The Question an Equilibrium Constant Answers

A mixture of reactants and products that has reached equilibrium is called an equilibrium mixture. Its composition stops changing, but the composition it settles at is not fixed by nature alone — it depends on how much of each substance was put into the vessel to begin with.

Take the same reversible reaction and run it three times with different starting amounts. Three different equilibrium mixtures come out. So the individual equilibrium concentrations are of no use as a fingerprint of the reaction; they change from run to run.

What chemists wanted was a combination of those concentrations that comes out the same every time, whatever the starting mixture, so long as the temperature is unchanged. Such a number would be a property of the reaction rather than of the particular experiment.

Two Norwegian chemists, Cato Maximillian Guldberg and Peter Waage, found that combination in 1864. For a general reversible reaction

A+BC+D\mathrm{A} + \mathrm{B} \rightleftharpoons \mathrm{C} + \mathrm{D}

they proposed that the equilibrium concentrations always satisfy

Kc=[C][D][A][B]K_c = \frac{[\mathrm{C}][\mathrm{D}]}{[\mathrm{A}][\mathrm{B}]}

KcK_c is the equilibrium constant and the right-hand side is the equilibrium constant expression. The subscript cc says that the expression is written in concentrations, in mol L1\mathrm{mol\ L^{-1}}.

Why it is called the law of mass action

In the chemistry of the 1860s, concentration went by the name active mass. Guldberg and Waage's relation was a statement about active masses, and the name law of mass action has stuck to it ever since. The name is historical; the content is about concentration.

Key Point (Definition): The equilibrium mixture is the mixture of reactants and products present when a reversible reaction has reached equilibrium. Its individual concentrations depend on what was taken initially; the equilibrium constant built from them does not.

The square brackets

[A][\mathrm{A}] means the molar concentration of A. Inside an equilibrium constant expression, every square bracket is understood to be an equilibrium concentration, even though the subscript "eq" is almost never written. Concentrations measured at some random moment before equilibrium do not belong in a KcK_c expression at all.

Phase labels (s)(s), (l)(l), (g)(g) are usually dropped inside the brackets to save clutter. They still matter — Section 5 shows that pure solids and pure liquids are left out of the expression altogether — but the labels themselves are not written in the fraction.

[JEE/NEET] Every value of KcK_c carries a temperature with it. Quoting KcK_c without a temperature is like quoting a density without saying of what.

The Hydrogen-Iodine Experiments

The cleanest evidence for the law comes from the reaction of dihydrogen with iodine vapour in a sealed vessel at 731 K731\ \mathrm{K}:

H2(g)+I2(g)2HI(g)\mathrm{H_2}(g) + \mathrm{I_2}(g) \rightleftharpoons \mathrm{2HI}(g)

Iodine vapour is purple and hydrogen iodide is colourless, so the colour of the vessel tracks the amount of iodine left. When the purple stops fading, equilibrium has arrived.

Six experiments were run at the same temperature. The first four started with dihydrogen and iodine only, in various proportions. The last two started with pure hydrogen iodide, so that equilibrium had to be reached from the opposite side.

All concentrations below are in units of 102 mol L110^{-2}\ \mathrm{mol\ L^{-1}}.

Expt [H2]0[\mathrm{H_2}]_0 [I2]0[\mathrm{I_2}]_0 [HI]0[\mathrm{HI}]_0 [H2][\mathrm{H_2}] [I2][\mathrm{I_2}] [HI][\mathrm{HI}]
1 2.40 1.38 0 1.14 0.120 2.52
2 2.40 1.68 0 0.920 0.200 2.96
3 2.44 1.98 0 0.770 0.310 3.34
4 1.20 1.40 0 0.208 0.408 1.98
5 0 0 3.04 0.345 0.345 2.35
6 0 0 7.58 0.860 0.860 5.86

Two things fall straight out of the numbers. In experiments 1 to 4, the moles of dihydrogen consumed equal the moles of iodine consumed and equal half the moles of hydrogen iodide formed — exactly what the balanced equation demands. In experiments 5 and 6, which started from pure hydrogen iodide, the two products come out equal: [H2]=[I2][\mathrm{H_2}] = [\mathrm{I_2}].

Trying the obvious combination first

The simplest combination anyone would try puts the product on top and the two reactants underneath, each to the first power:

[HI][H2][I2]\frac{[\mathrm{HI}]}{[\mathrm{H_2}][\mathrm{I_2}]}

Feeding the six equilibrium rows into it gives nothing like a constant.

Expt [HI][H2][I2] / L mol1\dfrac{[\mathrm{HI}]}{[\mathrm{H_2}][\mathrm{I_2}]}\ /\ \mathrm{L\ mol^{-1}} [HI]2[H2][I2]\dfrac{[\mathrm{HI}]^2}{[\mathrm{H_2}][\mathrm{I_2}]}
1 1842 46.4
2 1609 47.6
3 1399 46.7
4 2333 46.2
5 1974 46.4
6 792 46.4

The first column wanders over a factor of three, from 792 to 2333. It is a property of the experiment, not of the reaction.

