\mathrm{p}K_a, then by total concentration. Both matter, and a highly concentrated buffer two pH units from its pKa\mathrm{p}K_a can still lose to a dilute one sitting exactly on it.

Titration Curves and the Choice of Indicator

A titration curve plots the pH of the flask against the volume of titrant added. Its shape is fixed by which of the two reagents is strong and which is weak, and the shape decides which indicator can be used.

Three titration curves with equivalence points and indicator ranges marked alongside

Strong acid against strong base

Take 25.0 mL25.0\ \mathrm{mL} of 0.10 M0.10\ \mathrm{M} HCl titrated with 0.10 M0.10\ \mathrm{M} NaOH. The pH is set entirely by whichever reagent is in excess, since neither ion of the salt formed reacts with water.

NaOH added / mL Species in excess pH
0.00.0 0.10 M H3O+0.10\ \mathrm{M}\ \mathrm{H_3O^+} 1.001.00
24.024.0 H3O+\mathrm{H_3O^+}, 2.0×103 M2.0 \times 10^{-3}\ \mathrm{M} 2.692.69
24.924.9 H3O+\mathrm{H_3O^+}, 2.0×104 M2.0 \times 10^{-4}\ \mathrm{M} 3.703.70
25.025.0 neither; NaCl solution 7.007.00
25.125.1 OH\mathrm{OH^-}, 2.0×104 M2.0 \times 10^{-4}\ \mathrm{M} 10.3010.30
50.050.0 OH\mathrm{OH^-}, 3.3×102 M3.3 \times 10^{-2}\ \mathrm{M} 12.5212.52

Between 24.924.9 and 25.1 mL25.1\ \mathrm{mL} — about four drops — the pH climbs from 3.703.70 to 10.3010.30. The equivalence pH is 7.007.00 at 298 K, because Na+\mathrm{Na^+} and Cl\mathrm{Cl^-} are the ions of a strong base and a strong acid and neither hydrolyses. At another temperature the neutral pH is not 7 and neither is the equivalence point.

Weak acid against strong base

Take 25.0 mL25.0\ \mathrm{mL} of 0.10 M0.10\ \mathrm{M} CH3COOH\mathrm{CH_3COOH} (Ka=1.74×105K_a = 1.74 \times 10^{-5}, pKa=4.76\mathrm{p}K_a = 4.76) with 0.10 M0.10\ \mathrm{M} NaOH. Four regions follow one another.

  1. Before any base. A weak acid on its own: [H3O+]=Kac=1.32×103[\mathrm{H_3O^+}] = \sqrt{K_ac} = 1.32 \times 10^{-3}, pH=2.88\mathrm{pH} = 2.88. The curve starts far higher than the strong acid's 1.001.00.
  2. The buffer region. Between the first drop and the equivalence point the flask holds acid and its conjugate base together, and the pH follows the Henderson-Hasselbalch equation. The curve is at its flattest here.
  3. The half-equivalence point, at 12.5 mL12.5\ \mathrm{mL}. Exactly half the acid has been converted, so [salt]=[acid][\text{salt}] = [\text{acid}], the logarithm vanishes and pH=pKa=4.76\mathrm{pH} = \mathrm{p}K_a = 4.76. This is the standard experimental route to pKa\mathrm{p}K_a — no concentrations need to be known, only the volume at which half the equivalence volume has been delivered.
  4. The equivalence point, at 25.0 mL25.0\ \mathrm{mL}. Every acid molecule has become acetate, at 0.05 M0.05\ \mathrm{M} in the doubled volume. Acetate is a Bronsted base with Kb=Kw/Ka=5.7×1010K_b = K_w/K_a = 5.7 \times 10^{-10}, so [OH]=Kbc=5.34×106[\mathrm{OH^-}] = \sqrt{K_b c} = 5.34 \times 10^{-6} and pH=8.73\mathrm{pH} = 8.73. The equivalence pH is above 7 and it is not the point where pH equals 7.

Measured over the same 24.924.9 to 25.1 mL25.1\ \mathrm{mL} window used for the strong acid, the jump runs from 7.17.1 to 10.310.3 — shorter than for the strong-strong case and displaced upwards.

Strong acid against weak base

Take 25.0 mL25.0\ \mathrm{mL} of 0.10 M0.10\ \mathrm{M} NH3\mathrm{NH_3} (Kb=1.77×105K_b = 1.77 \times 10^{-5}, pKb=4.75\mathrm{p}K_b = 4.75) with 0.10 M0.10\ \mathrm{M} HCl. The mirror image: the curve starts at pH=11.12\mathrm{pH} = 11.12, the half-equivalence point has pOH=pKb\mathrm{pOH} = \mathrm{p}K_b so pH=9.25\mathrm{pH} = 9.25, and at equivalence the flask holds 0.05 M0.05\ \mathrm{M} NH4+\mathrm{NH_4^+}, an acid with Ka=Kw/Kb=5.6×1010K_a = K_w/K_b = 5.6 \times 10^{-10}. Then [H3O+]=5.29×106[\mathrm{H_3O^+}] = 5.29 \times 10^{-6} and pH=5.28\mathrm{pH} = 5.28, below 7. Over the same 24.924.9 to 25.1 mL25.1\ \mathrm{mL} window the jump runs down from 6.96.9 to 3.73.7.

Titration pH at start pH at half-equivalence pH at equivalence (298 K) Jump from 24.924.9 to 25.1 mL25.1\ \mathrm{mL}
Strong acid, strong base 1.001.00 no special value 7.007.00 3.73.7 to 10.310.3
Weak acid, strong base 2.882.88 pKa=4.76\mathrm{p}K_a = 4.76 above 7, 8.738.73 7.17.1 to 10.310.3
Strong acid, weak base 11.1211.12 14pKb=9.2514 - \mathrm{p}K_b = 9.25 below 7, 5.285.28 6.96.9 to 3.73.7
Weak acid, weak base intermediate near 7 if KaKbK_a \approx K_b no sharp jump

The weak-weak titration has no usable indicator end point at all, because there is no steep region for a colour change to sit in; conductometric titration is used instead.

How an indicator works

An acid-base indicator is itself a weak acid whose two forms differ in colour:

HInH++InKIn=[H+][In][HIn]pH=pKIn+log[In][HIn]\mathrm{HIn} \rightleftharpoons \mathrm{H^+} + \mathrm{In^-} \qquad K_{\mathrm{In}} = \frac{[\mathrm{H^+}][\mathrm{In^-}]}{[\mathrm{HIn}]} \qquad \mathrm{pH} = \mathrm{p}K_{\mathrm{In}} + \log\frac{[\mathrm{In^-}]}{[\mathrm{HIn}]}

The eye stops seeing one colour when the other form reaches roughly a tenth of it, so the visible transition spans the ratios 1:101{:}10 to 10:110{:}1, that is pKIn±1\mathrm{p}K_{\mathrm{In}} \pm 1. Only a very small amount of indicator is added, so it does not consume a measurable quantity of the titrant.