The second column, which squares the hydrogen iodide term, sits between 46.2 and 47.6 across six wildly different starting mixtures — including two that approached equilibrium from the opposite direction. The mean value is about 46.646.6, and the spread is no bigger than the experimental error in measuring the concentrations. The figure conventionally quoted for this equilibrium, and the one used everywhere in this chapter, is 46.446.4 — the value returned by three of the six runs, including both of those that started from pure hydrogen iodide — so the small difference from the mean is a matter of convention, not of chemistry.

Six hydrogen iodide experiments giving scattered simple ratios but one constant squared ratio

What the square was doing there

The power 2 on [HI][\mathrm{HI}] is not a fitting parameter that happened to work. It is the coefficient of HI\mathrm{HI} in the balanced equation H2+I22HI\mathrm{H_2} + \mathrm{I_2} \rightleftharpoons \mathrm{2HI}. The powers on [H2][\mathrm{H_2}] and [I2][\mathrm{I_2}] are 1, and those are their coefficients too.

Repeat the exercise on any other reversible reaction and the same pattern appears: the combination that stays constant is the one in which every concentration is raised to its own stoichiometric coefficient. So for this reaction

Kc=[HI]2[H2][I2]=46.4 at 731 KK_c = \frac{[\mathrm{HI}]^2}{[\mathrm{H_2}][\mathrm{I_2}]} = 46.4 \ \text{at}\ 731\ \mathrm{K}

[Board] The experimental point worth remembering is that experiments 5 and 6 started from pure HI\mathrm{HI} and still landed on the same constant. A relation that survives approach from both directions is a genuine property of the equilibrium state.

The Law of Chemical Equilibrium

Generalising the hydrogen-iodine result to any balanced reversible reaction

aA+bBcC+dDa\mathrm{A} + b\mathrm{B} \rightleftharpoons c\mathrm{C} + d\mathrm{D}

gives the central equation of this chapter:

Kc=[C]c[D]d[A]a[B]bK_c = \frac{[\mathrm{C}]^c[\mathrm{D}]^d}{[\mathrm{A}]^a[\mathrm{B}]^b}

Key Point (Definition): Law of Chemical Equilibrium (Equilibrium Law). At a given temperature, the product of the equilibrium concentrations of the products, each raised to its stoichiometric coefficient in the balanced equation, divided by the product of the equilibrium concentrations of the reactants, each raised to its stoichiometric coefficient, has a constant value.

Three separate claims are packed into that sentence, and each one is tested in exams.

The products go on top. Numerator for the right-hand side of the equation as written, denominator for the left-hand side. Flip the fraction and you have written the constant for the reverse reaction, which is a different number.

The powers are the coefficients. Not the number of atoms, not the number of bonds, not the order of the reaction. The coefficient cc that sits in front of C in the balanced equation becomes the exponent on [C][\mathrm{C}].

The equation must be balanced first. An unbalanced equation has no defensible coefficients, so it has no defensible KcK_c. Balance, then write.

Anatomy of the equilibrium constant expression built from a balanced chemical equation

Reading the general expression on real reactions

4NH3(g)+5O2(g)4NO(g)+6H2O(g)Kc=[NO]4[H2O]6[NH3]4[O2]5\mathrm{4NH_3}(g) + \mathrm{5O_2}(g) \rightleftharpoons \mathrm{4NO}(g) + \mathrm{6H_2O}(g) \qquad K_c = \frac{[\mathrm{NO}]^4[\mathrm{H_2O}]^6}{[\mathrm{NH_3}]^4[\mathrm{O_2}]^5}

N2(g)+3H2(g)2NH3(g)Kc=[NH3]2[N2][H2]3\mathrm{N_2}(g) + \mathrm{3H_2}(g) \rightleftharpoons \mathrm{2NH_3}(g) \qquad K_c = \frac{[\mathrm{NH_3}]^2}{[\mathrm{N_2}][\mathrm{H_2}]^3}

PCl5(g)PCl3(g)+Cl2(g)Kc=[PCl3][Cl2][PCl5]\mathrm{PCl_5}(g) \rightleftharpoons \mathrm{PCl_3}(g) + \mathrm{Cl_2}(g) \qquad K_c = \frac{[\mathrm{PCl_3}][\mathrm{Cl_2}]}{[\mathrm{PCl_5}]}

2SO2(g)+O2(g)2SO3(g)Kc=[SO3]2[SO2]2[O2]\mathrm{2SO_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2SO_3}(g) \qquad K_c = \frac{[\mathrm{SO_3}]^2}{[\mathrm{SO_2}]^2[\mathrm{O_2}]}

Fe3+(aq)+SCN(aq)[Fe(SCN)]2+(aq)Kc=[[Fe(SCN)]2+][Fe3+][SCN]\mathrm{Fe^{3+}}(aq) + \mathrm{SCN^-}(aq) \rightleftharpoons \mathrm{[Fe(SCN)]^{2+}}(aq) \qquad K_c = \frac{[\mathrm{[Fe(SCN)]^{2+}}]}{[\mathrm{Fe^{3+}}][\mathrm{SCN^-}]}

A coefficient of 1 gives a power of 1, which is never written.

What the law does not say

The equilibrium law is an experimental result about the equilibrium state. It is not a rate law. The exponents in a rate law come from the mechanism and have to be measured; the exponents in KcK_c come from the balanced equation and can be written down by inspection. A reaction whose rate law is first order in H2\mathrm{H_2} and half order in I2\mathrm{I_2} would still have [I2]1[\mathrm{I_2}]^1 in its KcK_c.

[JEE Main] A favourite trap is to hand you a rate law and ask for KcK_c, or to hand you the equation and ask for the rate law. The coefficients feed the equilibrium constant; only experiment feeds the rate law.

Writing the Expression: the Three Checks

Every KcK_c expression you will ever write survives three checks. Run them in order.

Check 1 — is the equation balanced? Count each element, then count the charge if ions are involved. For Cr2O72(aq)+H2O(l)2CrO42(aq)+2H+(aq)\mathrm{Cr_2O_7^{2-}}(aq) + \mathrm{H_2O}(l) \rightleftharpoons \mathrm{2CrO_4^{2-}}(aq) + \mathrm{2H^+}(aq), the charge on the left is 2-2 and on the right is 2(2)+2(+1)=22(-2) + 2(+1) = -2. Balanced.

Check 2 — are the products on top? The side written on the right of the \rightleftharpoons is the numerator, no matter which side you privately think of as "the products".

Check 3 — is every power the coefficient of that species? Read the coefficients straight off the equation and copy them up as exponents.

The same chemistry, two equations, two constants

Consider the hydrogen-iodine system written two ways at 731 K731\ \mathrm{K}:

H2(g)+I2(g)2HI(g)Kc=[HI]2[H2][I2]=46.4\mathrm{H_2}(g) + \mathrm{I_2}(g) \rightleftharpoons \mathrm{2HI}(g) \qquad K_c = \frac{[\mathrm{HI}]^2}{[\mathrm{H_2}][\mathrm{I_2}]} = 46.4

12H2(g)+12I2(g)HI(g)Kc=[HI][H2]1/2[I2]1/2=6.81\tfrac{1}{2}\mathrm{H_2}(g) + \tfrac{1}{2}\mathrm{I_2}(g) \rightleftharpoons \mathrm{HI}(g) \qquad K_c' = \frac{[\mathrm{HI}]}{[\mathrm{H_2}]^{1/2}[\mathrm{I_2}]^{1/2}} = 6.81

Same vessel, same molecules, same equilibrium mixture, same temperature — and two different numbers, because the two equations are two different bookkeeping choices. Neither is more correct than the other.

Key Point: A value of KK is meaningless without the balanced equation it belongs to. Always quote the equation alongside the number.

Fractional coefficients are allowed

12H2+12I2HI\tfrac{1}{2}\mathrm{H_2} + \tfrac{1}{2}\mathrm{I_2} \rightleftharpoons \mathrm{HI} is a legitimate balanced equation. Half a molecule is meaningless, but half a mole is not, and equilibrium constants are written on the mole scale. Fractional coefficients become fractional exponents, and fractional exponents are square roots and cube roots.

Concentrations, not moles

The brackets hold concentrations in mol L1\mathrm{mol\ L^{-1}}, never mole numbers. If a problem gives you moles, divide by the volume of the vessel before anything else. Skipping that division is the single most common arithmetic slip in this chapter, and it damages the answer by a factor of VΔnV^{\Delta n} — which is why a reaction with equal numbers of moles on both sides sometimes forgives the mistake and a reaction like N2+3H22NH3\mathrm{N_2} + \mathrm{3H_2} \rightleftharpoons \mathrm{2NH_3} never does.

The Units of KcK_c, and Why It Is Usually a Bare Number

Work out the dimensions of KcK_c from the expression itself. Each bracket carries units of mol L1\mathrm{mol\ L^{-1}}, so

units of Kc=(mol L1)(c+d)(a+b)=(mol L1)Δn\text{units of } K_c = (\mathrm{mol\ L^{-1}})^{(c+d)-(a+b)} = (\mathrm{mol\ L^{-1}})^{\Delta n}

where Δn\Delta n is the total stoichiometric coefficient of the products minus that of the reactants.

Reaction Δn\Delta n Units of KcK_c
H2+I22HI\mathrm{H_2} + \mathrm{I_2} \rightleftharpoons \mathrm{2HI} 22=02-2 = 0 none
PCl5PCl3+Cl2\mathrm{PCl_5} \rightleftharpoons \mathrm{PCl_3} + \mathrm{Cl_2} 21=12-1 = 1 mol L1\mathrm{mol\ L^{-1}}
N2+3H22NH3\mathrm{N_2} + \mathrm{3H_2} \rightleftharpoons \mathrm{2NH_3} 24=22-4 = -2 L2 mol2\mathrm{L^2\ mol^{-2}}
2SO2+O22SO3\mathrm{2SO_2} + \mathrm{O_2} \rightleftharpoons \mathrm{2SO_3} 23=12-3 = -1 L mol1\mathrm{L\ mol^{-1}}

So the units are not fixed — they change from reaction to reaction, and they vanish whenever the coefficients balance out.