Indicator pH range Colour in acid Colour in base pKIn\mathrm{p}K_{\mathrm{In}}
Thymol blue (first change) 1.22.81.2 - 2.8 red yellow 1.7\approx 1.7
Methyl orange 3.14.43.1 - 4.4 red yellow 3.7\approx 3.7
Bromophenol blue 3.04.63.0 - 4.6 yellow blue 4.0\approx 4.0
Methyl red 4.26.34.2 - 6.3 red yellow 5.1\approx 5.1
Bromothymol blue 6.07.66.0 - 7.6 yellow blue 7.0\approx 7.0
Phenol red 6.88.46.8 - 8.4 yellow red 7.9\approx 7.9
Phenolphthalein 8.310.08.3 - 10.0 colourless pink 9.1\approx 9.1
Thymolphthalein 9.310.59.3 - 10.5 colourless blue 9.9\approx 9.9
Alizarin yellow R 10.112.010.1 - 12.0 yellow red 11.0\approx 11.0

Key Point: Choose an indicator whose transition range lies wholly inside the steep part of the curve, so that the colour changes within one drop of the equivalence point. It is the position of the range, not a match with pH 7, that decides.

Applying that rule to the three cases: strong against strong takes methyl red or phenolphthalein outright, both ranges lying wholly inside 3.73.7 to 10.310.3, and methyl orange serves in practice as well — its range opens at 3.13.1, a shade below the foot of the jump, but its change to yellow is complete by 4.44.4, comfortably inside the steep region. Weak acid against strong base needs phenolphthalein or thymolphthalein; methyl orange would have finished its change to yellow by about 8 mL8\ \mathrm{mL}, less than a third of the way to the equivalence point. Strong acid against weak base needs methyl red or methyl orange; phenolphthalein would lose its pink long before the equivalence point and report far too little acid.

Selective Precipitation

When one reagent can precipitate two or more ions in the same solution, the ion whose salt needs the smallest concentration of the added ion comes down first. Adding the reagent slowly separates them.

Setting the threshold

Precipitation begins the instant the ionic product reaches KspK_{sp}. For a 1:11{:}1 salt AgX\mathrm{AgX} in a solution already containing X\mathrm{X^-},

[Ag+]start=Ksp(AgX)[X][\mathrm{Ag^+}]_{\text{start}} = \frac{K_{sp}(\mathrm{AgX})}{[\mathrm{X^-}]}

Below this the solution is unsaturated and nothing appears; at it the solution is exactly saturated; above it solid separates until the product falls back to KspK_{sp}.

Take a litre holding 0.10 M0.10\ \mathrm{M} each of Cl\mathrm{Cl^-}, Br\mathrm{Br^-} and I\mathrm{I^-}, with silver nitrate solution added drop by drop.

Salt KspK_{sp} at 298 K [Ag+][\mathrm{Ag^+}] needed with the halide at 0.10 M0.10\ \mathrm{M} Order
AgI\mathrm{AgI} 8.3×10178.3 \times 10^{-17} 8.3×1016 M8.3 \times 10^{-16}\ \mathrm{M} first
AgBr\mathrm{AgBr} 5.0×10135.0 \times 10^{-13} 5.0×1012 M5.0 \times 10^{-12}\ \mathrm{M} second
AgCl\mathrm{AgCl} 1.8×10101.8 \times 10^{-10} 1.8×109 M1.8 \times 10^{-9}\ \mathrm{M} third

Silver ion concentration scale showing where iodide bromide and chloride begin to precipitate

How clean the separation is

The useful question is not which comes first but how much of the first ion is still in solution when the second starts. Silver bromide begins when [Ag+]=5.0×1012 M[\mathrm{Ag^+}] = 5.0 \times 10^{-12}\ \mathrm{M}. At that instant the iodide left over is fixed by the silver iodide equilibrium:

[I]=Ksp(AgI)[Ag+]=8.3×10175.0×1012=1.7×105 M[\mathrm{I^-}] = \frac{K_{sp}(\mathrm{AgI})}{[\mathrm{Ag^+}]} = \frac{8.3 \times 10^{-17}}{5.0 \times 10^{-12}} = 1.7 \times 10^{-5}\ \mathrm{M}

That is 0.017%0.017\% of the original 0.10 M0.10\ \mathrm{M}: over 99.98%99.98\% of the iodide is already in the precipitate before any bromide is touched. Repeating the calculation at the moment silver chloride starts, [Ag+]=1.8×109 M[\mathrm{Ag^+}] = 1.8 \times 10^{-9}\ \mathrm{M} leaves [Br]=2.8×104 M[\mathrm{Br^-}] = 2.8 \times 10^{-4}\ \mathrm{M}, or 0.28%0.28\% of the bromide.

Key Point: For two salts of the same formula type sharing a common ion, the separation is essentially complete when their solubility products differ by a factor of about 10310^{3} or more. A smaller gap leaves the two precipitating together over much of the addition.

The comparison that must be made with care

Ranking salts by KspK_{sp} alone works only when they are of the same formula type. Silver chromate has Ksp=1.1×1012K_{sp} = 1.1 \times 10^{-12}, smaller than silver chloride's 1.8×10101.8 \times 10^{-10}, yet it is the more soluble salt: s(Ag2CrO4)=(Ksp/4)1/3=6.5×105 Ms(\mathrm{Ag_2CrO_4}) = (K_{sp}/4)^{1/3} = 6.5 \times 10^{-5}\ \mathrm{M} against s(AgCl)=Ksp=1.3×105 Ms(\mathrm{AgCl}) = \sqrt{K_{sp}} = 1.3 \times 10^{-5}\ \mathrm{M}. The chromate releases two silver ions per formula unit and its KspK_{sp} carries a squared term, so the numbers are not on the same footing.

The safe procedure is always to compute the concentration of the added ion at which each salt starts. With [Cl]=[CrO42]=0.10 M[\mathrm{Cl^-}] = [\mathrm{CrO_4^{2-}}] = 0.10\ \mathrm{M}:

[Ag+]AgCl=1.8×10100.10=1.8×109 M[Ag+]Ag2CrO4=1.1×10120.10=3.3×106 M[\mathrm{Ag^+}]_{\mathrm{AgCl}} = \frac{1.8\times 10^{-10}}{0.10} = 1.8 \times 10^{-9}\ \mathrm{M} \qquad [\mathrm{Ag^+}]_{\mathrm{Ag_2CrO_4}} = \sqrt{\frac{1.1\times 10^{-12}}{0.10}} = 3.3 \times 10^{-6}\ \mathrm{M}

Silver chloride needs a thousand times less silver, so all the chloride precipitates before the first red speck of silver chromate appears. That is exactly the basis of Mohr's method, in which chromate is the indicator for a chloride titration.