Why tables print KK without units

Strictly, the quantity that belongs inside an equilibrium constant is not the concentration itself but the activity: the concentration divided by a chosen standard concentration, c=1 mol L1c^{\circ} = 1\ \mathrm{mol\ L^{-1}}.

aA=[A]ca_{\mathrm{A}} = \frac{[\mathrm{A}]}{c^{\circ}}

Dividing a concentration in mol L1\mathrm{mol\ L^{-1}} by 1 mol L11\ \mathrm{mol\ L^{-1}} leaves the number unchanged but strips the units. Every bracket in the expression becomes a pure ratio, and the constant built from pure ratios is itself a pure number.

The same argument runs for gases with the standard pressure p=1 barp^{\circ} = 1\ \mathrm{bar}, which is why KpK_p is also quoted without units.

Key Point: KK is dimensionless because each concentration (or pressure) is divided by its standard-state value of 1 mol L11\ \mathrm{mol\ L^{-1}} (or 1 bar1\ \mathrm{bar}). The numerical value is unaffected; only the units disappear. A thermodynamically dimensionless KK is what makes ΔG=RTlnK\Delta G^{\circ} = -RT\ln K legal, since you cannot take the logarithm of a quantity with units.

[Board] Board papers sometimes ask for the units of KcK_c for a stated reaction. Give (mol L1)Δn(\mathrm{mol\ L^{-1}})^{\Delta n} worked out for that reaction, and add the one-line remark that KK is treated as dimensionless when activities are used. Both halves earn marks.

What the Magnitude of KK Tells You

KcK_c has products in the numerator and reactants in the denominator. A large KcK_c therefore means the numerator dominates: at equilibrium there is far more product than reactant. A small KcK_c means the reverse.

That single observation is enough to sort every reaction into three bands.

Magnitude of KcK_c Composition of the equilibrium mixture Extent of reaction Examples
Kc>103K_c > 10^3 products predominate; very little reactant left proceeds nearly to completion 2H2+O22H2O\mathrm{2H_2} + \mathrm{O_2} \rightleftharpoons \mathrm{2H_2O} at 500 K500\ \mathrm{K}, Kc=2.4×1047K_c = 2.4 \times 10^{47}; H2+Cl22HCl\mathrm{H_2} + \mathrm{Cl_2} \rightleftharpoons \mathrm{2HCl} at 300 K300\ \mathrm{K}, Kc=4.0×1031K_c = 4.0 \times 10^{31}; H2+Br22HBr\mathrm{H_2} + \mathrm{Br_2} \rightleftharpoons \mathrm{2HBr} at 300 K300\ \mathrm{K}, Kc=5.4×1018K_c = 5.4 \times 10^{18}
103<Kc<10310^{-3} < K_c < 10^3 appreciable amounts of both reactants and products proceeds part of the way H2+I22HI\mathrm{H_2} + \mathrm{I_2} \rightleftharpoons \mathrm{2HI} at 700 K700\ \mathrm{K}, Kc=57.0K_c = 57.0; N2O42NO2\mathrm{N_2O_4} \rightleftharpoons \mathrm{2NO_2} at 298 K298\ \mathrm{K}, Kc=4.64×103K_c = 4.64 \times 10^{-3}
Kc<103K_c < 10^{-3} reactants predominate; very little product forms barely proceeds 2H2O2H2+O2\mathrm{2H_2O} \rightleftharpoons \mathrm{2H_2} + \mathrm{O_2} at 500 K500\ \mathrm{K}, Kc=4.1×1048K_c = 4.1 \times 10^{-48}; N2+O22NO\mathrm{N_2} + \mathrm{O_2} \rightleftharpoons \mathrm{2NO} at 298 K298\ \mathrm{K}, Kc=4.8×1031K_c = 4.8 \times 10^{-31}

Logarithmic scale of K showing reactant favoured, mixed and product favoured bands

The boundaries 10310^3 and 10310^{-3} are conventions, not laws of nature. A reaction with Kc=900K_c = 900 is not qualitatively different from one with Kc=1100K_c = 1100. The bands are a way of reading a number at a glance.

The pair of reactions that explains the atmosphere

N2\mathrm{N_2} and O2\mathrm{O_2} have shared the atmosphere for billions of years without turning into nitric oxide, and Kc=4.8×1031K_c = 4.8 \times 10^{-31} at 298 K298\ \mathrm{K} says why: the equilibrium mixture is essentially pure nitrogen and oxygen. Raise the temperature to the inside of a car engine and KcK_c rises by many orders of magnitude, which is where the oxides of nitrogen in exhaust gas come from.

The limit of what KK can tell you

A large KK says where the equilibrium lies. It says nothing whatever about how long the mixture takes to get there.

2H2(g)+O2(g)2H2O(g)\mathrm{2H_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2H_2O}(g) has Kc=2.4×1047K_c = 2.4 \times 10^{47}, one of the largest equilibrium constants in ordinary chemistry, yet a sealed flask of the two gases at room temperature will sit unchanged for years. The equilibrium position is overwhelmingly on the water side; the rate of getting there is negligible until a spark supplies the activation energy.