Controlling an ion instead of adding it

Sulphide separations do not add sulphide directly; they control it through acidity, using the coupled equilibrium of the earlier block:

[S2]=Ka1Ka2[H2S][H+]2[\mathrm{S^{2-}}] = \frac{K_{a_1}K_{a_2}[\mathrm{H_2S}]}{[\mathrm{H^+}]^{2}}

In a solution saturated with H2S\mathrm{H_2S} and made 0.1 M0.1\ \mathrm{M} in HCl, [S2][\mathrm{S^{2-}}] sits near 1.0×1019 M1.0 \times 10^{-19}\ \mathrm{M}. With a metal ion at around 102 M10^{-2}\ \mathrm{M} the ionic product is near 102110^{-21}, which exceeds KspK_{sp} for CuS (8×10378 \times 10^{-37}), CdS (8×10278 \times 10^{-27}) and ZnS (1.6×10241.6 \times 10^{-24}) but not for FeS (6.3×10186.3 \times 10^{-18}) or MnS (2.5×10132.5 \times 10^{-13}). Raising the acid to 0.3 M0.3\ \mathrm{M} divides [S2][\mathrm{S^{2-}}] by nine, to about 1.1×1020 M1.1 \times 10^{-20}\ \mathrm{M}, which pulls the ionic product down to about 102210^{-22} — still above KspK_{sp} for ZnS, so zinc does not return to solution on these numbers. What the extra acid buys is margin: it pushes the borderline sulphides closer to their saturation point while leaving the very insoluble ones untouched. Setting the sulphide groups of qualitative analysis apart is done the same way, by choosing the acidity rather than by adding sulphide, and the zinc group is held back not by more acid but by precipitating it separately from an alkaline medium, where [S2][\mathrm{S^{2-}}] is orders of magnitude higher. The same hydroxide-based logic separates Fe3+\mathrm{Fe^{3+}} from Mg2+\mathrm{Mg^{2+}}: a buffered pH\mathrm{pH} near 5 precipitates Fe(OH)3\mathrm{Fe(OH)_3} (Ksp=1.0×1038K_{sp} = 1.0 \times 10^{-38}) completely while leaving Mg(OH)2\mathrm{Mg(OH)_2} (Ksp=8.9×1012K_{sp} = 8.9 \times 10^{-12}) untouched.

[JEE/NEET] Every one of these problems reduces to a single sentence: compute the ionic product with the concentrations actually present after mixing, and compare it with KspK_{sp}. Dilution on mixing is the step most often skipped.

Question 1: Degree of dissociation of PCl5\mathrm{PCl_5} from vapour density

The vapour density of phosphorus pentachloride at 523 K523\ \mathrm{K} and a total pressure of 2.0 bar2.0\ \mathrm{bar} is found to be 69.569.5. Calculate the degree of dissociation, KpK_p and KcK_c for PCl5(g)PCl3(g)+Cl2(g)\mathrm{PCl_5(g)} \rightleftharpoons \mathrm{PCl_3(g)} + \mathrm{Cl_2(g)}. Take P=31\mathrm{P} = 31, Cl=35.5\mathrm{Cl} = 35.5 and R=0.0831 LbarK1mol1R = 0.0831\ \mathrm{L\,bar\,K^{-1}\,mol^{-1}}.

Answer:

First I find the theoretical vapour density from the formula. The molar mass of PCl5\mathrm{PCl_5} is 31+5(35.5)=208.5 gmol131 + 5(35.5) = 208.5\ \mathrm{g\,mol^{-1}}, so D=208.5/2=104.25D = 208.5/2 = 104.25.

One mole of PCl5\mathrm{PCl_5} gives one mole of PCl3\mathrm{PCl_3} and one of Cl2\mathrm{Cl_2}, so n=2n = 2 and n1=1n - 1 = 1.

α=Dd(n1)d=104.2569.51×69.5=34.7569.5=0.50\alpha = \frac{D-d}{(n-1)d} = \frac{104.25 - 69.5}{1 \times 69.5} = \frac{34.75}{69.5} = 0.50

Half the pentachloride has dissociated. For KpK_p I use the AB+C\mathrm{A} \rightleftharpoons \mathrm{B} + \mathrm{C} result with P=2.0 barP = 2.0\ \mathrm{bar}:

Kp=α2P1α2=(0.50)2(2.0)10.25=0.500.75=0.67 barK_p = \frac{\alpha^{2}P}{1-\alpha^{2}} = \frac{(0.50)^{2}(2.0)}{1-0.25} = \frac{0.50}{0.75} = 0.67\ \mathrm{bar}

For KcK_c I use Kp=Kc(RT)ΔnK_p = K_c(RT)^{\Delta n} with Δn=21=1\Delta n = 2 - 1 = 1:

Kc=KpRT=0.670.0831×523=0.6743.5=1.5×102 molL1K_c = \frac{K_p}{RT} = \frac{0.67}{0.0831 \times 523} = \frac{0.67}{43.5} = 1.5 \times 10^{-2}\ \mathrm{mol\,L^{-1}}

Ans: α=0.50\alpha = 0.50 (50% dissociated), Kp=0.67 barK_p = 0.67\ \mathrm{bar}, Kc=1.5×102 molL1K_c = 1.5 \times 10^{-2}\ \mathrm{mol\,L^{-1}} Watch out: DD is the vapour density, 104.25104.25, not the molar mass 208.5208.5. Using 208.5208.5 in place of DD returns α=2.0\alpha = 2.0, which is impossible since α\alpha cannot exceed 1 — a useful check on the arithmetic.


Question 2: N2O4\mathrm{N_2O_4} from an observed molar mass

The observed molar mass of an equilibrium mixture of N2O4\mathrm{N_2O_4} and NO2\mathrm{NO_2} at 1.0 bar1.0\ \mathrm{bar} is 80.0 gmol180.0\ \mathrm{g\,mol^{-1}}. Find the degree of dissociation of N2O4\mathrm{N_2O_4} and KpK_p at this temperature. Take N=14\mathrm{N} = 14, O=16\mathrm{O} = 16.

Answer:

The theoretical molar mass of N2O4\mathrm{N_2O_4} is 2(14)+4(16)=92.0 gmol12(14) + 4(16) = 92.0\ \mathrm{g\,mol^{-1}}.

The reaction N2O4(g)2NO2(g)\mathrm{N_2O_4(g)} \rightleftharpoons 2\mathrm{NO_2(g)} gives two moles of gas from one, so n=2n = 2.

α=MtheoreticalMobserved(n1)Mobserved=92.080.080.0=12.080.0=0.15\alpha = \frac{M_{\text{theoretical}} - M_{\text{observed}}}{(n-1)M_{\text{observed}}} = \frac{92.0 - 80.0}{80.0} = \frac{12.0}{80.0} = 0.15

For a reactant giving two moles of the same product the constant carries a factor of 4:

Kp=4α2P1α2=4(0.15)2(1.0)10.0225=0.09000.9775=0.092 barK_p = \frac{4\alpha^{2}P}{1-\alpha^{2}} = \frac{4(0.15)^{2}(1.0)}{1 - 0.0225} = \frac{0.0900}{0.9775} = 0.092\ \mathrm{bar}

Ans: α=0.15\alpha = 0.15 (15% dissociated), Kp=0.092 barK_p = 0.092\ \mathrm{bar} Watch out: The factor 4 comes from squaring the coefficient 2 in 2NO22\mathrm{NO_2}. Leaving it out gives 0.023 bar0.023\ \mathrm{bar}, exactly a quarter of the right value, and it is the commonest error in the whole topic.


Question 3: Ammonium chloride vapour

The vapour above solid ammonium chloride heated to 673 K673\ \mathrm{K} has an observed vapour density of 14.514.5. Assuming the vapour is entirely NH3\mathrm{NH_3}, HCl\mathrm{HCl} and undissociated NH4Cl\mathrm{NH_4Cl}, find the percentage dissociation. Take N=14\mathrm{N} = 14, H=1\mathrm{H} = 1, Cl=35.5\mathrm{Cl} = 35.5.

Answer:

The formula mass of NH4Cl\mathrm{NH_4Cl} is 14+4+35.5=53.5 gmol114 + 4 + 35.5 = 53.5\ \mathrm{g\,mol^{-1}}, so the theoretical vapour density is D=53.5/2=26.75D = 53.5/2 = 26.75.

The dissociation NH4Cl(g)NH3(g)+HCl(g)\mathrm{NH_4Cl(g)} \rightleftharpoons \mathrm{NH_3(g)} + \mathrm{HCl(g)} produces two moles from one, so n=2n = 2.

α=Dd(n1)d=26.7514.514.5=12.2514.5=0.845\alpha = \frac{D-d}{(n-1)d} = \frac{26.75 - 14.5}{14.5} = \frac{12.25}{14.5} = 0.845

Multiplying by 100 gives the percentage.

The observed molar mass is 2×14.5=29.0 gmol12 \times 14.5 = 29.0\ \mathrm{g\,mol^{-1}}, which is close to that of air. A vapour that appears to weigh about as much as air, from a compound of formula mass 53.553.5, signals extensive dissociation before any calculation is done.

Ans: 84.5%84.5\% dissociated Watch out: The measured density falling below the formula value is what defines dissociation here. If a measured dd ever comes out above DD, the vapour is associating, not dissociating, and this formula does not apply.

Question 4: How the degree of dissociation follows the pressure

For N2O4(g)2NO2(g)\mathrm{N_2O_4(g)} \rightleftharpoons 2\mathrm{NO_2(g)}, Kp=0.15 barK_p = 0.15\ \mathrm{bar} at a certain temperature. Calculate the degree of dissociation at a total pressure of 1.0 bar1.0\ \mathrm{bar} and at 10.0 bar10.0\ \mathrm{bar}, and comment on the ratio.

Answer:

I start from Kp=4α2P/(1α2)K_p = 4\alpha^{2}P/(1-\alpha^{2}) and make α\alpha the subject. Cross-multiplying, Kp(1α2)=4α2PK_p(1-\alpha^{2}) = 4\alpha^{2}P, so Kp=α2(Kp+4P)K_p = \alpha^{2}(K_p + 4P) and

α=KpKp+4P\alpha = \sqrt{\frac{K_p}{K_p + 4P}}

At P=1.0 barP = 1.0\ \mathrm{bar}:

α=0.150.15+4.0=0.154.15=0.0361=0.19\alpha = \sqrt{\frac{0.15}{0.15 + 4.0}} = \sqrt{\frac{0.15}{4.15}} = \sqrt{0.0361} = 0.19

At P=10.0 barP = 10.0\ \mathrm{bar}:

α=0.150.15+40.0=0.1540.15=0.00374=0.061\alpha = \sqrt{\frac{0.15}{0.15 + 40.0}} = \sqrt{\frac{0.15}{40.15}} = \sqrt{0.00374} = 0.061

Ten times the pressure gives about one third the dissociation. Since α\alpha is small in both cases, Kp4α2PK_p \approx 4\alpha^{2}P, so α\alpha varies as P1/2P^{-1/2} and the predicted ratio is 10=3.16\sqrt{10} = 3.16. The computed ratio is 0.19/0.061=3.110.19/0.061 = 3.11, close because the α2\alpha^{2} correction in the denominator is tiny at these values.

Compression forces the equilibrium towards the side with fewer gaseous moles, which is the undissociated N2O4\mathrm{N_2O_4}, so α\alpha falls. KpK_p itself does not move; only temperature changes it.

Ans: α=0.19\alpha = 0.19 at 1.0 bar1.0\ \mathrm{bar} and α=0.061\alpha = 0.061 at 10.0 bar10.0\ \mathrm{bar} Watch out: A falling α\alpha is not a falling KpK_p. Pressure redistributes the mixture at constant KpK_p; only a temperature change alters the constant.


Question 5: Dissociation suppressed by a product already present

One mole of PCl5\mathrm{PCl_5} is heated with one mole of Cl2\mathrm{Cl_2} in a vessel until equilibrium is reached at a total pressure of 2.0 bar2.0\ \mathrm{bar}, at the temperature where Kp=2/3 barK_p = 2/3\ \mathrm{bar}. Find the degree of dissociation of PCl5\mathrm{PCl_5} and compare it with the value obtained when no chlorine is added.

Answer:

I build the mole table first. Starting from 1 mol PCl5\mathrm{PCl_5} and 1 mol Cl2\mathrm{Cl_2}, with α\alpha mol of the pentachloride dissociating:

PCl5=1αPCl3=αCl2=1+αtotal=2+α\mathrm{PCl_5} = 1-\alpha \qquad \mathrm{PCl_3} = \alpha \qquad \mathrm{Cl_2} = 1+\alpha \qquad \text{total} = 2+\alpha

The chlorine already present adds to the chlorine produced, which is why its count is 1+α1+\alpha and the total is 2+α2+\alpha rather than 1+α1+\alpha.