Key Point: KK is a thermodynamic quantity and fixes only the extent of reaction. Rate is a kinetic quantity fixed by activation energy. A huge KK with a huge activation energy gives a reaction that will go far but has not yet started.

[NEET] The statement "a reaction with a large KcK_c is a fast reaction" is false, and it appears as a distractor almost every year.

Manipulating Equilibria: Three Rules

Equations get rewritten — reversed, halved, doubled, added together. Each rewriting changes KK in a way that follows straight from the algebra of the expression.

Rule 1 — reversing a reaction inverts KK

For H2(g)+I2(g)2HI(g)\mathrm{H_2}(g) + \mathrm{I_2}(g) \rightleftharpoons \mathrm{2HI}(g) at 731 K731\ \mathrm{K},

Kc=[HI]2[H2][I2]=46.4K_c = \frac{[\mathrm{HI}]^2}{[\mathrm{H_2}][\mathrm{I_2}]} = 46.4

Write the same chemistry backwards, 2HI(g)H2(g)+I2(g)\mathrm{2HI}(g) \rightleftharpoons \mathrm{H_2}(g) + \mathrm{I_2}(g). The products of the new equation are the reactants of the old, so the fraction turns over:

Kc=[H2][I2][HI]2=1Kc=146.4=2.16×102K_c' = \frac{[\mathrm{H_2}][\mathrm{I_2}]}{[\mathrm{HI}]^2} = \frac{1}{K_c} = \frac{1}{46.4} = 2.16 \times 10^{-2}

Nothing physical has happened. The same vessel holds the same equilibrium mixture; only the direction in which the equation was typed has changed.

Rule 2 — multiplying the equation by nn raises KK to the power nn

Multiply every coefficient in H2+I22HI\mathrm{H_2} + \mathrm{I_2} \rightleftharpoons \mathrm{2HI} by nn:

nH2(g)+nI2(g)2nHI(g)n\mathrm{H_2}(g) + n\mathrm{I_2}(g) \rightleftharpoons \mathrm{2}n\mathrm{HI}(g)

Every exponent in the expression is multiplied by nn as well:

Kc=[HI]2n[H2]n[I2]n=([HI]2[H2][I2])n=(Kc)nK_c'' = \frac{[\mathrm{HI}]^{2n}}{[\mathrm{H_2}]^n[\mathrm{I_2}]^n} = \left(\frac{[\mathrm{HI}]^2}{[\mathrm{H_2}][\mathrm{I_2}]}\right)^{n} = (K_c)^n

Two cases worth having at your fingertips. With n=2n = 2:

2H2+2I24HIKc=(46.4)2=2.15×103\mathrm{2H_2} + \mathrm{2I_2} \rightleftharpoons \mathrm{4HI} \qquad K_c'' = (46.4)^2 = 2.15 \times 10^{3}

With n=12n = \tfrac{1}{2}:

12H2+12I2HIKc=(46.4)1/2=6.81\tfrac{1}{2}\mathrm{H_2} + \tfrac{1}{2}\mathrm{I_2} \rightleftharpoons \mathrm{HI} \qquad K_c'' = (46.4)^{1/2} = 6.81

Halving the equation takes the square root of KK; it does not halve KK. That confusion is the most expensive mistake in this section.

Rule 3 — adding two equilibria multiplies their constants

Suppose two equilibria, at the same temperature, share a species:

N2(g)+O2(g)2NO(g)K1=[NO]2[N2][O2]\mathrm{N_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO}(g) \qquad K_1 = \frac{[\mathrm{NO}]^2}{[\mathrm{N_2}][\mathrm{O_2}]}

2NO(g)+O2(g)2NO2(g)K2=[NO2]2[NO]2[O2]\mathrm{2NO}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO_2}(g) \qquad K_2 = \frac{[\mathrm{NO_2}]^2}{[\mathrm{NO}]^2[\mathrm{O_2}]}

Add the two equations. 2NO\mathrm{2NO} appears once on the right and once on the left, so it cancels:

N2(g)+2O2(g)2NO2(g)\mathrm{N_2}(g) + \mathrm{2O_2}(g) \rightleftharpoons \mathrm{2NO_2}(g)

Multiply the two expressions and the shared [NO]2[\mathrm{NO}]^2 cancels in exactly the same way:

K1×K2=[NO]2[N2][O2]×[NO2]2[NO]2[O2]=[NO2]2[N2][O2]2=K3K_1 \times K_2 = \frac{[\mathrm{NO}]^2}{[\mathrm{N_2}][\mathrm{O_2}]} \times \frac{[\mathrm{NO_2}]^2}{[\mathrm{NO}]^2[\mathrm{O_2}]} = \frac{[\mathrm{NO_2}]^2}{[\mathrm{N_2}][\mathrm{O_2}]^2} = K_3

The cancellation of the species in the equations mirrors the cancellation of the brackets in the fractions, which is the whole reason the rule works. With K1=4.8×1031K_1 = 4.8 \times 10^{-31} and K2=2.2×1012K_2 = 2.2 \times 10^{12} at 298 K298\ \mathrm{K},

K3=(4.8×1031)(2.2×1012)=1.1×1018K_3 = (4.8 \times 10^{-31})(2.2 \times 10^{12}) = 1.1 \times 10^{-18}

Subtracting one equation from another divides the constants, since subtraction is addition of the reversed equation.