Each partial pressure is the mole fraction multiplied by P=2.0 barP = 2.0\ \mathrm{bar}:

Kp=pPCl3pCl2pPCl5=α(1+α)(1α)(2+α)PK_p = \frac{p_{\mathrm{PCl_3}}\,p_{\mathrm{Cl_2}}}{p_{\mathrm{PCl_5}}} = \frac{\alpha(1+\alpha)}{(1-\alpha)(2+\alpha)}\,P

Substituting Kp=2/3K_p = 2/3 and P=2P = 2:

23=2α(1+α)(1α)(2+α)(1α)(2+α)=3α(1+α)\frac{2}{3} = \frac{2\alpha(1+\alpha)}{(1-\alpha)(2+\alpha)} \quad\Longrightarrow\quad (1-\alpha)(2+\alpha) = 3\alpha(1+\alpha)

Expanding both sides, 2αα2=3α+3α22 - \alpha - \alpha^{2} = 3\alpha + 3\alpha^{2}, which rearranges to

4α2+4α2=02α2+2α1=04\alpha^{2} + 4\alpha - 2 = 0 \quad\Longrightarrow\quad 2\alpha^{2} + 2\alpha - 1 = 0

α=2+4+84=2+3.4644=0.366\alpha = \frac{-2 + \sqrt{4 + 8}}{4} = \frac{-2 + 3.464}{4} = 0.366

Without added chlorine the same KpK_p and PP give α=Kp/(Kp+P)=0.667/2.667=0.50\alpha = \sqrt{K_p/(K_p+P)} = \sqrt{0.667/2.667} = 0.50.

Ans: α=0.366\alpha = 0.366 with the added chlorine, against 0.500.50 without it Watch out: The chlorine changes both the numerator and the total mole count, so the 1+α1+\alpha denominator of the simple case becomes 2+α2+\alpha. Using the plain α2P/(1α2)\alpha^{2}P/(1-\alpha^{2}) formula here quietly assumes there is no added chlorine at all.

Question 6: Two solids releasing a common gas

Solid NH4HS\mathrm{NH_4HS} and solid NH4Cl\mathrm{NH_4Cl} are both placed in an evacuated vessel and allowed to reach equilibrium at a temperature where

NH4HS(s)NH3(g)+H2S(g), Kp1=0.090 bar2NH4Cl(s)NH3(g)+HCl(g), Kp2=0.160 bar2\mathrm{NH_4HS(s)} \rightleftharpoons \mathrm{NH_3(g)} + \mathrm{H_2S(g)},\ K_{p_1} = 0.090\ \mathrm{bar^{2}} \qquad \mathrm{NH_4Cl(s)} \rightleftharpoons \mathrm{NH_3(g)} + \mathrm{HCl(g)},\ K_{p_2} = 0.160\ \mathrm{bar^{2}}

Both solids remain in excess. Find the partial pressure of each gas and the total pressure, and compare with the pressures each solid would give on its own.

Answer:

Ammonia is shared, so there is only one pNH3p_{\mathrm{NH_3}} in the vessel and it must satisfy both expressions.

I let pH2S=xp_{\mathrm{H_2S}} = x and pHCl=yp_{\mathrm{HCl}} = y. Every ammonia molecule came from one solid or the other, one for each molecule of the partner gas, so

pNH3=x+yp_{\mathrm{NH_3}} = x + y

The two equilibrium constants become

Kp1=x(x+y)=0.090Kp2=y(x+y)=0.160K_{p_1} = x(x+y) = 0.090 \qquad K_{p_2} = y(x+y) = 0.160

Adding the two equations gives (x+y)2=0.250(x+y)^{2} = 0.250, so

pNH3=x+y=0.250=0.50 barp_{\mathrm{NH_3}} = x + y = \sqrt{0.250} = 0.50\ \mathrm{bar}

Now each partner follows from its own constant:

x=pH2S=0.0900.50=0.18 bary=pHCl=0.1600.50=0.32 barx = p_{\mathrm{H_2S}} = \frac{0.090}{0.50} = 0.18\ \mathrm{bar} \qquad y = p_{\mathrm{HCl}} = \frac{0.160}{0.50} = 0.32\ \mathrm{bar}

Ptotal=0.50+0.18+0.32=1.00 barP_{\text{total}} = 0.50 + 0.18 + 0.32 = 1.00\ \mathrm{bar}

Alone, NH4HS\mathrm{NH_4HS} would give pNH3=pH2S=0.090=0.30 barp_{\mathrm{NH_3}} = p_{\mathrm{H_2S}} = \sqrt{0.090} = 0.30\ \mathrm{bar}, and NH4Cl\mathrm{NH_4Cl} alone would give 0.40 bar0.40\ \mathrm{bar} of each gas. Together, the shared ammonia rises to 0.50 bar0.50\ \mathrm{bar} while hydrogen sulphide is pushed down from 0.300.30 to 0.18 bar0.18\ \mathrm{bar} and hydrogen chloride from 0.400.40 to 0.32 bar0.32\ \mathrm{bar}.

Ans: pNH3=0.50 barp_{\mathrm{NH_3}} = 0.50\ \mathrm{bar}, pH2S=0.18 barp_{\mathrm{H_2S}} = 0.18\ \mathrm{bar}, pHCl=0.32 barp_{\mathrm{HCl}} = 0.32\ \mathrm{bar}, Ptotal=1.00 barP_{\text{total}} = 1.00\ \mathrm{bar} Watch out: The two equilibria cannot be solved one at a time. Treating them separately and adding the four pressures gives 1.40 bar1.40\ \mathrm{bar}, which satisfies neither constant.


Question 7: Sulphide concentration controlled by acid

A solution 0.1 M0.1\ \mathrm{M} in HCl and saturated with H2S\mathrm{H_2S} contains sulphide ion at 1.0×1019 M1.0 \times 10^{-19}\ \mathrm{M}. Ten millilitres of this solution is added to 5 mL5\ \mathrm{mL} of 0.04 M0.04\ \mathrm{M} solutions of FeSO4\mathrm{FeSO_4}, MnCl2\mathrm{MnCl_2}, ZnCl2\mathrm{ZnCl_2} and CdCl2\mathrm{CdCl_2} in turn. In which will a sulphide precipitate? Take KspK_{sp} as 6.3×10186.3 \times 10^{-18} (FeS), 2.5×10132.5 \times 10^{-13} (MnS), 1.6×10241.6 \times 10^{-24} (ZnS) and 8.0×10278.0 \times 10^{-27} (CdS).

Answer:

Mixing dilutes both solutions, and the dilution must be done before any comparison. The total volume is 10+5=15 mL10 + 5 = 15\ \mathrm{mL}.

[S2]=1.0×1019×1015=6.7×1020 M[\mathrm{S^{2-}}] = 1.0 \times 10^{-19} \times \frac{10}{15} = 6.7 \times 10^{-20}\ \mathrm{M}

[M2+]=0.04×515=1.3×102 M[\mathrm{M^{2+}}] = 0.04 \times \frac{5}{15} = 1.3 \times 10^{-2}\ \mathrm{M}

The ionic product is the same for all four, because every one of these salts is MS\mathrm{MS} and each solution has the same metal ion concentration:

Qsp=[M2+][S2]=(1.3×102)(6.7×1020)=8.9×1022Q_{sp} = [\mathrm{M^{2+}}][\mathrm{S^{2-}}] = (1.3 \times 10^{-2})(6.7 \times 10^{-20}) = 8.9 \times 10^{-22}

Now I compare this single number with each KspK_{sp}. Precipitation happens when Qsp>KspQ_{sp} > K_{sp}.

Salt KspK_{sp} QspQ_{sp} against KspK_{sp} Result
FeS 6.3×10186.3 \times 10^{-18} QspQ_{sp} smaller no precipitate
MnS 2.5×10132.5 \times 10^{-13} QspQ_{sp} smaller no precipitate
ZnS 1.6×10241.6 \times 10^{-24} QspQ_{sp} larger precipitates
CdS 8.0×10278.0 \times 10^{-27} QspQ_{sp} larger precipitates

Ans: ZnS\mathrm{ZnS} and CdS\mathrm{CdS} precipitate; FeS\mathrm{FeS} and MnS\mathrm{MnS} do not Watch out: Skipping the dilution multiplies the ionic product by about 4.54.5 — it gives (1.0×1019)(0.04)=4.0×1021(1.0 \times 10^{-19})(0.04) = 4.0 \times 10^{-21} against the correct 8.9×10228.9 \times 10^{-22} — which does not change the verdict here but does in problems where a value sits close to KspK_{sp}. Raising the HCl to 0.3 M0.3\ \mathrm{M} would divide [S2][\mathrm{S^{2-}}] by nine, since [S2][\mathrm{S^{2-}}] goes as 1/[H+]21/[\mathrm{H^+}]^{2}, taking the ionic product to about 9.9×10239.9 \times 10^{-23}; that is still well above Ksp(ZnS)K_{sp}(\mathrm{ZnS}), so zinc comes down even then, and separating it from cadmium needs a different medium rather than more acid.

Question 8: When the small-xx approximation must be abandoned

Calculate the degree of ionisation and the pH of 0.020 M0.020\ \mathrm{M} hydrofluoric acid, for which Ka=3.5×104K_a = 3.5 \times 10^{-4}, first with the usual approximation and then exactly. Comment on the difference.

Answer:

I apply the validity test before choosing a method.

cKa=0.0203.5×104=57\frac{c}{K_a} = \frac{0.020}{3.5 \times 10^{-4}} = 57

This is far below 400, so the approximation is not safe here and the quadratic must be solved.

The approximate route, for comparison. [H3O+]=Kac=(3.5×104)(0.020)=7.0×106=2.65×103 M[\mathrm{H_3O^+}] = \sqrt{K_ac} = \sqrt{(3.5 \times 10^{-4})(0.020)} = \sqrt{7.0 \times 10^{-6}} = 2.65 \times 10^{-3}\ \mathrm{M}, giving pH=2.58\mathrm{pH} = 2.58 and α=0.132\alpha = 0.132.

The exact route. With x=[H3O+]x = [\mathrm{H_3O^+}] at equilibrium and (cx)(c-x) left as it is:

Ka=x2cxx2+KaxKac=0K_a = \frac{x^{2}}{c-x} \quad\Longrightarrow\quad x^{2} + K_ax - K_ac = 0

x2+(3.5×104)x7.0×106=0x^{2} + (3.5 \times 10^{-4})x - 7.0 \times 10^{-6} = 0

The discriminant is (3.5×104)2+4(7.0×106)=1.23×107+2.80×105=2.81×105(3.5 \times 10^{-4})^{2} + 4(7.0 \times 10^{-6}) = 1.23 \times 10^{-7} + 2.80 \times 10^{-5} = 2.81 \times 10^{-5}, whose square root is 5.30×1035.30 \times 10^{-3}. Taking the positive root,

x=3.5×104+5.30×1032=2.48×103 Mx = \frac{-3.5 \times 10^{-4} + 5.30 \times 10^{-3}}{2} = 2.48 \times 10^{-3}\ \mathrm{M}

α=2.48×1030.020=0.124pH=log(2.48×103)=2.61\alpha = \frac{2.48 \times 10^{-3}}{0.020} = 0.124 \qquad \mathrm{pH} = -\log(2.48 \times 10^{-3}) = 2.61

The approximation overstates [H3O+][\mathrm{H_3O^+}] by about 7%7\% and understates the pH by 0.030.03. It always errs in this direction, because replacing (cx)(c-x) by cc pretends more acid is available than there is.

Ans: exact α=0.124\alpha = 0.124 and pH=2.61\mathrm{pH} = 2.61; the approximation gives α=0.132\alpha = 0.132 and pH=2.58\mathrm{pH} = 2.58 Watch out: For 1.0×103 M1.0 \times 10^{-3}\ \mathrm{M} chloroacetic acid, Ka=1.35×103K_a = 1.35 \times 10^{-3}, the same approximation returns [H3O+]=1.16×103 M[\mathrm{H_3O^+}] = 1.16 \times 10^{-3}\ \mathrm{M} — more hydrogen ion than the acid taken. The quadratic gives 6.75×104 M6.75 \times 10^{-4}\ \mathrm{M} and pH=3.17\mathrm{pH} = 3.17. Whenever c/Kac/K_a is near 1 the approximation does not merely lose accuracy, it produces impossible numbers.


Question 9: When water's own ionisation cannot be ignored

(a) Calculate the pH of 1.0×105 M1.0 \times 10^{-5}\ \mathrm{M} HCN, Ka=4.9×1010K_a = 4.9 \times 10^{-10}. (b) Calculate the pH of 1.0×108 M1.0 \times 10^{-8}\ \mathrm{M} HCl. Take Kw=1.0×1014K_w = 1.0 \times 10^{-14} at 298 K.

Answer:

(a) I first check how much acid the solute can supply against what water supplies. The product Kac=(4.9×1010)(1.0×105)=4.9×1015K_ac = (4.9 \times 10^{-10})(1.0 \times 10^{-5}) = 4.9 \times 10^{-15}, which is smaller than Kw=1.0×1014K_w = 1.0 \times 10^{-14}. Water is the larger source, so it must be kept.

Charge balance gives [H3O+]=[CN]+[OH][\mathrm{H_3O^+}] = [\mathrm{CN^-}] + [\mathrm{OH^-}]. Substituting [CN]=Kac/[H3O+][\mathrm{CN^-}] = K_a c/[\mathrm{H_3O^+}] (the acid is barely ionised, so [HCN]c[\mathrm{HCN}] \approx c) and [OH]=Kw/[H3O+][\mathrm{OH^-}] = K_w/[\mathrm{H_3O^+}], then multiplying through by [H3O+][\mathrm{H_3O^+}]:

[H3O+]=Kac+Kw=4.9×1015+1.0×1014=1.49×1014=1.22×107 M[\mathrm{H_3O^+}] = \sqrt{K_ac + K_w} = \sqrt{4.9 \times 10^{-15} + 1.0 \times 10^{-14}} = \sqrt{1.49 \times 10^{-14}} = 1.22 \times 10^{-7}\ \mathrm{M}

pH=log(1.22×107)=6.91\mathrm{pH} = -\log(1.22 \times 10^{-7}) = 6.91

Dropping the KwK_w term would give 4.9×1015=7.0×108\sqrt{4.9 \times 10^{-15}} = 7.0 \times 10^{-8} and pH=7.15\mathrm{pH} = 7.15 — an acidic solution reported as basic.