The rules in one table

Operation on the equation Effect on KK
aA+bBcC+dDa\mathrm{A} + b\mathrm{B} \rightleftharpoons c\mathrm{C} + d\mathrm{D} KcK_c
reverse it: cC+dDaA+bBc\mathrm{C} + d\mathrm{D} \rightleftharpoons a\mathrm{A} + b\mathrm{B} 1/Kc1/K_c
multiply through by nn (Kc)n(K_c)^n
halve it (Kc)1/2(K_c)^{1/2}
add two equations K1×K2K_1 \times K_2
subtract one from another K1/K2K_1 / K_2

Logarithms make the pattern obvious: reversing changes the sign of logK\log K, scaling by nn multiplies logK\log K by nn, and adding equations adds their logK\log K values.

Key Point: Addition and subtraction of equations become multiplication and division of KK. Multiplication of an equation becomes exponentiation of KK. Never add or multiply KK values themselves.

[JEE Main] Multi-step questions usually combine two rules: reverse one equation and halve it, so KK becomes (1/K)1/2(1/K)^{1/2}. Do the operations one at a time and write the intermediate constant down.

Worked Questions

Question 1: Writing the expression from a balanced equation

Write the equilibrium constant expression for 4NH3(g)+5O2(g)4NO(g)+6H2O(g)\mathrm{4NH_3}(g) + \mathrm{5O_2}(g) \rightleftharpoons \mathrm{4NO}(g) + \mathrm{6H_2O}(g)

Answer:

First I check the equation is balanced. Nitrogen: 4 on each side. Hydrogen: 12 on each side. Oxygen: 10 on the left, 4+6=104 + 6 = 10 on the right. Balanced.

The right-hand side goes in the numerator, the left-hand side in the denominator.

Each power is that species' coefficient: 4 for NO\mathrm{NO}, 6 for H2O\mathrm{H_2O}, 4 for NH3\mathrm{NH_3}, 5 for O2\mathrm{O_2}.

Ans: Kc=[NO]4[H2O]6[NH3]4[O2]5K_c = \dfrac{[\mathrm{NO}]^4[\mathrm{H_2O}]^6}{[\mathrm{NH_3}]^4[\mathrm{O_2}]^5} Watch out: Water is a gas here, so it stays in the expression. Liquid water in an aqueous equilibrium would be left out.

Question 2: KcK_c from equilibrium concentrations

At 800 K800\ \mathrm{K} the equilibrium concentrations for N2(g)+O2(g)2NO(g)\mathrm{N_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO}(g) are [N2]=3.0×103 M[\mathrm{N_2}] = 3.0 \times 10^{-3}\ \mathrm{M}, [O2]=4.2×103 M[\mathrm{O_2}] = 4.2 \times 10^{-3}\ \mathrm{M} and [NO]=2.8×103 M[\mathrm{NO}] = 2.8 \times 10^{-3}\ \mathrm{M}. Calculate KcK_c.

Answer:

I write the expression first.

Kc=[NO]2[N2][O2]K_c = \frac{[\mathrm{NO}]^2}{[\mathrm{N_2}][\mathrm{O_2}]}

Then I substitute.

Kc=(2.8×103)2(3.0×103)(4.2×103)=7.84×1061.26×105K_c = \frac{(2.8 \times 10^{-3})^2}{(3.0 \times 10^{-3})(4.2 \times 10^{-3})} = \frac{7.84 \times 10^{-6}}{1.26 \times 10^{-5}}

Ans: Kc=0.622K_c = 0.622 (dimensionless, since Δn=0\Delta n = 0) Watch out: Dropping the square on [NO][\mathrm{NO}] gives 2.8×103/1.26×105=2222.8 \times 10^{-3}/1.26 \times 10^{-5} = 222, which is off by a factor of 357.

Question 3: KcK_c for the synthesis of ammonia

At 500 K500\ \mathrm{K} the equilibrium concentrations for N2(g)+3H2(g)2NH3(g)\mathrm{N_2}(g) + \mathrm{3H_2}(g) \rightleftharpoons \mathrm{2NH_3}(g) are [N2]=1.5×102 M[\mathrm{N_2}] = 1.5 \times 10^{-2}\ \mathrm{M}, [H2]=3.0×102 M[\mathrm{H_2}] = 3.0 \times 10^{-2}\ \mathrm{M} and [NH3]=1.2×102 M[\mathrm{NH_3}] = 1.2 \times 10^{-2}\ \mathrm{M}. Find KcK_c and its units.

Answer:

Kc=[NH3]2[N2][H2]3K_c = \frac{[\mathrm{NH_3}]^2}{[\mathrm{N_2}][\mathrm{H_2}]^3}

The numerator is (1.2×102)2=1.44×104(1.2 \times 10^{-2})^2 = 1.44 \times 10^{-4}.