(b) Hydrochloric acid ionises completely, so it supplies 1.0×108 M1.0 \times 10^{-8}\ \mathrm{M} of hydrogen ion, one hundredth of what pure water already holds. The exact result comes from the same charge balance with CaC_a the acid concentration:

[H3O+]=Ca+Ca2+4Kw2=1.0×108+1.0×1016+4.0×10142[\mathrm{H_3O^+}] = \frac{C_a + \sqrt{C_a^{2} + 4K_w}}{2} = \frac{1.0 \times 10^{-8} + \sqrt{1.0 \times 10^{-16} + 4.0 \times 10^{-14}}}{2}

=1.0×108+2.00×1072=1.05×107 MpH=6.98= \frac{1.0 \times 10^{-8} + 2.00 \times 10^{-7}}{2} = 1.05 \times 10^{-7}\ \mathrm{M} \qquad \mathrm{pH} = 6.98

Ans: (a) pH=6.91\mathrm{pH} = 6.91; (b) pH=6.98\mathrm{pH} = 6.98 Watch out: The naive answer to (b) is pH=8\mathrm{pH} = 8, which claims that adding acid to water made it basic. Adding any acid can only push the pH below the neutral value, which is 7.007.00 at 298 K and different at other temperatures.


Question 10: Measuring a buffer's capacity

One litre of buffer contains 0.50 mol0.50\ \mathrm{mol} of CH3COOH\mathrm{CH_3COOH} and 0.50 mol0.50\ \mathrm{mol} of CH3COONa\mathrm{CH_3COONa}; Ka=1.74×105K_a = 1.74 \times 10^{-5}, so pKa=4.76\mathrm{p}K_a = 4.76. (a) Find the pH. (b) Find the pH after adding 0.050 mol0.050\ \mathrm{mol} of solid NaOH, and the buffer capacity this implies. (c) Compare with the theoretical maximum. (d) State what happens if the same 0.050 mol0.050\ \mathrm{mol} is added to one litre of the buffer after a tenfold dilution.

Answer:

(a) The salt and acid are equal, so the logarithmic term vanishes:

pH=pKa+log[salt][acid]=4.76+log1=4.76\mathrm{pH} = \mathrm{p}K_a + \log\frac{[\text{salt}]}{[\text{acid}]} = 4.76 + \log 1 = 4.76

(b) Hydroxide converts acid into its conjugate base mole for mole. Acid falls to 0.45 mol0.45\ \mathrm{mol}, salt rises to 0.55 mol0.55\ \mathrm{mol}:

pH=4.76+log0.550.45=4.76+log1.222=4.76+0.087=4.85\mathrm{pH} = 4.76 + \log\frac{0.55}{0.45} = 4.76 + \log 1.222 = 4.76 + 0.087 = 4.85

β=moles of base added per litreΔpH=0.0500.087=0.57 molL1 per pH unit\beta = \frac{\text{moles of base added per litre}}{\Delta \mathrm{pH}} = \frac{0.050}{0.087} = 0.57\ \mathrm{mol\,L^{-1}}\ \text{per pH unit}

(c) The total buffer concentration is C=0.50+0.50=1.0 MC = 0.50 + 0.50 = 1.0\ \mathrm{M}, and the buffer is sitting exactly at pH=pKa\mathrm{pH} = \mathrm{p}K_a, so it is at its most resistant:

βmax=0.576C=0.576 molL1 per pH unit\beta_{\max} = 0.576\,C = 0.576\ \mathrm{mol\,L^{-1}}\ \text{per pH unit}

The measured 0.570.57 matches, the small shortfall arising because the addition is finite while βmax\beta_{\max} is defined for an infinitesimal one.

(d) After a tenfold dilution each component is 0.050 M0.050\ \mathrm{M}, so one litre holds 0.050 mol0.050\ \mathrm{mol} of each. The ratio is unchanged and the pH is still 4.764.76, but βmax\beta_{\max} has fallen to 0.05760.0576. Adding 0.050 mol0.050\ \mathrm{mol} of NaOH now consumes every last mole of acetic acid, leaving a plain 0.050 M0.050\ \mathrm{M} sodium acetate solution at about pH=8.7\mathrm{pH} = 8.7. The buffer has not resisted, it has been destroyed.

Ans: (a) 4.764.76; (b) 4.854.85, β=0.57\beta = 0.57; (c) βmax=0.576\beta_{\max} = 0.576, in agreement; (d) same pH, one tenth the capacity, and the addition wipes the buffer out Watch out: Dilution leaves the pH alone and cuts the capacity in proportion. A question that dilutes a buffer and asks for the new pH is testing whether the ratio was seen to be unchanged.

Question 11: Building a weak-acid titration curve

25.0 mL25.0\ \mathrm{mL} of 0.100 M0.100\ \mathrm{M} CH3COOH\mathrm{CH_3COOH} (Ka=1.74×105K_a = 1.74 \times 10^{-5}) is titrated with 0.100 M0.100\ \mathrm{M} NaOH. Find the pH after adding 00, 12.512.5, 24.024.0, 25.025.0 and 26.0 mL26.0\ \mathrm{mL} of the base, and choose a suitable indicator. Work at 298 K.

Answer:

The acid taken is 25.0×0.100=2.50 mmol25.0 \times 0.100 = 2.50\ \mathrm{mmol}, so the equivalence volume is 25.0 mL25.0\ \mathrm{mL}.