The denominator is (1.5×102)(3.0×102)3=(1.5×102)(2.7×105)=4.05×107(1.5 \times 10^{-2})(3.0 \times 10^{-2})^3 = (1.5 \times 10^{-2})(2.7 \times 10^{-5}) = 4.05 \times 10^{-7}.

Kc=1.44×1044.05×107=355.6K_c = \frac{1.44 \times 10^{-4}}{4.05 \times 10^{-7}} = 355.6

For the units, Δn=24=2\Delta n = 2 - 4 = -2, so the units are (mol L1)2(\mathrm{mol\ L^{-1}})^{-2}.

Ans: Kc=3.56×102 L2 mol2K_c = 3.56 \times 10^{2}\ \mathrm{L^2\ mol^{-2}} Watch out: The cube on [H2][\mathrm{H_2}] is the coefficient 3, not the number of hydrogen atoms. Forgetting it gives 0.320.32 instead of 356356.

Question 4: Reversing the equation

For H2(g)+I2(g)2HI(g)\mathrm{H_2}(g) + \mathrm{I_2}(g) \rightleftharpoons \mathrm{2HI}(g), Kc=46.4K_c = 46.4 at 731 K731\ \mathrm{K}. Find KcK_c for 2HI(g)H2(g)+I2(g)\mathrm{2HI}(g) \rightleftharpoons \mathrm{H_2}(g) + \mathrm{I_2}(g) at the same temperature.

Answer:

Reversing an equation turns the equilibrium constant expression upside down, so the new constant is the reciprocal of the old one.

Kc=146.4=0.02155K_c' = \frac{1}{46.4} = 0.02155

Ans: Kc=2.16×102K_c' = 2.16 \times 10^{-2} Watch out: A reversed reaction never gets a negative KK. Equilibrium constants are ratios of concentrations and are always positive.

Question 5: Halving the equation

Using Kc=3.56×102K_c = 3.56 \times 10^{2} for N2(g)+3H2(g)2NH3(g)\mathrm{N_2}(g) + \mathrm{3H_2}(g) \rightleftharpoons \mathrm{2NH_3}(g) at 500 K500\ \mathrm{K}, find KcK_c for 12N2(g)+32H2(g)NH3(g)\tfrac{1}{2}\mathrm{N_2}(g) + \tfrac{3}{2}\mathrm{H_2}(g) \rightleftharpoons \mathrm{NH_3}(g)

Answer:

Every coefficient has been multiplied by n=12n = \tfrac{1}{2}, so the constant is raised to the power 12\tfrac{1}{2}.

Kc=(3.56×102)1/2=356K_c' = (3.56 \times 10^{2})^{1/2} = \sqrt{356}

Ans: Kc=18.9K_c' = 18.9 Watch out: Halving the equation takes the square root, not half the value. Halving 356356 to 178178 is the standard error here.

Question 6: Doubling the equation

KcK_c for H2(g)+I2(g)2HI(g)\mathrm{H_2}(g) + \mathrm{I_2}(g) \rightleftharpoons \mathrm{2HI}(g) is 46.446.4 at 731 K731\ \mathrm{K}. Find KcK_c for 2H2(g)+2I2(g)4HI(g)\mathrm{2H_2}(g) + \mathrm{2I_2}(g) \rightleftharpoons \mathrm{4HI}(g).

Answer:

Here n=2n = 2, so the constant is squared.

Kc=(46.4)2=2153K_c' = (46.4)^2 = 2153

Ans: Kc=2.15×103K_c' = 2.15 \times 10^{3}

Question 7: A reversal and a scaling together

At a certain temperature Kc=2.8×102K_c = 2.8 \times 10^{2} for 2SO2(g)+O2(g)2SO3(g)\mathrm{2SO_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2SO_3}(g). Find KcK_c for SO3(g)SO2(g)+12O2(g)\mathrm{SO_3}(g) \rightleftharpoons \mathrm{SO_2}(g) + \tfrac{1}{2}\mathrm{O_2}(g)

Answer:

I take the two operations one at a time.

Step one: reverse the given equation to get 2SO32SO2+O2\mathrm{2SO_3} \rightleftharpoons \mathrm{2SO_2} + \mathrm{O_2}. The constant becomes

12.8×102=3.571×103\frac{1}{2.8 \times 10^{2}} = 3.571 \times 10^{-3}

Step two: halve that equation to get the target. The constant is raised to the power 12\tfrac{1}{2}.

Kc=(3.571×103)1/2=5.98×102K_c' = (3.571 \times 10^{-3})^{1/2} = 5.98 \times 10^{-2}

Ans: Kc6.0×102K_c' \approx 6.0 \times 10^{-2} Watch out: The order of the two steps does not matter — (1K)1/2\left(\tfrac{1}{K}\right)^{1/2} and 1K1/2\tfrac{1}{K^{1/2}} are the same number — but doing both in one line invites an error. Write the intermediate value down.

Question 8: Adding two equilibria

At 298 K298\ \mathrm{K}: N2(g)+O2(g)2NO(g)K1=4.8×1031\mathrm{N_2}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO}(g) \qquad K_1 = 4.8 \times 10^{-31} 2NO(g)+O2(g)2NO2(g)K2=2.2×1012\mathrm{2NO}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO_2}(g) \qquad K_2 = 2.2 \times 10^{12} Find KK for N2(g)+2O2(g)2NO2(g)\mathrm{N_2}(g) + \mathrm{2O_2}(g) \rightleftharpoons \mathrm{2NO_2}(g).

Answer:

I add the two equations. On the left I get N2+O2+2NO+O2\mathrm{N_2} + \mathrm{O_2} + \mathrm{2NO} + \mathrm{O_2} and on the right 2NO+2NO2\mathrm{2NO} + \mathrm{2NO_2}.

2NO\mathrm{2NO} appears on both sides and cancels, leaving N2+2O22NO2\mathrm{N_2} + \mathrm{2O_2} \rightleftharpoons \mathrm{2NO_2}, which is the target.

Adding equations multiplies the constants.

K3=K1K2=(4.8×1031)(2.2×1012)=1.056×1018K_3 = K_1 K_2 = (4.8 \times 10^{-31})(2.2 \times 10^{12}) = 1.056 \times 10^{-18}

Ans: K3=1.1×1018K_3 = 1.1 \times 10^{-18} Watch out: Adding the two KK values gives 2.2×10122.2 \times 10^{12}, essentially K2K_2 alone, because K1K_1 is negligible beside it. That answer looks plausible and is wrong.

Question 9: Units and the dimensionless convention

State the units of KcK_c for PCl5(g)PCl3(g)+Cl2(g)\mathrm{PCl_5}(g) \rightleftharpoons \mathrm{PCl_3}(g) + \mathrm{Cl_2}(g) and for 2NO(g)+O2(g)2NO2(g)\mathrm{2NO}(g) + \mathrm{O_2}(g) \rightleftharpoons \mathrm{2NO_2}(g), and explain why data tables print both constants without units.

Answer:

The units are (mol L1)Δn(\mathrm{mol\ L^{-1}})^{\Delta n}.

For the phosphorus pentachloride equilibrium, Δn=21=1\Delta n = 2 - 1 = 1, giving mol L1\mathrm{mol\ L^{-1}}.

For the nitric oxide equilibrium, Δn=23=1\Delta n = 2 - 3 = -1, giving L mol1\mathrm{L\ mol^{-1}}.

Tables print bare numbers because each concentration is divided by the standard concentration c=1 mol L1c^{\circ} = 1\ \mathrm{mol\ L^{-1}} before it enters the expression. The numerical value is unchanged and the units cancel.

Ans: mol L1\mathrm{mol\ L^{-1}} and L mol1\mathrm{L\ mol^{-1}} respectively; both are quoted as pure numbers once activities are used.

Question 10: Reading the magnitude

Three reactions have Kc=5.4×1018K_c = 5.4 \times 10^{18}, Kc=4.64×103K_c = 4.64 \times 10^{-3} and Kc=4.1×1048K_c = 4.1 \times 10^{-48} at the stated temperatures. Describe the equilibrium mixture in each case, and say which of the three is the fastest.

Answer:

5.4×10185.4 \times 10^{18} is far above 10310^3, so products predominate and the reaction goes nearly to completion. Reactant is present but in vanishing amounts.

4.64×1034.64 \times 10^{-3} lies inside the band 10310^{-3} to 10310^3, so reactants and products are both present in appreciable amounts.

4.1×10484.1 \times 10^{-48} is far below 10310^{-3}, so reactants predominate and almost no product forms.

Ans: Products predominate; both present appreciably; reactants predominate. The question of which is fastest cannot be answered, because KK carries no information about rate. Watch out: The equilibrium constant is thermodynamic. Ranking reactions by speed from their KK values is the trap the question is built around.

Question 11: Two forms of one equation

A student measures Kc=6.81K_c = 6.81 for 12H2+12I2HI\tfrac{1}{2}\mathrm{H_2} + \tfrac{1}{2}\mathrm{I_2} \rightleftharpoons \mathrm{HI} and a classmate measures Kc=46.4K_c = 46.4 for the same equilibrium mixture. Both are correct. Explain.

Answer:

The two are working from different balanced equations for the same chemistry.

The classmate has written H2+I22HI\mathrm{H_2} + \mathrm{I_2} \rightleftharpoons \mathrm{2HI}, whose expression is [HI]2/[H2][I2][\mathrm{HI}]^2/[\mathrm{H_2}][\mathrm{I_2}].

The student has halved every coefficient, so the expression becomes [HI]/[H2]1/2[I2]1/2[\mathrm{HI}]/[\mathrm{H_2}]^{1/2}[\mathrm{I_2}]^{1/2}, which is the square root of the first.

46.4=6.81\sqrt{46.4} = 6.81, so the two numbers describe one equilibrium mixture.

Ans: Halving the equation takes the square root of KK; both values are correct for the equations they belong to. Watch out: A value of KK quoted without its balanced equation is unusable. Always write the equation beside the number.