At 0 mL0\ \mathrm{mL}. A weak acid alone. Here c/Ka=0.100/(1.74×105)=5.7×103c/K_a = 0.100/(1.74 \times 10^{-5}) = 5.7 \times 10^{3}, comfortably above 400, so the approximation is safe:

[H3O+]=Kac=1.74×106=1.32×103 MpH=2.88[\mathrm{H_3O^+}] = \sqrt{K_ac} = \sqrt{1.74 \times 10^{-6}} = 1.32 \times 10^{-3}\ \mathrm{M} \qquad \mathrm{pH} = 2.88

At 12.5 mL12.5\ \mathrm{mL}. Half the acid (1.25 mmol1.25\ \mathrm{mmol}) is neutralised, leaving 1.25 mmol1.25\ \mathrm{mmol} each of acid and acetate. Equal amounts in the same solution means an equal ratio:

pH=pKa=4.76\mathrm{pH} = \mathrm{p}K_a = 4.76

At 24.0 mL24.0\ \mathrm{mL}. Base added =2.40 mmol= 2.40\ \mathrm{mmol}, so acid left =0.10 mmol= 0.10\ \mathrm{mmol} and acetate formed =2.40 mmol= 2.40\ \mathrm{mmol}. Both sit in the same volume, so their ratio is the ratio of the millimoles:

pH=4.76+log2.400.10=4.76+1.38=6.14\mathrm{pH} = 4.76 + \log\frac{2.40}{0.10} = 4.76 + 1.38 = 6.14

At 25.0 mL25.0\ \mathrm{mL} (equivalence). All the acid has become acetate: 2.50 mmol2.50\ \mathrm{mmol} in 50.0 mL50.0\ \mathrm{mL}, that is 0.0500 M0.0500\ \mathrm{M}. Acetate hydrolyses as a base with

Kb=KwKa=1.0×10141.74×105=5.7×1010K_b = \frac{K_w}{K_a} = \frac{1.0 \times 10^{-14}}{1.74 \times 10^{-5}} = 5.7 \times 10^{-10}

[OH]=Kbc=(5.7×1010)(0.0500)=5.34×106 M[\mathrm{OH^-}] = \sqrt{K_bc} = \sqrt{(5.7 \times 10^{-10})(0.0500)} = 5.34 \times 10^{-6}\ \mathrm{M}

pOH=5.27pH=14.005.27=8.73\mathrm{pOH} = 5.27 \qquad \mathrm{pH} = 14.00 - 5.27 = 8.73

At 26.0 mL26.0\ \mathrm{mL}. Excess NaOH =0.10 mmol= 0.10\ \mathrm{mmol} in 51.0 mL=1.96×103 M51.0\ \mathrm{mL} = 1.96 \times 10^{-3}\ \mathrm{M}. Strong base swamps the acetate:

pOH=log(1.96×103)=2.71pH=11.29\mathrm{pOH} = -\log(1.96 \times 10^{-3}) = 2.71 \qquad \mathrm{pH} = 11.29

The steep region therefore runs from 6.146.14 at 24.0 mL24.0\ \mathrm{mL} to 11.2911.29 at 26.0 mL26.0\ \mathrm{mL}, and within the four drops from 24.924.9 to 25.1 mL25.1\ \mathrm{mL} it climbs from 7.17.1 to 10.310.3. Phenolphthalein, changing between 8.38.3 and 10.010.0, lies entirely inside it.

Ans: pH=2.88, 4.76, 6.14, 8.73, 11.29\mathrm{pH} = 2.88,\ 4.76,\ 6.14,\ 8.73,\ 11.29; use phenolphthalein Watch out: The equivalence point is at pH=8.73\mathrm{pH} = 8.73, not 77. Methyl orange, with its range 3.13.1 to 4.44.4, would have completed its change to yellow by about 8 mL8\ \mathrm{mL} — less than a third of the way to the equivalence point.


Question 12: Separating three halides with one reagent

A litre of solution is 0.10 M0.10\ \mathrm{M} in each of Cl\mathrm{Cl^-}, Br\mathrm{Br^-} and I\mathrm{I^-}. Silver nitrate solution is added drop by drop, the volume change being negligible. Give the order of precipitation, the silver ion concentration at which each salt begins, and the fraction of iodide still in solution when silver bromide starts. Take KspK_{sp} as 1.8×10101.8 \times 10^{-10} (AgCl), 5.0×10135.0 \times 10^{-13} (AgBr) and 8.3×10178.3 \times 10^{-17} (AgI).

Answer:

Each salt is AgX\mathrm{AgX}, so precipitation begins when [Ag+][X][\mathrm{Ag^+}][\mathrm{X^-}] reaches its KspK_{sp}. With every halide at 0.10 M0.10\ \mathrm{M}:

[Ag+]AgI=8.3×10170.10=8.3×1016 M[\mathrm{Ag^+}]_{\mathrm{AgI}} = \frac{8.3 \times 10^{-17}}{0.10} = 8.3 \times 10^{-16}\ \mathrm{M}

[Ag+]AgBr=5.0×10130.10=5.0×1012 M[\mathrm{Ag^+}]_{\mathrm{AgBr}} = \frac{5.0 \times 10^{-13}}{0.10} = 5.0 \times 10^{-12}\ \mathrm{M}

[Ag+]AgCl=1.8×10100.10=1.8×109 M[\mathrm{Ag^+}]_{\mathrm{AgCl}} = \frac{1.8 \times 10^{-10}}{0.10} = 1.8 \times 10^{-9}\ \mathrm{M}

The smallest requirement is met first, so iodide precipitates, then bromide, then chloride.

Silver bromide starts the moment [Ag+][\mathrm{Ag^+}] reaches 5.0×1012 M5.0 \times 10^{-12}\ \mathrm{M}. At that instant the solid silver iodide already present fixes the remaining iodide:

[I]=Ksp(AgI)[Ag+]=8.3×10175.0×1012=1.7×105 M[\mathrm{I^-}] = \frac{K_{sp}(\mathrm{AgI})}{[\mathrm{Ag^+}]} = \frac{8.3 \times 10^{-17}}{5.0 \times 10^{-12}} = 1.7 \times 10^{-5}\ \mathrm{M}

As a fraction of the original 0.10 M0.10\ \mathrm{M} that is 1.7×1041.7 \times 10^{-4}, or 0.017%0.017\%. More than 99.98%99.98\% of the iodide is in the precipitate before a single crystal of silver bromide appears, so the separation is effectively complete.

Repeating the step at the start of silver chloride, [Br]=5.0×1013/1.8×109=2.8×104 M[\mathrm{Br^-}] = 5.0 \times 10^{-13}/1.8 \times 10^{-9} = 2.8 \times 10^{-4}\ \mathrm{M}, leaving 0.28%0.28\% of the bromide — a good separation, though not as clean, because the solubility products of AgBr and AgCl differ by a smaller factor than those of AgI and AgBr.

Ans: iodide first at 8.3×1016 M8.3 \times 10^{-16}\ \mathrm{M}, bromide at 5.0×1012 M5.0 \times 10^{-12}\ \mathrm{M}, chloride at 1.8×109 M1.8 \times 10^{-9}\ \mathrm{M}; 0.017%0.017\% of the iodide remains when bromide begins Watch out: Comparing KspK_{sp} values directly is only valid because all three salts have the same 1:11{:}1 formula. Against a salt such as Ag2CrO4\mathrm{Ag_2CrO_4}, whose KspK_{sp} contains [Ag+]2[\mathrm{Ag^+}]^{2}, the required silver concentration must be computed before any ranking is attempted.